Reaction 5: In the final crystallization step, the aluminum sulfate from the previous step reacts with potassium sulfate and water still present in the solution from other reactions to produce the final alum product (KAI(SO4)2-12H2O). Write a balanced chemical equation for the reaction and compute the theoretical yield of the final alum product. Theoretical Yield Actual Yield % Yield

Reaction 5: In the final crystallization step, the aluminum sulfate from the previous step reacts with potassium sulfate and water still present in the solution from other reactions to produce the final alum product (KAI(SO4)2-12H2O). Write a balanced chemical equation for the reaction and compute the theoretical yield of the final alum product. Theoretical Yield Actual Yield % Yield

Living By Chemistry: First Edition Textbook

1st Edition

ISBN:9781559539418

Author:Angelica Stacy

Publisher:Angelica Stacy

ChapterU6: Showtime: Reversible Reactions And Chemical Equilibrium

SectionU6.2: How Backward: Reversible Reactions

Problem 7E

See similar textbooks

Similar questions

Cobalt metal can be prepared by reducing cobalt (II) oxide with carbon monoxide. CoO(s)+CO(g)Co(s)+CO2(g)Kc=4.90102 at 550 C
(write a balanced chemical equation with accurate states) Liquid methanol (CH3OH) undergoes complete combustion in racecar engines.
Predict the products for the following combustion reaction and write a balanced molecular equation. Be sure to include all phase labels. C3H80(l) + O2(g) ——-> ?
Write the correct net ionic equation for the reaction of 0.1 M lithium iodide (clear, colorless) with 0.1 M lead(II) nitrate (clear, colorless), pictured below (it is attached). # cation(state) + # anion(state) ⟶ # product(state)
A student Investigated the stoichiometry of the reaction of zinc (Zn) and HCl solution and reported the following data. When 0.2158 g of Zn reacted with 10.00 ml of 1.000M HCl, 82.062 g of water was displaced. A total of 36.00 ml of 9.501 x 10-2M NaOH solution was required to titrate the HCl remaining in the reaction mixture at the end of the reaction. The room temperature was 27.0°C and the barometric pressure was 777 torr. Calculate the volume of the displaced water from its mass (which will be equal to the volume of the gas collected.) 2) Calculate the pressure of the H2 collected 3) Calculate the number of moles of H2 collected using the ideal gas equation. 4)calculate the number of moles of hcl remaining in the flask at the end of the reaction 5) caluxukage the number of miles of hcl originally present in the reaction 6) calculate the number of moles hcl reacting 7) ccalculate the number of moles zn reacting 8) calculate the ratio of the number of hcl reacting to the number of…
Predict the products and balance the following reactions, including phase symbols. a. Complete combustion of liquid pentane (C5H12) in the presence of oxygen gas. b. H2 (g) + F2 (g) --> c. Sodium metal is placed in water. d. K (s) + Cl2 (g) -->
Write a balanced equation for each of the following reactions.(You may have to guess at one or more of the reaction products,but you should be able to make a reasonable guess, basedon your study of this chapter.) (a) Hydrogen selenide can beprepared by reaction of an aqueous acid solution on aluminumselenide. (b) Sodium thiosulfate is used to remove excessCl2 from chlorine-bleached fabrics. The thiosulfate ion formsSO42- and elemental sulfur, while Cl2 is reduced to Cl - .
Aircraft de-icing agents, such as propylene glycol [1,2-propanediol; CH₃CH(OH)CH₂OH; d=1.036 g/mL], are used toremove ice and snow prior to winter flights, but their presence inrunoff depletes O₂ in natural waters. (a) Write a balanced equa-tion for the complete oxidation of propylene glycol by O₂.(b) What is the “theoretical oxygen demand,” in grams of O₂ required per gram of propylene glycol oxidized? (c) What is thetheoretical oxygen demand, in grams of O₂ required per liter ofsolution, of 90.0% by volume aqueous propylene glycol?
Pure copper may be produced by the reaction of copper(I) sulfide withexcess oxygen gas as follows:Cu2S(s) + O2(g) ---> 2Cu(s) + SO2(g)What mass of copper(I) sulfide is required in order to prepare 0.610 kg ofcopper metal?A. 0.610 kgB. 0.764 kgC. 0.305 kgD. 0.459
A student investigated the stoichiometry of the reaction of zinc (Zn) with HCl solution and reported the following data. When 0.2158 g of Zn reacted with 10.00 mL of 1.000M HCl, 82.062 g of water was displaced. A total of 36.00 mL of 9.501 x 10-2M NaOH solution was required to titrate the HCl remaining in the reaction mixture at the end of the reaction. The room temperature was 27.0°C and the barometric pressure was 777 torr. The gram atomic mass of Zn is 65.38 g mol-1. The density of water at 27.0 °C is 0.9965 g mL-1 and its vapor pressure is 27.0 torr. R = 8.21 X 10-2 L-atm K-1 mol-1 a) determine the volume of the water displaced. b) Calculate the pressure of the H2 collected. c) Calculate the number of moles of H2 collected, using the ideal gas equation. d) Calculate the number of moles of HCl originally present in the reaction flask. e) Calculate the number of moles of HCl remaining in the flask at the end of the reaction. f) Calculate the number of moles of HCl reacting. g)…
Consider the following reaction: 4K(s)+O2(g)→2K2O(s)4K(s)+O2(g)→2K2O(s)The molar mass of KK is 39.10 gmol−1gmol−1 and that of O2O2 is 32.00 gmol−1gmol−1. The limiting reactant is 1.5 g K, 0.38 g O2 I need help with the "explain your reasoning"
The solubility of BaSO4 in water is 2.33×10−3 gm/litre. Its solubility product will be (molecular weight of BaSO4=233) equal