Use your knowledge of fat metabolism. glycolysis, the TCA cycle, and axidative phosphorylation to determine how many molečules of ATP Rauvalents are produced when glycerol undergoes biochemical combustion. Assume that each molecule of NADH produces 2.5 ATP and that each molecule of FADH2 produces 1.5 molecules of ATP during oxidative phosphorylation. Note that GTP is an ATp "equivalent." OA 145 OB 17 OC 19.5 OD. 20.5

Use your knowledge of fat metabolism. glycolysis, the TCA cycle, and axidative phosphorylation to determine how many molečules of ATP Rauvalents are produced when glycerol undergoes biochemical combustion. Assume that each molecule of NADH produces 2.5 ATP and that each molecule of FADH2 produces 1.5 molecules of ATP during oxidative phosphorylation. Note that GTP is an ATp "equivalent." OA 145 OB 17 OC 19.5 OD. 20.5

Biochemistry

6th Edition

ISBN:9781305577206

Author:Reginald H. Garrett, Charles M. Grisham

Publisher:Reginald H. Garrett, Charles M. Grisham

Chapter19: The Tricarboxylic Acid Cycle

Section: Chapter Questions

Problem 21P: Complete oxidation of a 16-carbon fatty acid can yield 129 molecules of ATP Study Figure 19.2 and...

See similar textbooks

Similar questions

Under aerobic conditions when glucose is limiting, with high ratios of NADH/NAD+ and ATP/ADP, as carbon-2 radiolabeled pyruvate is utilized for its carbon skeleton, which molecules would you expect to see significant radiolabeling in the liver? Select all that apply. **Please note some molecules contain more details, including not only molecule name, but location of the label. Pick the options that are accurate for the above situation. Glucose C-2 only Label is halved over many TCA cycles Oxaloacetate Glucose C-1 and C-6 Glucose C-2 and C-5 CO2 from TCA cycle shows some radiolabel Lactate C-2 for export Malate Pyruvate C-1
Calculate the net ATP yield from the complete processing of a saturated fatty acid containing 17 carbons. Consider the β-oxidation steps, processing of acetyl-CoA through the citric acid cycle, and electron transport.
Walking consumes approximately 100 kcal/mi. In the hydrolysis of ATP (ATP → ADP + Pi), the reaction that drives muscle contraction, ΔG°′ is −7.3 kcal/mol (−30.5 kJ/mol). Calculate how many grams of ATP must be produced to walk a mile. ATP synthesis is coupled to the oxidation of glucose (ΔG°′ = −686 kcal/mol). How many grams of glucose are actually metabolized to produce this amount of ATP? (Assume that only glucose oxidation is used to generate ATP and that 40% of the energy generated from this process is used to phosphorylate ADP. The gram molecular weight of glucose is 180 g and that of ATP is 507 g.)
Calculate the number of ATPs generated by the complete metabolic oxidation of tripalmitin (tripalmitoylglycerol). Hydrolysis of the triacylglycerol occurs at the cell surface. Consider the energy yield from catabolism of glycerol, as well as from the fatty acids. Calculate the ATP yield per carbon atom oxidized, and compare it with the energy yield from glucose.
a- During intense exercise the transformation glucose to lactate causes very less ATP production compared to aerobic glycolysis. Explain, does anaerobic glycolysis lead to waste of energy in muscle? b-Glycogen phosphorylase enzyme catalyzes the removal of glucose from glycogen. Describe, glycogen metabolism regulation through glycogen phosphorylase.
Considering the fatty acids: (a) Arachidic acid (C20H40O2); molar mass = 312.5 g/mol) (b) Palmitoleic acid (C16H30O2); molar mass = 256.4 g/mol). How many cycles of β -oxidation are needed for complete oxidation? How many molecules of acetyl CoA are formed from its complete catabolism? How can you calculate the number of molecules (moles) of ATP formed (net) by the complete catabolism of each fatty acid? and the number of moles of ATP formed per gram of each fatty acid metabolized??
Calculate the net number of ATPs produced when one 10-carbon fatty acid is activated, enters the mitochondrion, and undergoes complete � oxidation to produce acetyl-CoA and reduced coenzymes.
How many molecules of ATP are released in the overall catabolism of glycerol to acetyl-CoA? How many molecules of ATP are released in the complete catabolism of glycerol to CO2 and H2O? (Hint: Combine pathways ofglycerol to DHAP with glycolysis from DHAP to pyruvate and pyruvate to acetyl-CoA. Remember to account for any NADH and FADH2 produced.)
Under aerobic conditions when glucose is limiting, with high ratios of NADH/NAD+ and ATP/ADP, as carbon-2 radiolabeled pyruvate is utilized for its carbon skeleton, which molecules would you expect to see significant radiolabeling in the liver? Select all that apply. (multiple answers) Glucose C-2 only Label is halved over many TCA cycles Oxaloacetate Glucose C-1 and C-6 Glucose C-2 and C-5 CO2 from TCA cycle shows some radiolabel Lactate C-2 for export Malate Pyruvate C-1
Compare the ATP yield from the complete oxidation of glucose, a sixcarbon carbohydrate, and hexanoic acid, a six-carbon fatty acid. Hexanoic acid is also called caprioic acid and is responsible for the “aroma” of goats. Why are fats better fuels than carbohydrates?
Long explanations are NOT NEEDED. ATP accounting. Consider 1 molecule of the sucrose (monomeric units: glucose and fructose) that will undergo complete oxidation. a. Number of pyruvate molecules after glycolysis.b. Net ATP produced in glycolysis only (via substrate-level phosphorylation).c. Number of NADH produced using the pyruvate dehydrogenase complex reaction.d. Number of NADH and FADH2 produced from Krebs cycle.e. Net ATP produced (complete oxidation via Malate aspartate shuttle).
Myristoleic acid is a monounsaturated fatty acid found in small amounts in a variety of foods. Calculate the net ATP yield from the complete β-oxidation of myristoleic acid. The formula of myristoleic acid is shown below (it is assumed that the total ATP production is the same for both saturated and unsaturated fatty acids having the same carbon chain length). CH3-(CH2)3-CHCH-(CH2)7-COOH (Given: The oxidation of one NADH yields 2.5 ATP; the oxidation of one FADH2 yields 1.5 ATP; and the oxidation of one acetyl CoA yields 10 ATP. ) Group of answer choices a. 96 ATP b. 92 ATP c. 94 ATP d. 34 ATP e. 36 ATP