Which of the following statements is false? * The percent yield = x 100% The limiting reactant is completely consumed in a chemical reaction. The actual yield is the amount of product actually produced by a chemical reactio The theoretical yield is the amount of product that can be made based on the ame of limiting reagent.

Which of the following statements is false? * The percent yield = x 100% The limiting reactant is completely consumed in a chemical reaction. The actual yield is the amount of product actually produced by a chemical reactio The theoretical yield is the amount of product that can be made based on the ame of limiting reagent.

Living by Chemistry

2nd Edition

ISBN:9781464142314

Author:Angelica M. Stacy

Publisher:Angelica M. Stacy

ChapterU4: Toxins: Stoichiometry, Solution Chemistry, And Acids And Bases

Section: Chapter Questions

Problem 20STP

See similar textbooks

Similar questions

he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
Classify each of the following statements as true or false: a Coefficients in a chemical equation express the molar proportions among both reactants and products. b A stoichiometry problem can be solved with an unbalanced equation. c In solving a stoichiometry problem, the change from quantity of given substance to quantity of wanted substance is based on masses. d Percentage yield is actual yield expressed as a percentage of ideal yield. e The quantity of product of any reaction can be calculated only through the moles of the limiting reactant. f rH is positive for an endothermic reaction and negative for an exothermic reaction.
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
What is meant by a limiting reactant in a particular reaction? In what way is the reaction “limited”? What does it mean to say that one or more of the reactants are present in excess? What happens to a reaction when the limiting reactant is used up?
onsider the balanced chemical equation :math>4Al(s)+3O2(g)2Al2O3(s). at mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of aluminum metal? What mole ratio would you use to calculate the number of moles of product that would be expected if a given number of moles of aluminum metal reacts completely?
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
For each of the following balanced equations, indicate how many moles of the product could be produced by complete reaction of 1.00 g of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;NH3(g)+HCl(g)NH4Cl(s) msp;CaO(s)+CO2(g)CaCO3(s) msp;4Na(s)+O2(g)2Na2O(s) msp;2P(s)+3Cl2(g)2PCl3(l)
Methanol, CH3OH, is used in racing cars because it is a clean-burning fuel. It can be made by this reaction: CO(g)+2H2(g)CH3OH(l) What is the percentage yield if 5.0103gH2 reacts with excess CO to form 3.5104gCH3OH ?
Consider the following generic reaction: Y2+2XY2XY2 In a limiting reactant problem, a certain quantity of each reactant is given and you are usually asked to calculate the mass of product formed. If 10.0 g of Y2 is reacted with 10.0 g of XY, outline two methods you could use to determine which reactant is limiting (runs out first) and thus determines the mass of product formed.
Ammonia can be formed from a combination reaction of its elements. A small fraction of an unreacted mixture of elements is illustrated in the following diagram, in which white spheres represent hydrogen atoms and blue spheres represent nitrogen atoms. The temperature is such that all species are gases. a Write and balance the equation for the reaction. b Which of the following correctly represents the product mixture? c Which species is the limiting reactant? Explain.
A 0.20 mol sample of magnesium burns in air to form 0.20 mol of solid MgO. What amount (moles) of oxygen (O2) is required for a complete reaction?