For the gas phase decomposition of t-butyl chloride, (CH3)3CC(CH3)2C=CH2 + HCI the rate constant in s' has been determined at several temperatures. When In k is plotted against the reciprocal of the Kelvin temperature, the resulting linear plot has a slope of -2.08×104 K and a y-intercept of 28.6. The value of the rate constant for the gas phase decomposition of t-butyl chloride at 577 K is (Enter your answer to one significant figure.)

For the gas phase decomposition of t-butyl chloride, (CH3)3CC(CH3)2C=CH2 + HCI the rate constant in s' has been determined at several temperatures. When In k is plotted against the reciprocal of the Kelvin temperature, the resulting linear plot has a slope of -2.08×104 K and a y-intercept of 28.6. The value of the rate constant for the gas phase decomposition of t-butyl chloride at 577 K is (Enter your answer to one significant figure.)

Physical Chemistry

2nd Edition

ISBN:9781133958437

Author:Ball, David W. (david Warren), BAER, Tomas

Publisher:Ball, David W. (david Warren), BAER, Tomas

Chapter20: Kinetics

Section: Chapter Questions

Problem 20.38E: List at least four experimentally determined parameters that you, an experimenter, can define when...

See similar textbooks

Similar questions

The frequency factor for the second-order gas-phase decomposition of ozone at low pressures is 4.6 × 1012 dm3 mol−1 s−1 and its activation energy is 10.0 kJ mol−1. What are (i) the entropy of activation, (ii) the enthalpy of activation, (iii) the Gibbs energy of activation at 298 K? Assume κ = 1.
The frequency factor for a second-order gas-phase decomposition of a species at low pressures is 2.3 × 1013 dm3 mol−1 s−1 and its activation energy is 30.0 kJ mol−1. What are (i) the entropy of activation, (ii) the enthalpy of activation, (iii) the Gibbs energy of activation at 298 K? Assume κ = 1.
Calculate the magnitude of the diffusion-controlled rate constant at 320 K for the recombination of two atoms in benzene, for which η = 0.601 cP. Assuming the concentration of the reacting species is 2.0 mmol dm−3 initially, how long does it take for the concentration of the atoms to fall to half that value? Assume the reaction is elementary.
For the gas phase decomposition of t-butyl propionate,C2H5COOC(CH3)3(CH3)2C=CH2 + C2H5COOHthe rate constant in s-1 has been determined at several temperatures. When ln k is plotted against the reciprocal of the Kelvin temperature, the resulting linear plot has a slope of -1.97×104 K and a y-intercept of 29.5. The value of the rate constant for the gas phase decomposition of t-butyl propionate at 530 K is _______s-1. (Enter your answer to one significant figure.)
Assuming the rate law for the system is rate = k[I-]x[S2O82-]y, what is the value of x for the system? Explain your answer. What are the steps in obtaining this answer?
Some reactions proceed through a chain mechanism involving radicals, which are highly reactive species with one or more unpaired electrons. The radicals are produced in initiation steps, through either thermal or photodissociation. Reactions in which the radical centre is transferred are called propagation steps. The radicals are lost in termination steps. Consider the following chain mechanism:(1) AH → A + H·(2) A → B· + C(3) AH + B· → A + D(4) A + B· → P(a) Identify the initiation, propagation, and termination steps.(b) Use the steady-state approximation to deduce that the decompositionof AH is f irst-order in AH.
Calculate the magnitude of the diffusion-controlled rate constant at 320 K for the recombination of two atoms in water, for which η = 0.89 cP. Assuming the concentration of the reacting species is 1.5 mmol dm−3 initially, how long does it take for the concentration of the atoms to fall to half that value? Assume the reaction is elementary.
Sucrose is hydrolyzed to glucose and fructose in a classic experiment in kinetics. The reaction is catalyzed by the enzyme invertase. Using the following data, determine, by Lineweaver-Burk method, whether the inhibition of this reaction by 2 M urea is competitive or noncompetitive Sucrose concentration (M) V, No I (arbitrary unit) V, With I (arbitrary unit) 0.0292 0.182 0.083 0.0584 0.265 0.119 0.0876 0.311 0.154 0.117 0.330 0.167 0.175 0.372 0.192
Consider the rate law: rate=k[CO2][N2]2. What is the order with respect to CO2?
Differential EQN: Bruce Wayne analyzes a kryptonite in order to prepare if ever Clark Kent becomes rogue. The former studieda kryptonite and found that it decomposes at a rate proportional to the quantity of kryptonite present.Suppose that it is found that in 25 years approximately 1.1% of a certain quantity of kryptonite hasdecomposed. Determine how long it will take until 50% of the original amount of kryptonite dissipates. pls. provide complete solution with explenation. the formula we use is : dx/dt=kx
If the rate law for a process is rate=k[A]^2 [B], and [A]=0.7085 and [B]=0.1211, determine the rate as a multiple of k. State the answer without including k.
Write the rate law expression for the generic reaction: B + C → D