Introductory Chemistry Essentials (5th Edition) - Standalone book
5th Edition
ISBN: 9780321919052
Author: Nivaldo J. Tro
Publisher: PEARSON
expand_more
expand_more
format_list_bulleted
Concept explainers
Textbook Question
Chapter 8, Problem 87E
Hydrogen gas can be prepared in the laboratory by a single-displacement reaction in which solid zinc reacts with hydrochloric acid. How much zinc in grams is required to make 14.5 g of hydrogen gas through this reaction?
Expert Solution & Answer
Learn your wayIncludes step-by-step video
schedule06:34
Chapter 8 Solutions
Introductory Chemistry Essentials (5th Edition) - Standalone book
Ch. 8 - Q1. Sulfur and fluorine react to form sulfur...Ch. 8 - Hydrogen chloride gas and oxygen gas react to form...Ch. 8 - Sodium reacts with fluorine to form sodium...Ch. 8 - Consider the hypothetical reaction shown here. If...Ch. 8 - Prob. 5SAQCh. 8 - Prob. 6SAQCh. 8 - Sodium and chlorine react to form sodium chloride....Ch. 8 - A reaction has a theoretical yield of 22.8 g. when...Ch. 8 - Titanium can be obtained from its oxide by the...Ch. 8 - Which statement best describes an exothermic...
Ch. 8 - Consider the generic reaction: A+2BAB2Hrxn=155kJ...Ch. 8 - Q12. Hydrogen gas reacts with oxygen to form...Ch. 8 - Prob. 1ECh. 8 - Nitrogen and hydrogen can react to from ammonia:...Ch. 8 - Prob. 3ECh. 8 - Prob. 4ECh. 8 - 5 what is the general from of the solution map...Ch. 8 - 6. Consider the recipe for making tomato and...Ch. 8 - 7 In a chemical reaction, what is the limiting...Ch. 8 - Prob. 8ECh. 8 - In a chemical reaction, what are the actual yield...Ch. 8 - If you are given a chemical equation and specific...Ch. 8 - 11. Consider the generic chemical...Ch. 8 - Prob. 12ECh. 8 - Prob. 13ECh. 8 - Explain the relationship between the sign of Hrxn...Ch. 8 - Consider the generic chemical reaction: A+2BC How...Ch. 8 - Prob. 16ECh. 8 - 17. For the reaction shown, calculate how many...Ch. 8 - 18. For the reaction shown, calculate how many...Ch. 8 - 19. Dihydrogen monosulfide reacts with sulfur...Ch. 8 - 20. Chlorine gas reacts with fluorine gas...Ch. 8 - For each reaction, calculate how many moles of...Ch. 8 - 22. For each reaction, calculate how many moles of...Ch. 8 - 23. For the reaction shown, calculate how many...Ch. 8 - 24. For the reaction shown, calculate how many...Ch. 8 - Consider the balanced equation:...Ch. 8 - 26. Consider the balance equation:
Complete the...Ch. 8 - 27. Consider the unbalanced equation for the...Ch. 8 - Prob. 28ECh. 8 - 29. Consider the unbalanced equation for the...Ch. 8 - 30. Consider the unbalanced equation for the...Ch. 8 - Prob. 31ECh. 8 - 32. For the reaction shown, calculate how many...Ch. 8 - For each of the reactions, calculate how many...Ch. 8 - 34. For each of the reactions, calculate how many...Ch. 8 - 35. For the reaction shown, calculate how many...Ch. 8 - 36. For the reaction shown, calculate how many...Ch. 8 - Prob. 37ECh. 8 - Consider the balanced equation for the combustion...Ch. 8 - 39. For each acid–base reaction, calculate how...Ch. 8 - 40. For each precipitation reaction, calculate how...Ch. 8 - Sulfuric acid can dissolve aluminum metal...Ch. 8 - Hydrochloric acid can dissolve solid iron...Ch. 8 - 43. Consider the generic chemical equation:
a....Ch. 8 - Prob. 44ECh. 8 - Prob. 45ECh. 8 - Prob. 46ECh. 8 - For the reaction shown, find the limiting reactant...Ch. 8 - Prob. 48ECh. 8 - 49. For the reaction shown, calculate the...Ch. 8 - For the reaction shown, calculate the theoretical...Ch. 8 - Consider the generic reaction between reactants A...Ch. 8 - Consider the reaction between reactants S and O2:...Ch. 8 - Consider the reaction 4HCI(g)+O2(g)2H2O(g)+2Cl2(g)...Ch. 8 - 54. Consider the reaction
Each molecular diagram...Ch. 8 - 55. For the reaction shown, find the limiting...Ch. 8 - For the reaction shown, find the limiting reactant...Ch. 8 - Prob. 57ECh. 8 - For the reaction shown, calculate the theoretical...Ch. 8 - 58. If the theoretical yield of a reaction is 24.8...Ch. 8 - If the theoretical yield of reaction is 0.118 g...Ch. 8 - 61. Consider the reaction between calcium oxide...Ch. 8 - Consider the reaction between sulfur trioxide and...Ch. 8 - Consider the reaction between NiS2 and O2:...Ch. 8 - LIMITING REACTANT, THEORETICAL YIELD, AND PERCENT...Ch. 8 - Lead ions can be precipitate form solution with...Ch. 8 -
Ch. 8 - Consider the reaction between TiO2 and C:...Ch. 8 - 68. Consider the raction between N2H4 and N2O4:
A...Ch. 8 - 69. Classify each process as exothermic or...Ch. 8 - 70. Classify each process as exothermic or...Ch. 8 - Consider the generic reaction: A+2BCHrxn=55kJ...Ch. 8 - Prob. 72ECh. 8 - Consider the equation for the combustion of...Ch. 8 - ENTHALPY AND STOICHIOMETRY OF Hrxn
74. The...Ch. 8 - 75. Octane (C8H18) is a component of gasoline that...Ch. 8 - Prob. 76ECh. 8 - Consider the reaction:...Ch. 8 - Prob. 78ECh. 8 - A solution contains an unknown mass of dissolved...Ch. 8 - Prob. 80ECh. 8 - Prob. 81ECh. 8 - Prob. 82ECh. 8 - 83. The combustion of gasoline produces carbon...Ch. 8 - Many home barbecues are fueled with propane gas...Ch. 8 - Prob. 85ECh. 8 - 86. Magnesium ions can be precipitated from...Ch. 8 - Hydrogen gas can be prepared in the laboratory by...Ch. 8 - Prob. 88ECh. 8 - Prob. 89ECh. 8 - Pure oxygen gas can be prepared in the laboratory...Ch. 8 - 91. Aspirin can be made in the laboratory by...Ch. 8 - 92. The combustion of liquid ethanol produces...Ch. 8 - Urea (CH4N2 O), a common fertilizer, can be...Ch. 8 - 94. Silicon, which occurs in nature as SiO2, is...Ch. 8 - 95. The ingestion of lead from food, water, or...Ch. 8 - Prob. 96ECh. 8 - The propane fuel (C3H8) used in gas barbecues...Ch. 8 - Prob. 98ECh. 8 - 99. A loud classroom demonstration involves...Ch. 8 - 100. A hydrochloric acid solution will neutralize...Ch. 8 - Prob. 101ECh. 8 - Prob. 102ECh. 8 - What volume of air is needed to burn an entire...Ch. 8 - Have each member of your group choose a...Ch. 8 - 105. Consider the combustion of propane:
a....
Additional Science Textbook Solutions
Find more solutions based on key concepts
45. Consider the reaction:
A reaction mixture in a 3.67 L flask at a certain temperature initially con...
Chemistry: Structure and Properties (2nd Edition)
Determine the number of protons, neutrons, and electrons in the following atoms: a. a hydrogen atom that has a ...
General, Organic, and Biological Chemistry (3rd Edition)
10.71 Identify each of the following as an acid or a base: (10.1)
H2SO4
RbOH
Ca(OH)2
HI
...
Chemistry: An Introduction to General, Organic, and Biological Chemistry (12th Edition) - Standalone book
Answer the following questions for each compound: a. How many signals are in its 13C NMR spectrum? b. Which sig...
Organic Chemistry
Without looking at the structures, give molecular formulas for the compounds in Problem 3-8 (a) and (b). Use th...
Organic Chemistry (9th Edition)
Calculate the lattice energy of CaCl2 using a Born-Haber cycle and data from Appendices F and L and Table 7.5. ...
Chemistry & Chemical Reactivity
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- Copper reacts with nitric acid according to the following reaction. 3Cu(s)+8HNO3(aq)3Cu(NO3)2(aq)+2NO(g)+4H2O(l) If 2.40 g of Cu is added to a container with 2.00 mL of concentrated nitric acid (70% by mass HNO3; density = 1.42 g/cm3), what mass of nitrogen monoxide gas will be produced?arrow_forwardSulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.arrow_forwardIn a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).arrow_forward
- Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?arrow_forwardMany cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?arrow_forward3.115 The average person exhales 1.0 kg of carbon dioxide in a day. Describe how you would estimate the number of CO2 molecules exhaled per breath for this average person.arrow_forward
- 4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.arrow_forward4.111 Aluminum metal reacts with sulfuric acid to form hydrogen gas and aluminum sulfate (a) Write a balanced chemical equation for this reaction. (b) Suppose that a 0.792-g sample of aluminum that contains impurities is reacted with excess sulfuric acid and 0.0813 g of H2 is collected. Assuming that none of the impurities reacts with sulfuric acid to produce hydrogen, what is the percentage of aluminum in the sample?arrow_forwardWhen potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?arrow_forward
- Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): C5H12(l)+O2(g)CO2(g)+H2O(l) If 20.4 g of pentane are burned in excess oxygen, what mass of water can be produced, assuming 100% yield?arrow_forwardOver the years, the thermite reaction has been used for welding railroad rails, in incendiary bombs, and to ignite solid fuel rocket motors. The reaction is :math>Fe2O3(s)+2Al(s)2Fe(l)+Al2O3(s) l type='a'> What mass of iron(III) oxide must be used to produce 25.69 g of iron? What mass of aluminum must be used to produce 25.69 g of iron? What is the maximum mass of aluminum oxide that could be produced along with 25.69 g of iron?arrow_forward
arrow_back_ios
arrow_forward_ios
Recommended textbooks for you
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- World of Chemistry, 3rd editionChemistryISBN:9781133109655Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCostePublisher:Brooks / Cole / Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
Chemistry: An Atoms First Approach
Chemistry
ISBN:9781305079243
Author:Steven S. Zumdahl, Susan A. Zumdahl
Publisher:Cengage Learning
Chemistry
Chemistry
ISBN:9781305957404
Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
World of Chemistry, 3rd edition
Chemistry
ISBN:9781133109655
Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste
Publisher:Brooks / Cole / Cengage Learning
Introductory Chemistry: A Foundation
Chemistry
ISBN:9781337399425
Author:Steven S. Zumdahl, Donald J. DeCoste
Publisher:Cengage Learning
Chemistry for Engineering Students
Chemistry
ISBN:9781337398909
Author:Lawrence S. Brown, Tom Holme
Publisher:Cengage Learning
Bonding (Ionic, Covalent & Metallic) - GCSE Chemistry; Author: Science Shorts;https://www.youtube.com/watch?v=p9MA6Od-zBA;License: Standard YouTube License, CC-BY
Stoichiometry - Chemistry for Massive Creatures: Crash Course Chemistry #6; Author: Crash Course;https://www.youtube.com/watch?v=UL1jmJaUkaQ;License: Standard YouTube License, CC-BY