Concept explainers
Interpretation:
The standard enthalpies of formation of
Concept Introduction:
The change in enthalpy that is associated with the formation of one mole of a substance from its related elements being in standard state is called standard enthalpy of formation (
The standard enthalpy of reaction is the enthalpy of reaction that takes place under standard conditions.
The equation for determining the standard enthalpies of compound and element can be given by,
Answer to Problem 6.125QP
Standard enthalpy of formation of
Standard enthalpy of formation of
Change in enthalpy of formation of
Explanation of Solution
The chemical equations can be given,
Using the values of standard enthalpies of formation,
Standard enthalpy of formation of
Standard enthalpy of formation of Water =
The equations can be given as,
The equations are summed up to get the standard enthalpy of formation of
Therefore, standard enthalpy of formation of
Similarly, the equations are summed up to get the standard enthalpy of formation of
To calculate the change in enthalpy of formation of
The equation can be given as,
Change in enthalpy of formation of
The change in enthalpy of formation of
Want to see more full solutions like this?
Chapter 6 Solutions
Combo: Loose Leaf For Chemistry With Connect 2-year Access Card
- A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forwardCompounds with carboncarbon double bonds, such as ethylene, C2H4, add hydrogen in a reaction called hydrogenation. C2H4(g)+H2(g)C2H6(g) Calculate the enthalpy change for this reaction, using the following combustion data: C2H4(g)+3O2(g)2CO2(g)+2H2O(l);H=1411kJC2H6(g)+72O2(g)2CO2(g)+3H2O(l);H=1560kJH2(g)+12O2(g)H2O(l);H=286kJarrow_forwardA 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?arrow_forward
- Chloroform, CHCl3, is formed from methane and chlorine in the following reaction. CH4(g) + 3 Cl2(g) 3 HCl(g) + CHCl3(g) Calculate rH, the enthalpy change for this reaction, using the enthalpies of formation of CO2(g), H2O(), CHCI3(g) (fH = 103.1 kJ/mol), and the enthalpy changes for the following reactions: CH4(g) + 2 O2(g) 2 H2O() + CO2(g) rH = 890.4 kJ/mol-rxn 2 HCl(g) H2(g) + Cl2(g) rH = +184.6 kJ/mol-ransarrow_forwardThe standard molar enthalpy of formation of diborane, B2H6(g), cannot be determined directly because the compound cannot be prepared by the reaction of boron and hydrogen. It can be calculated from other enthalpy changes, however. The following enthalpy changes can be measured. 4 B(s) + 3 O2(g) 2 B2O3(s) rH = 2543.8 kJ/mol-rxn H2(g) + O2(g) H2O(g) rH = 241.8 kl/mol-rxn B2H6(g) + 3 O2(g) B2O3(s) + 3 H2O(g) rH = 2032.9 kJ/mol-rxn (a) Show how these equations can be added together to give the equation for the formation of B2H6(g) from B(s) and H2(g) in their standard states. Assign enthalpy changes to each reaction. (b) Calculate fH for B2H6(g). (c) Draw an energy level diagram that shows how the various enthalpies in this problem are related. (d) Is the formation of B2H6(g) from its elements exo- or endothermic?arrow_forwardThe combustion of 1.00 mol liquid methyl alcohol (CH3OH) in excess oxygen is exothermic, giving 727 kJ of heat. (a) Write the thermochemical equation for this reaction. (b) Calculate the enthalpy change that accompanies the burning 10.0 g methanol. (c) Compare this with the amount of heat produced by 10.0 g octane, C8H18, a component of gasoline (see Exercise 5.41).arrow_forward
- Salicylic acid, C7H6O3, is one of the starting materials in the manufacture of aspirin. When 1.00 g of salicylic acid burns in a bomb calorimeter, the temperature of the bomb and water goes from 23.11C to 28.91C. The calorimeter and water absorb 21.9 kJ of heat. How much heat is given off when one mole of salicylic acid burns?arrow_forwardWhich of the enthalpies of combustion in Table 5.2 the table are also standard enthalpies of formation?arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forward
- The Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forwardMethanol (CH3OH) has also been proposed as an alternative fuel. Calculate the standard enthalpy of combustion per gram of liquid methanol, and compare this answer to that for ethanol in Exercise 87.arrow_forwardAssume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)arrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning