What is the relationship between limiting reactant and theoretical yield? The limiting reactant is the reactant that runs out, so it will determine the theoretical yield of product The limiting reactant is the reactant that is put in first, so it will determine the theoretical yield of product The limiting reactant is the reactant you have the most of, so it determines the theoretical yield of product The limiting reactant is the reactant you have less of, so it determines the theoretical yield of product

What is the relationship between limiting reactant and theoretical yield? The limiting reactant is the reactant that runs out, so it will determine the theoretical yield of product The limiting reactant is the reactant that is put in first, so it will determine the theoretical yield of product The limiting reactant is the reactant you have the most of, so it determines the theoretical yield of product The limiting reactant is the reactant you have less of, so it determines the theoretical yield of product

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 42QAP: Explain how one determines which reactant in a process is the limiting reactant. Does this depend...

See similar textbooks

Similar questions

The left box of the following diagram shows the hypothetical elements A green atoms and B blue diatomic molecules before they react. Write a balanced chemical equation, using the lowest possible whole-number coefficients, for the reaction that occurs to form the product in the right box.
A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?
Explain how one determines which reactant in a process is the limiting reactant. Does this depend only on the masses of the reactant present? Give an example of how to determine the limiting reactant by using a Before-Change-After (RCA) table with a balanced chemical equation and reactant starling amounts.
Titanium dioxide, TiO2 , reacts with carbon and chlorineto give gaseous TiCl4 : TiO2+2C+2Cl2TiCl4+2CO The reaction of 7.39 kg titanium dioxide with excess Cand Cl2 gives 14.24 kg titanium tetrachloride. Calculatethe theoretical yield of TiCl4 (assuming complete reaction)and its percentage yield.
Classify each of the following statements as true or false: a Coefficients in a chemical equation express the molar proportions among both reactants and products. b A stoichiometry problem can be solved with an unbalanced equation. c In solving a stoichiometry problem, the change from quantity of given substance to quantity of wanted substance is based on masses. d Percentage yield is actual yield expressed as a percentage of ideal yield. e The quantity of product of any reaction can be calculated only through the moles of the limiting reactant. f rH is positive for an endothermic reaction and negative for an exothermic reaction.
What is the theoretical yield for a reaction, and how does this quantity depend on the limiting reactant?
For each of the following unbalanced chemical equations, suppose exactly 5.0 g of each reactant is taken. Determine which reactant is limiting, and calculate what mass of each product is expected, assuming that the limiting reactant is completely consumed. msp;Na(s)+Br2(l)NaBr(s) msp;Zn(s)+CuSO4(aq)ZnSO4(aq)+Cu(s) msp;NH4Cl(aq)+NaOH(aq)NH3(g)+H2O(l)+NaCl(aq) msp;Fe2O3(s)+CO(g)Fe(s)+CO2(g)
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Lead(ll) oxide is obtained by roasting galena, lead(ll) sulfide, in air. The unbalanced equation is: PbS(s)+O2(g)PbO(s)+SO2(g) ) a. Balance the equation, and determine the theoretical yield of PbO if 200.0 g of PbS is heated. b. What is the percent yield if 170.0 g of PbO is obtained?
For each of the following balanced chemical equations, calculate how many grams of the product(s) would be produced by complete reaction of 0.125 mole of the first reactant. msp;AgNO3(aq)+LiOH(aq)AgOH(s)+LiNO3(aq) msp;Al2(SO4)3(aq)+3CaCl2(aq)2AlCl3(aq)+3CaSO4(s) msp;CaCO3(s)+2HCl(aq)CaCl2(aq)+CO2(g)+H2O(l) msp;2C4H10(g)+13O2(g)8CO2(g)+10H2O(g)
What is meant by a limiting reactant in a particular reaction? In what way is the reaction “limited”? What does it mean to say that one or more of the reactants are present in excess? What happens to a reaction when the limiting reactant is used up?