(a)
Interpretation:
The direction of the equilibrium on increasing concentration of strontium is to be stated.
Concept introduction:
Equilibrium is the state where the concentration of the reactant is equal to the concentration of the product. According to Le Chatelier’s Principle, it states that the equilibrium shifts in such a way or a direction that it can reduce the effect of change.
(b)
Interpretation:
The effect of increasing concentration of carbonate ion is to be stated.
Concept introduction:
Equilibrium is the state where the concentration of the reactant is equal to the concentration of the product. According to Le Chatelier’s Principle, it states that the equilibrium shifts in such a way or a direction that it can reduce the effect of change.
(c)
Interpretation:
The direction of the equilibrium on decreasing concentration of strontium is to be stated.
Concept introduction:
Equilibrium is the state where the concentration of the reactant is equal to the concentration of the product. According to Le Chatelier’s Principle, it states that the equilibrium shifts in such a way or a direction that it can reduce the effect of change.
(d)
Interpretation:
The direction of the equilibrium on decreasing concentration of carbonate is to be stated.
Concept introduction:
Equilibrium is the state where the concentration of the reactant is equal to the concentration of the product. According to Le Chatelier’s Principle, it states that the equilibrium shifts in such a way or a direction that it can reduce the effect of change.
(e)
Interpretation:
The direction of the equilibrium on adding solid
Concept introduction:
Equilibrium is the state where the concentration of the reactant is equal to the concentration of the product. According to Le Chatelier’s Principle, it states that the equilibrium shifts in such a way or a direction that it can reduce the effect of change.
(f)
Interpretation:
The direction of the equilibrium on adding solid
Concept introduction:
Equilibrium is the state where the concentration of the reactant is equal to the concentration of the product. According to Le Chatelier’s Principle, it states that the equilibrium shifts in such a way or a direction that it can reduce the effect of change.
(g)
Interpretation:
The direction of the equilibrium on adding solid
Concept introduction:
Equilibrium is the state where the concentration of the reactant is equal to the concentration of the product. According to Le Chatelier’s Principle, it states that the equilibrium shifts in such a way or a direction that it can reduce the effect of change.
(h)
Interpretation:
The direction of the equilibrium on increasing concentration of hydrogen ion is to be stated.
Concept introduction:
Equilibrium is the state where the concentration of the reactant is equal to the concentration of the product. According to Le Chatelier’s Principle, it states that the equilibrium shifts in such a way or a direction that it can reduce the effect of change.
Want to see the full answer?
Check out a sample textbook solutionChapter 16 Solutions
INTRODUCTORY CHEMISTRY-STD.GDE.+SOL.MAN
- The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1arrow_forwardConsider the following equilibria involving SO2(g) and their corresponding equilibrium constants. SO2(g) + 12 O2(g) SO3(g) K1 2SO3(g) 2SO2(g) + O2(g) K2 Which of the following expressions relates K1 to K2? (a) K2=K12 (b) K22=K1 (c) K2 = K1 (d) K2 = 1/K1 (e) K2=1/K12arrow_forwardGiven the following descriptions of reversible reactions, write a balanced net ionic equation (simplest whole-number coefficients) and the equilibrium constant expression (K) for each. (a) Liquid acetone (C3H6O) is in equilibrium with its vapor. (b) Hydrogen gas reduces nitrogen dioxide gas to form ammonia and steam. (c) Hydrogen sulfide gas (H2S) bubbled into an aqueous solution of lead(ll) ions produces lead sulfide precipitate and hydrogen ions.arrow_forward
- Given the following descriptions of reversible reactions, write a balanced equation (smallest whole-number coefficients) and the equilibrium constant expression for each. (a) Nickel metal reacts with carbon monoxide to form nickel tetracarbonyl (Ni(CO)4) gas. (b) Aqueous nitrous acid in equilibrium with hydrogen and nitrite ions. (c) Chlorine gas and bromide ions in equilibrium with liquid bromine and chloride ions.arrow_forwardThe diagram represents an equilibrium mixture for the reaction N2(g) + O2(g) ⇌ 2 NO(g) Estimate the equilibrium constant.arrow_forwardBecause carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?arrow_forward
- What is the approximate value of the equilibrium constant KP for the change C2H5OC2H5(l)C2H5OC2H5(g) at 25 C. {Vapor pressure was described in the previous Chapter on liquids and solids; refer back to this chapter to find the relevant information needed to solve this problem.)arrow_forwardThe following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?arrow_forwardBecause calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?arrow_forward
- Introductory Chemistry: A FoundationChemistryISBN:9781285199030Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningIntroduction to General, Organic and BiochemistryChemistryISBN:9781285869759Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar TorresPublisher:Cengage Learning
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage Learning