Concept explainers
(a)
Interpretation:
Hybridization and geometry of each Sulfur atom has to be identified.
Concept Introduction:
VSEPR theory is constitutes a set of rules which predicts the shape of the molecule based on the orientation of bonding and non-bonding electrons in the molecule.
(b)
Interpretation:
Bond energy of
Concept Introduction:
(c)
Interpretation:
The bonding in
Concept Introduction:
Molecular orbital theory has set rules to depict the electronic structure of molecules. Two atomic orbitals combine to form molecular orbitals. The number of atomic orbitals combine equal to the number of molecular orbitals formed.
Molecular orbitals having lower energy are called bonding molecular orbitals. Molecular orbitals having higher energy are called anti-bonding orbitals.
A molecular compound having unpaired electrons is said to be paramagnetic and a compound having all the electrons in it paired state is said to be diamagnetic.
Want to see the full answer?
Check out a sample textbook solutionChapter 8 Solutions
General Chemistry: Atoms First
- The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forwardThe reaction of quicklime, CaO, with water produces slaked lime, Ca(OH)2, which is widely used in the construction industry to make mortar and plaster. The reaction of quicklime and water is highly exothermic: CaO(s)+H2O(l)Ca(OH)2(s)H=350kJmol1 (a) What is the enthalpy of reaction per gram of quicklime that reacts?. (b) How much heat, in kilojoules, is associated with the production of 1 ton of slaked lime?arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forward
- Is the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardFrom the data given in Appendix I, determine the standard enthalpy change and the standard free energy change for each of the following reactions: (a) BF3(g)+3H2O(l)B(OH)3(s)+3HF(g) (b) BCl3(g)+3H2O(l)B(OH)3+3HCl(g) (c) B2H6(g)+6H2O(l)2B(OH)3(s)+6H2(g)arrow_forwardGas A2 reacts with gas B2 to form gas AB at a constant temperature. The bond energy of AB is much greater than that of either reactant. What can be said about the sign of H? SSurr? S? Explain how potential energy changes for this process. Explain how random kinetic energy changes during the process.arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax