For the gas phase isomerization of cyclobutene, (CH2)2(CH)2CH2=CHCH=CH2 the rate constant has been determined at several temperatures. When ln k in s-1 is plotted against the reciprocal of the Kelvin temperature, the resulting linear plot has a slope of -1.64×104 K and a y-intercept of 30.1. The activation energy for the gas phase isomerization of cyclobutene is __________kJ/mol.

Q: Consider the reaction 2O3(g) ⟶3O2(g);  Use the following data to calculate the activation energy for…

A:

Q: The activation energy for a particular reaction is 102 kJ/mol. If the rate constant is 1.35 × 10¬ª…

A: Given information - activation energy, Ea = 102 kJ/mol =102000 J/mol  rate constant, k1 = 1.35 x…

Q: Differentiate the two classification of catalyst (1) homogeneous catalysis and (2) heterogeneous…

A: The two different types of catalyst has to be differentiated with examples. A chemical substance…

Q: Assuming the rate law for the system is rate = k[I-]x[S2O82-]y, what is the value of x for the…

A: Given  rate = k[I-]x[S2O82-]y Find X

Q: The activation energy of a certain reaction is 50.0 kJ/mol . At 23 ∘C , the rate constant is…

A: The Arrhenius equation tells about the relationship between the rate constant and temperature. For…

Q: The decomposition of NO2 (g) occurs by the following bimolecular elementary reaction: 2NO2 (g) -->…

A: Given: Rate constant of the reaction = 2.3 X 10-12 M-1s-1. Temperature = 500 K Initial pressure of…

Q: What is the Ea for this reaction in kJ/mol?   Use Excel to plot the pertinent data and use linear…

A: First, we should solve the activation energy equation to bring in the form of y=mx+c. Then we would…

Q: For the gas phase isomerization of methyl cis-cinnamate,cis-C6H5CH=CHCOOCH3trans-C6H5CH=CHCOOCH3the…

A: A = pre-exponential factor,R = gas constant,T = absolute temperaturek = reaction rate coefficient.Ea…

Q: For the gas phase decomposition of dinitrogen pentoxide, N2O52 NO, + 1/2 0, the rate constant has…

A:

Q: The activation energy for the gas phase decomposition of t-butyl alcohol is 27.4 kJ. (CH3)3COH -->…

A:

Q: Experimental values for the temperature dependence of the rate constant for the gas phase reaction…

A:

Q: For the gas phase decomposition of acetic anhydride, (CH;CO),0CH,=C=0+CH;COOH the rate constant has…

A:

Q: Would the slope of a In(k) versus 1/T (K) plot for a cata- lyzed reaction be more or less negative…

A: The formula fro calculating the slope of the graph is E = -Ea/R here R is the universal gas constant…

Q: Sketch the reaction profile for a reaction having Ea = 50 kJ/mol and (change in)Hrxn = -75 kJ/mol.…

A: For the given reaction,drawn in the picture is the energy profle diagramThe uncatalyzed reaction is…

Q: The reaction rate for the decomposition of N2O5 to form NO2 and O2 was studied as a function of…

A:

Q: The second-order rate constant for the decomposition of nitrous oxide (N20) into nitrogen molecule…

A:

Q: temperatures

A: Dear student I have given answer to your question in the image format.

Q: For the gas phase decomposition of dichloroethane, CH3CHCI, CH;=CHCI + HCI the rate constant has…

A:

Q: The rate constant for the reaction                         CH2=CH2(g) + H2(g)  →  CH3−CH3(g) was…

A:

Q: For the gas phase isomerization of cis-cyanostyrene, cis-C6H3CH=CHCNtrans-CGH5CH=CHCN the rate…

A:

Q: The rate constant (k) of a reaction was determined at three temperatures and the following plot was…

A: The Arrhenius equation is shown below. From the linear equation, y = mx + c, the slope is m.  Thus,…

Q: ClCOOCCl3 ---------> 2 COCl2 the rate constant has been determined at several temperatures. When ln…

A: In this question, we want to determine the value of Activation energy in kJmol-1 unit.  You can see…

Q: The pre-exponential factor and activation energy for the hydrolysis of t-butyl chloride are 3.4 x…

A: A(pre exponential factor)=3.4x1016s-1Ea( activation energy)      =101kj/molT(temprature)…

Q: The Arrhenius plot of the first-order rate constant produced the slope of – 1500 K and the intercept…

A: The explanation is given below-

Q: In an experiment on the adsorption of oxygen on tungsten it was found that the same volume of oxygen…

A: Time requiired for adsorption is expressed as:t=t0e(EdRT)..............1stFor two diffrent…

Q: The enzyme-catalyzed reaction has the Michaelis-Menten constant KM=0.02 M. The reaction rate is v =…

A:

Q: By what factor does increasing the temperature of a reaction from T = 273 K to T = 283 K increase…

A: #Part-A: Given the activation energy of the reaction, Ea = 164500 J  pre-exponential factor, A =…

Q: The reaction rate for the decomposition of N205 to form NO2 and O2 was studied as a function of…

A:

Q: The activation energy for the reaction 2 NO2(g) → 2 NO(g) + O2(g) is 111 kJ mol- 1. What proportion…

A: Given that : Activation energy(Ea)=111kJ/mol=111000J/mol The reaction for the process is :  2NO2(g)…

Q: Determine the activation energy, Ea, in kJ/mol given the data below: Rate constant      Temperature…

A:

Q: The first-order rate constant for the thermal decomposition of 3-methylcyclobutanone has the values…

A: Arrhenius equation is the equation that gives the effect of change in temperature on rate constant…

Q: For the gas phase isomerization of methyl cis-cinnamate, cis-C6H5CH=CHCOOCH3trans-C6H5CH=CHCOOCH3…

A: The relationship between rate constant and activation energy is given by   => ln(K) = ln(A)…

Q: A ne s of concentration and time for species A and B of a chemical reaction. Which s is consistent…

A:

Q: Explain the difference between homogeneous catalysis and heterogeneous catalysis?

A: Given: Catalyst is a substance that increases the rate of a reaction such that it does not undergo a…

Q: For the gas phase isomerization of methyl cis-cinnamate, cis-C,H;CH=CHCOOCH;→trans-CH;CH=CHCOOCH3…

A: We are given the reaction where the cis reactant is converted to trans isomer. The plot of K vs ln T…

Q: Chlorine atoms react with methane, forming HCl and CH3. The rate constant for the reaction is 6.00 ×…

A: First, graph is plotted for lnK vs 1/T.

Q: For the gas phase decomposition of t-butyl alcohol, (CH3)3COH>(CH3)½C=CH, + H,O the rate constant…

A: The rate constant of a reaction is given by Arrhenius equation,

Q: The specific rate constant, k, for a reaction is 0.464 s–1 at 394 K and the activation energy is 245…

A: In this question, we want to determine the rate constant at 398K. You can see details Solution…

Q: For the gas phase decomposition of t-butyl acetate,CH3COOC(CH3)3--------->(CH3)2C=CH2 +…

A: The rate constant of a reaction is given by Arrhenius equation, it is

Q: For the gas phase decomposition of t-butyl propionate, C2H5COOC(CH3)3(CH3)2C=CH2 + C2H5COOH the…

A: Given: slope = -1.97×104 K y-intercept = 29.5. The value of the rate constant for the gas phase…

Q: For the gas phase decomposition of trichloromethyl chloroformate, CICOOCCI32 COCI2 the rate constant…

A: Arrhenius equation is  k=A.exp{-EaR.T}Wherek = rate constant Ea=Activation energyR = gas constant =…

Q: The activation energy of a reaction is 33.4 kJ/mol. The rate constant for this reaction is 3.5 x…

A:

Q: What is the activation energy of a reverse reaction at 679 K if the foward reaction has a rate…

A:

Q: Chemistry For the gas phase decomposition of dichloroethane, CH3CHC12 -> CH2 = CHCI + HCI the rate…

A:

Q: The rate of the electron-exchange reaction between naphthalene (C10H8) and its anion radical…

A: Erying equation is used to relate the rate of reaction with temperature and is mathematically…