Concept explainers
(a)
Interpretation: The value of the equilibrium constant for the given reaction needs to be determined.
Concept Introduction: An acid is the substance that gives H+ or
The acid dissociation constant is the ratio of concentration of product and reactant for the equilibrium reaction of weak acid in solution. For the given weak acid HA, it can be written as:
(a)
Answer to Problem 153CP
Keq =
Explanation of Solution
The equilibrium constant for the given reaction can be written as:
(b)
Interpretation: The relation between
Concept Introduction: An acid is the substance that gives H+ or
The acid dissociation constant is the ratio of concentration of product and reactant for the equilibrium reaction of weak acid in solution. For the given weak acid HA, it can be written as:
(b)
Answer to Problem 153CP
At equilibrium, [
Explanation of Solution
The equilibrium constant for the given reaction can be written as:
Hence at equilibrium, [
(c)
Interpretation: The expression for the pH of the solution in terms of Ka1and Ka2 for the given reaction needs to be determined.
Concept Introduction: An acid is the substance that gives H+ or
The acid dissociation constant is the ratio of concentration of product and reactant for the equilibrium reaction of weak acid in solution. For the given weak acid HA, it can be written as:
(c)
Answer to Problem 153CP
Explanation of Solution
The equilibrium constant for the given reaction can be written as:
(d)
Interpretation: The value of pH of
Concept Introduction: An acid is the substance that gives H+ or
The acid dissociation constant is the ratio of concentration of product and reactant for the equilibrium reaction of weak acid in solution. For the given weak acid HA, it can be written as:
(d)
Answer to Problem 153CP
Explanation of Solution
The hydrogen ion concentration can be calculated as follows:
Substitute the values of Ka1 and Ka2:
Calculate pH:
Want to see more full solutions like this?
Chapter 7 Solutions
Chemical Principles
- What is meant by the presence of a common ion? How does the presence of a common ion affect an equilibrium such as HNO2(aq) H+(aq) + NO2-(aq) What is an acidbase solution called that contains a common ion?arrow_forwardSeveral acids are listed here with their respective equilibrium constants: HF(aq) + H2O() H3O+(aq) + F(aq) Ka = 7.2 104 HPO42(aq) + H2O() H3O+(aq) + PO43(aq) Ka = 3.6 1013 CH3CO2(H) + H2O() H3O+(aq) + CH3CO2(aq) Ka = 1.8 105 (a) Which is the strongest acid? Which is the weakest acid? (b) What is the conjugate base of the acid I IF? (c) Which acid has the weakest conjugate base? (d) Which acid has the strongest conjugate base?arrow_forwardFrom the equilibrium concentrations given, calculate Ka for each of the weak acids and Kb, for each of the weak bases. (a). CH3CO2H:[H3O+]=1.34103M;[CH3CO2]=1.34103M;[CH3CO2H]=9.866102M; (b). ClO:[OH]=4.0104M;[HClO]=2.38105M;[ClO]=0.273M; (c). HCO2H:[HCO2H]=0.524M;[H3O+]=9.8103M;[HCO2]=9.8103M; (d). C6H5NH3+:[C6H5NH3+]=0.233M;[C6H5NH2]=2.3103M;[H3O+]=2.3103Marrow_forward
- Barbituric acid, HC4H3N2O3, is used to prepare barbiturates, a class of drugs used as sedatives. Its Ka is 9.8105. Calculate [H+] in solutions prepared by adding enough water to the following to make 1.45 L. (a) 0.344 mol (b) 28.9 garrow_forwardSeveral acids are listed here with their respective equilibrium constants: C6H5OH(aq) + H2O() H3O+(aq) + C6H5O(aq) Ka = 1.3 1010 HCO2H(aq) + H2O() H3O+(aq) + HCO2(aq) Ka = 1.8 104 HC2O4(aq) H2O() H3O+(aq) + C2O42(aq) Ka = 6.4 105 (a) Which is the strongest acid? Which is the weakest acid? (b) Which acid has the weakest conjugate base? (c) Which acid has the strongest conjugate base?arrow_forward(a) Which is the stronger Bronsted acid, HCO3 or NH4+? Which has the stronger conjugate base? (b) Is a reaction between HCO3- ions and NH3 product- or reactant-favored at equilibrium? HCO3(aq) + NH3(aq) CO32(aq) + NH4+(aq) (c) You mix solutions of sodium hydrogen phosphate and ammonia. The net ionic equation for a possible reaction is HPO42(aq) + NH3(aq) PO43(aq) + NH4+(aq) Does the equilibrium lie to the left or to the right for this reaction?arrow_forward
- 12.63 For each of the following reactions, indicate the Bronsted-Lowrv acids and bases. What are the conjugate acid-base pairs? CN’(aq) + H2O(€) «=* HCN(aq) + OH’(aq) HCO}-(aq) + H,o+(aq) +* H2CO,(aq) + H,O(€) (C) CH,CtX)H(aq) + HS~(aq)i=i CH}COO"(aq) + H2S(aq)arrow_forwardThe following illustration displays the relative number of species when an acid, HA, is added to water. a. Is HA a weak or strong acid? How can you tell? b. Using the relative numbers given in the illustration, determine the value for Ka and the percent dissociation of the acid. Assume the initial acid concentration is 0.20 M.arrow_forwardCalculate [CO32] in a 0.010-M solution of CO2 in water (usually written as H2CO3). If all the CO32 in this solution comes from the reaction HCO3(aq)H+(aq)+CO32(aq) what percentage of the H+ ions in the solution is a result of the dissociation of HCO3? When acid is added to a solution of sodium hydrogen carbonate (NaHCO3), vigorous bubbling occurs. How is this reaction related to the existence of carbonic acid (H2CO3) molecules in aqueous solution?arrow_forward
- Calculate the equilibrium concentration of the non-ionized acids and all ions in a solution that is 0.25 M in HCO2H and 0.10 M in HClO.arrow_forwardFor each of the following reactions, predict whether the equilibrium lies predominantly to the left or to the right. Explain your predictions briefly. (a) H2S(aq) + CO32(aq) HS(aq) + HCO3(aq) (b) HCN(aq) + SO42(aq) CN(aq) + HSO4(aq) (c) SO42(aq) + CH3CO2H(aq) HSO4(aq) + CH3CO2(aq)arrow_forwardWhat is [OH-] in a solution of 1.25 M NH3 and 0.78 M NH4NO3?. NH3(aq)+H2O(l)NH4+(aq)+OH(aq)Kb=1.8105arrow_forward
- Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning