Concept explainers
(a)
Interpretation:
Enthalpy change for the given reaction should be calculated. The given reaction is,
Concept introduction:
Enthalpy
The value of standard enthalpy change
Where,
n is the number of moles.
(a)
Answer to Problem 5.82QE
Enthalpy change is
Explanation of Solution
The balanced equation for the given reaction follows as,
Standard enthalpy of formation values is given below,
Change in enthalpy can be calculated by the equation:
Substitute the values as follows,
(b)
Interpretation:
Enthalpy change for the given reaction should be calculated. The given reaction is,
Concept introduction:
Refer to (a).
(b)
Answer to Problem 5.82QE
Enthalpy change is
Explanation of Solution
The balanced equation for the given reaction follows as,
Standard enthalpy of formation values is given below,
Change in enthalpy can be calculated by the equation:
Substitute the values as follows,
(c)
Interpretation:
Enthalpy change for the given reaction should be calculated. The given reaction is,
Concept introduction:
Refer to (a).
(c)
Answer to Problem 5.82QE
Enthalpy change is
Explanation of Solution
The balanced equation for the given reaction follows as,
Standard enthalpy of formation values is given below,
Change in enthalpy can be calculated by the equation:
Substitute the values as follows,
Want to see more full solutions like this?
Chapter 5 Solutions
Chemistry: Principles and Practice
- Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forwardThe enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forward
- White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forwardUnder what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forward
- The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forwardCalculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.arrow_forwardWhat is the difference between the enthalpy of reaction and the enthalpy of formation? For what chemical reaction(s) are the two quantities the same?arrow_forward
- Using the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)arrow_forward9.73 Without looking up any numerical data or doing calculations, predict whether the enthalpy change for each of the following reactions should he positive, negative, or zero. (a) H2O(l)H2O(s) (b) N2(g)2N(g) (c) CH4(g)+2O2(g)CO2(g)+2H2O(l) (d) CO2(s)CO2(g)arrow_forwardEthylene glycol, HOCH2CH2OH, is used as antifreeze. It is produced from ethylene oxide, C2H4O, by the reaction C2H4O(g)+H2O(l)HOCH2CH2OH(l) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: 2C2H4O(g)+5O2(g)4CO2(g)+4H2O(l);H=2612.2kJHOCH2CH2OH(l)+52O2(g)2CO2(g)+3H2O(l);H=1189.8kJarrow_forward
- Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage Learning
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningWorld of Chemistry, 3rd editionChemistryISBN:9781133109655Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCostePublisher:Brooks / Cole / Cengage Learning