Concept explainers
(a)
Interpretation:
The Lewis structure of Hg22+ should be drawn.
Concept introduction:
Lewis structure is a representation of how valance shell electrons are arranged around individual atoms in a molecule. Steps of drawing Lewis structures are
- Determine the total number of valence electrons in a molecule.
- Draw a sketch of the molecule connecting all atoms to the central atom using only single bond. Central atom is the one which can form highest number of bonds. One bond indicates two electrons
- The remaining electrons are distributed among the atoms as their octets are being completed.
- If the octet of central atom is no completed, using lone pairs of terminal atoms, create multiple bonds.
- Then determine the formal charge of all atoms
Formal charge = valence electrons − Nonbonding electrons − (1/2) x Bonding electrons
(b)
Interpretation:
The Lewis structure of Mn2O7 should be drawn.
Concept introduction:
Lewis structure is a representation of how valance shell electrons are arranged around individual atoms in a molecule. Steps of drawing Lewis structures are
- Determine the total number of valence electrons in a molecule.
- Draw a sketch of the molecule connecting all atoms to the central atom using only single bond. Central atom is the one which can form highest number of bonds. One bond indicates two electrons
- The remaining electrons are distributed among the atoms as their octets are being completed.
- If the octet of central atom is no completed, using lone pairs of terminal atoms, create multiple bonds.
- Then determine the formal charge of all atoms
Formal charge = valence electrons − Nonbonding electrons − (1/2) x Bonding electrons
(c)
Interpretation:
The Lewis structure of OsO4 should be drawn.
Concept introduction:
Lewis structure is a representation of how valance shell electrons are arranged around individual atoms in a molecule. Steps of drawing Lewis structures are
- Determine the total number of valence electrons in a molecule.
- Draw a sketch of the molecule connecting all atoms to the central atom using only single bond. Central atom is the one which can form highest number of bonds. One bond indicates two electrons
- The remaining electrons are distributed among the atoms as their octets are being completed.
- If the octet of central atom is no completed, using lone pairs of terminal atoms, create multiple bonds.
- Then determine the formal charge of all atoms
Formal charge = valence electrons − Nonbonding electrons − (1/2) x Bonding electrons
Want to see the full answer?
Check out a sample textbook solutionChapter 23 Solutions
GENERAL CHEMISTRY-SOLUTIONS MANUAL
- Platinum(II) forms many complexes, among them those with the following ligands. Give the formula and charge of each complex. (a) two ammonia molecules and one oxalate ion (C2O42-) (b) two ammonia molecules, one thiocyanate ion (SCN-), and one bromide ion (c) one ethylenediamine molecule and two nitrite ionsarrow_forwardFour different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?arrow_forwardTwo different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.arrow_forward
- a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?arrow_forwardOne of the following nitrogen compounds or ions is not capable of serving as a ligand: NH4+, NH3, NH2. Identify this species, and explain your answer.arrow_forward
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningPrinciples of Modern ChemistryChemistryISBN:9781305079113Author:David W. Oxtoby, H. Pat Gillis, Laurie J. ButlerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning