Concept explainers
(a)
Interpretation:
The systematic name of the coordination compound
Concept introduction:
The coordination compound can be defined as the compound in which the central atoms are connected to the other ions or neutral molecules through coordinate bonds. When the other ions or neutral molecules have the tendency to donate electrons to the central atom then these are called as Lewis base. Similarly, central atoms or ion have the tendency to accept the electrons then it is called as Lewis acid.
(b)
Interpretation:
The systematic name of the coordination compound
Concept introduction:
The coordination compound can be defined as the compound in which the central atoms are connected to the other ions or neutral molecules through coordinate bonds. When the other ions or neutral molecules have the tendency to donate electrons to the central atom then these are called as Lewis base. Similarly, central atoms or ion have the tendency to accept the electrons then it is called as Lewis acid.
(c)
Interpretation:
The systematic name of the coordination compound
Concept introduction:
The coordination compound can be defined as the compound in which the central atoms are connected to the other ions or neutral molecules through coordinate bonds. When the other ions or neutral molecules have the tendency to donate electrons to the central atom then these are called as Lewis base. Similarly, central atoms or ion have the tendency to accept the electrons then it is called as Lewis acid.
(d)
Interpretation:
The systematic name of the coordination compound
Concept introduction:
The coordination compound can be defined as the compound in which the central atoms are connected to the other ions or neutral molecules through coordinate bonds. When the other ions or neutral molecules have the tendency to donate electrons to the central atom then these are called as Lewis base. Similarly, central atoms or ion have the tendency to accept the electrons then it is called as Lewis acid.
Want to see the full answer?
Check out a sample textbook solutionChapter 21 Solutions
LCPO CHEMISTRY W/MODIFIED MASTERING
- Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?arrow_forwardName each of the compounds or ions given, including the oxidation state of the metal. (a) [Co(CO3)3]3− (note that CO32− is bidentate in this complex)(b) [Cu(NH3)4]2+(c) [Co(NH3)4Br2]2(SO4)3(d) [Pt(NH3)4][PtCl4](e) [Cr(en)3](NO3)3(f) [Pd(NH3)2Br2] (square planar)(g) K3[Cu(Cl)5](h) [Zn(NH3)2Cl2]arrow_forwardConsider the complex ion [Co(en)2(SCN)Cl]+ (a) identify the ligands and their charges (b) what is the oxidation number of cobalt? (c) what is the formula for the sulfide salt of this ion?arrow_forward
- Predict the number of unpaired electrons.(a) K3[CrI6](b) [Cu(en)2(H2O)2]Cl2(c) Na3[Co(NO2)6]arrow_forwardWhich of the following coordination compounds has the highest CO stretching vibration frequency in the infrared spectrum? (A) Cr(CO)6 (B) [V(CO)6] (C) [Ti(CO)6] 2- (D) [Mn(CO)6]+ Answer(D)arrow_forwardName the compounds (a) [Cr(H2O)4Cl2]Cl, (b) K4[Ni(CN)4].arrow_forward
- Which of the following compounds can exhibit cis-trans isomerism? [Cr(H2O)6]3+ [Cu(CO)5Cl]+ [Ni(CO)2(NH3)2]2+ [MnClBr3]2- [Fe(CO)5NO2]2+arrow_forwardAssign a systematic name to each of the following chemical compounds:(a) NH4[Cr(NH3)2(NCS)4](b) [Tc(CO)5]I(c) K[Mn(CN)5](d) [Co(NH3)4(OH2)Cl]Br2arrow_forwardSpecify whether the following complexes have isomers.(a) tetrahedral [Ni(CO)2(Cl)2](b) trigonal bipyramidal [Mn(CO)4NO](c) [Pt(en)2Cl2]Cl2arrow_forward
- Give the proper name for each of the following compounds: (d) [Co(H2O)4]SO4 (e) [Co(NH3)4(OH2)2](BF4)5 (f) [Fe(H2O)6]Br2 (g) Na3[Fe(CN)6] · 2 H2O (h) Na4[Fe(CN)6] (i) Ni(CO)4 (j) [Cu(NH3)4]SO4 (k) [Pt(en)2](ClO4)2 (l) Co(NH3)2(Cl)(Br)(CH3CO2)arrow_forwardGive systematic names for the following formulas:(a) [Co(NH3)4(NO2)2]Cl (b) [Cr(NH3)6][Cr(CN)6] (c) K2[CuCl4]arrow_forwardGive systematic names for the following formulas:(a) [Co(NH3)4(NO2)2]Cl (b) [Cr(NH3)6][Cr(CN)6](c) K2[CuCl4]arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning