Interpretation:
Reason for choosing the temperature to run the reaction is very important in Haber-Bosch process has to be explained by using enthalpy effect and the entropy effect.
Concept Introduction:
Le Chatelier's principle:
It states that if a system in equilibrium gets disturbed due to modification of concentration, temperature, volume, and pressure, then it reset to counteract the effect of disturbance.
In the
If number of mole increases result the increasing entropy value and decreases result the decreasing entropy of reaction.
![Check Mark](/static/check-mark.png)
Want to see the full answer?
Check out a sample textbook solution![Blurred answer](/static/blurred-answer.jpg)
Chapter 12 Solutions
OWLv2 for Moore/Stanitski's Chemistry: The Molecular Science, 5th Edition, [Instant Access], 1 term (6 months)
- Cobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.arrow_forwardThe reaction of carbon monoxide with hydrogen to form methanol is quite slow at room temperature. As a general rule, reactions go faster at higher temperatures. Suppose that you tried to speed up this reaction by increasing the temperature. (a) Assuming that rH does not change very much as the temperature changes, what effect would increasing the temperature have on rSsurroundings? (b) Assuming that rS for a reaction System does not change much as the temperature changes, what effect would increasing the temperature have on rSuniverse?arrow_forwardSilver carbonate, Ag2CO3, is a light yellow compound that decomposes when heated to give silver oxide and carbon dioxide: Ag2CO3(s)Ag2O(s)+CO2(g) A researcher measured the partial pressure of carbon dioxide over a sample of silver carbonate at 220C and found that it was 1.37 atm. Calculate the partial pressure of carbon dioxide at 25C. The standard enthalpies of formation of silver carbonate and silver oxide at 25C are 505.9 kJ/mol and 31.05 kJ/mol, respectively. Make any reasonable assumptions in your calculations. State the assumptions that you make, and note why you think they are reasonable.arrow_forward
- Adenosine triphosphate, ATP, is used as a free-energy source by biological cells. (See the essay on page 624.) ATP hydrolyzes in the presence of enzymes to give ADP: ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq);G=30.5kJ/molat25C Consider a hypothetical biochemical reaction of molecule A to give molecule B: A(aq)B(aq);G=+15.0kJ/molat25C Calculate the ratio [B]/[A] at 25C at equilibrium. Now consider this reaction coupled to the reaction for the hydrolysis of ATP: A(aq)+ATP(aq)+H2O(l)B(aq)+ADP(aq)+H2PO4(aq) If a cell maintains a high ratio of ATP to ADP and H2PO4 by continuously making ATP, the conversion of A to B can be made highly spontaneous. A characteristic value of this ratio is [ATP][ADP][H2PO4]=500 Calculate the ratio [B][A] in this case and compare it with the uncoupled reaction. Compared with the uncoupled reaction, how much larger is this ratio when coupled to the hydrolysis of ATP?arrow_forwardDefine the terms product-favored System and reactant-favored System. Give one example of each.arrow_forwardWhen a mixture of hydrogen and bromine is maintained at normal atmospheric pressure and heated above 200. °C in a closed container, the hydrogen and bromine react to form hydrogen bromide and a gas-phase equilibrium is established. Write a balanced chemical equation for the equilibrium reaction. Use bond enthalpies from Table 6.2 ( Sec. 6-6b) to estimate the enthalpy change for the reaction. Based on your answers to parts (a) and (b), which is more important in determining the position of this equilibrium, the entropy effect or the energy effect? In which direction will the equilibrium shift as the temperature increases above 200. °C? Explain. Suppose that the pressure were increased to triple its initial value. In which direction would the equilibrium shift? Why is the equilibrium not established at room temperature?arrow_forward
- 5.11. Determine the numerical value of Q for the reaction conditions indicated.arrow_forwardOrgan pipes in unheated churches develop tin disease, in which white tin is converted to gray tin. Given white Sm: H f =0.00 kJ/mol; S =51.55 J/mol K gray Sn: H f =2.09 kJ/mol; S =44.14 J/mol K calculate the equilibrium temperature for the transition.arrow_forwardFor the ammonia synthesis reaction ⇌ Does the entropy effect favor products? Explain your answer. Does the energy effect favor products? Explain your answer. Is the equilibrium concentration of NH3(g) greater at high or low temperature? Explain.arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningWorld of Chemistry, 3rd editionChemistryISBN:9781133109655Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCostePublisher:Brooks / Cole / Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
- Chemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub CoGeneral, Organic, and Biological ChemistryChemistryISBN:9781285853918Author:H. Stephen StokerPublisher:Cengage LearningPrinciples of Modern ChemistryChemistryISBN:9781305079113Author:David W. Oxtoby, H. Pat Gillis, Laurie J. ButlerPublisher:Cengage Learning
![Text book image](https://www.bartleby.com/isbn_cover_images/9781285199047/9781285199047_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781133109655/9781133109655_smallCoverImage.jpg)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781337398909/9781337398909_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781285853918/9781285853918_smallCoverImage.gif)
![Text book image](https://www.bartleby.com/isbn_cover_images/9781305079113/9781305079113_smallCoverImage.gif)