Interpretation:
The empirical formula of the compound is to be calculated.
Concept introduction:
The number of moles is defined as the ratio of mass to the molar mass:
Here,
Molar mass is calculated by adding the masses of each element multiplied by their number of atoms present (given in subscript). Its S.I. unit is
The mass of compound can be calculated as
Here,
the Mass of carbon can be calculated as
The mass of hydrogen can be calculated as
Answer to Problem 154AP
Solution: The empirical formula of the first compound is
Explanation of Solution
Given information:
For gasoline
For methyl tert-butyl ether
The molar mass of
Calculate the number of moles of water as
Substitute
The molar mass of
Calculate the number of moles of carbon dioxide as
Substitute
The molar mass of
For carbon in
Calculate the mass of carbon as
Substitute
The molar mass of
For hydrogen in
Calculate the mass of hydrogen as
Substitute
The mass of the given sample is
Calculate the mass of lead as
Substitute
Rearrange the above equation for
Now, the number of moles of each element is to be calculated as
The molar mass of
Calculate the number of moles of carbon as
Substitute
The molar mass of hydrogen is
Calculate the mass of hydrogen as
Substitute
The molar mass of lead is
Calculate the mass of lead as
Substitute
So, the molecular formula of the compound can be written as
As the empirical formula are always has whole number multiples, on simplifying the number of moles of each element, it is calculated as
For H
For C
For Pb
So, the empirical formula of the compound is
Now, for tert-butyl ether:
The molar mass of
Calculate the number of moles of water as
Substitute
The molar mass of
Calculate the number of moles of carbon dioxide as
Substitute
The molar mass of
For carbon in
Calculate the mass of carbon as
Substitute
The molar mass of
For hydrogen in
Calculate the mass of hydrogen as
Substitute
The mass of the given sample is
Calculate the mass of oxygen as
Substitute
Rearrange the above equation for
Now, the number of moles of each element is to be calculated as
The molar mass of carbon is
Calculate the mass of carbon as
Substitute
The molar mass of hydrogen is
Calculate the mass of hydrogen as
Substitute
The molar mass of oxygen is
Calculate the mass of oxygen as
Substitute
So, the molecular formula of the compound is
As the empirical formula are always whole number multiples, on simplifying the number of moles of each element, it is calculated as
For H
For C
For O
So, the empirical formula of the compound is
The empirical formula of the first compound is
Want to see more full solutions like this?
Chapter 3 Solutions
Chemistry-Connect Plus Access
- 4.108 Elemental analysis is sometimes carried out by combustion of the sample. For a hydrocarbon, the only products formed are CO2 and H2O. If a 1.36-g sample of an unknown hydrocarbon is burned and 2.21 g of H2O is produced along with 4.07 g of CO2, what is the empirical formula of the hydrocarbon?arrow_forwardThe active ingredient in Pepto-Bismo® (an over- the-counter remedy for an upset stomach) is bismuth sub-salicylate, C7H5BiO4. Analysis of a 1.7500-g sample of Pepto-Bismol yields 346 mg of bismuth. What percent by mass is bismuth subsalicylate in the sample? (Assume that there are no other bismuth-containing compounds in Pepto-Bismol.)arrow_forwardThe following reaction, depicted using molecular models, is used to make carbon tetrachloride, CCl4, a solvent and starting material for the manufacture of fluorocarbon refrigerants and aerosol propellants. Calculate the number of grams of carbon disulfide, CS2, needed for a laboratory-scale reaction with 62.7 g of chlorine, Cl2.arrow_forward
- A compound contains only carbon, hydrogen, nitrogen, and oxygen. Combustion of 0.157 g of the compound produced 0.213 g CO2 and 0.0310 g H2O. In another experiment, it is found that 0.103 g of the compound produces 0.0230 g NH3. What is the empirical formula of the compound? Hint: Combustion involves reacting with excess O2. Assume that all the carbon ends up in CO2 and all the hydrogen ends up in H2O. Also assume that all the nitrogen ends up in the NH3 in the second experiment.arrow_forwardThe reaction of iron metal and chlorine gas to give iron(III) chloride is illustrated below. (a) Write the balanced chemical equation for the reaction. (b) Beginning with 10.0 g of iron, what mass of Cl2, in grams, is required for complete reaction? What mass of FeCl3 can be produced? (c) If only 18.5 g of FeCl3 is obtained from 10.0 g of iron and excess Cl2, what is the percent yield? (d) If 10.0 g each of iron and chlorine are combined, what is the theoretical yield of iron(III) chloride?arrow_forwardA mixture consisting of 11.9 g of calcium fluoride, CaF2, and 12.1 g of sulfuric acid, H2SO4, is heated to drive off hydrogen fluoride, HF. CaF2(s)+H2SO4(l)2HF(g)+CaSO4(s) What is the maximum number of grams of hydrogen fluoride that can be obtained?arrow_forward
- Bornite (Cu3FeS3) is a copper ore used in the production of copper. When heated, the following reaction occurs: 2Cu3FeS3(s)+7O2(g)6Cu(s)+2FeO(s)+6SO2 If 2.50 metric tons of bornite is reacted with excess O2 and the process has an 86.3% yield of copper, what mass of copper is produced?arrow_forwardYou perform a combustion analysis on a 255 mg sample of a substance that contains only C, H, and O, and you find that 561 mg CO2 is produced, along with 306 mg H2O. a If the substance contains only C, H, and O, what is the empirical formula? b If the molar mass of the compound is 180 g/mol, what is the molecular formula of the compound?arrow_forwardThe compound SF6 is made by burning sulfur in an atmosphere of fluorine. The balanced equation is Sa(s) + 24 F2(g) SF6(g) Starting with a mixture of 1.6 mol of sulfur. Sg, and 35 mol of F2, (a) Which is the limiting reagent? (b) What amount of SF6 is produced?arrow_forward
- Nitrobenzene, C6H5NO2, an important raw material for the dye industry, is prepared from benzene, C6H6, and nitric acid, HNO3. C6H6(l)+HNO3(l)C6H5NO2(l)+H2O(l) When 21.6 g of benzene and an excess of HNO3 are used, what is the theoretical yield of nitrobenzene? If 30.0 g of nitrobenzene is recovered, what is the percentage yield?arrow_forward4.44 Industrial production of hydrogen gas uses the reaction shown below. If 1.00 metric ton of propane reacting with excess water yields 270 kg of H2, what is the percentage yield? C3H8(g)+3H2O(l)3CO(g)+7H2(g)arrow_forwardPhenol is a compound of carbon, hydrogen, and oxygen used commonly as a disinfectant. Combustion of a 175-mg sample of phenol yielded 491 mg CO2 and 100. mg H2O. Calculate the empirical formula of phenol. Identify what other information is needed to determine whether the empirical formula is the actual molecular formula.arrow_forward
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning