Concept explainers
When a solution containing 8.00 g of NaOH in 50.0 g of water at 25.0 °C is added to a solution of 8.00 g of HCl in 250.0 g of water at 25.0 °C in a calorimeter, the temperature of the solution increases to 33.5 °C. Assuming that the specific heat of the solution is 4.18 J/(g · °C) and that the calorimeter absorbs a negligible amount of heat, calculate ΔH in kilojoules for the reaction
When the experiment is repeated using a solution of 10.00 g of HCl in 248.0 g of water, the same temperature increase is observed. Explain.
Want to see the full answer?
Check out a sample textbook solutionChapter 8 Solutions
General Chemistry: Atoms First
- When solid iron burns in oxygen gas (at constant pressure) to produce Fe2O3(s), 1651 kJ of heat is released for every 4 mol of iron burned. How much heat is released when 10.3 g Fe2O3(s) is produced (at constant pressure)? What additional information would you need to calculate the heat released to produce this much Fe2O3(s) if you burned iron in ozone gas, O3(g), instead of O2(g)?arrow_forwardAlloys When a 58.8-g piece of hot alloy is placed in125 g of cold water in a calorimeter, the temperature ofthe alloy decreases by 106.1°C, while the temperature ofthe water increases by 10.5°C. What is the specific heat ofthe alloy?arrow_forwardThe temperature of the cooling water as it leaves the hot engine of an automobile is 240 F. After it passes through the radiator it has a temperature of 175 F. Calculate the amount of heat transferred from the engine to the surroundings by one gallon of water with a specific heat of 4.184 J/g oC.arrow_forward
- A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?arrow_forwardA sample of nickel is heated to 99.8C and placed in a coffee-cup calorimeter containing 150.0 g water at 23.5C. After the metal cools, the final temperature of metal and water mixture is 25.0C. If the specific heat capacity of nickel is 0.444 J/C g, what mass of nickel was originally heated? Assume no heat loss to the surroundings.arrow_forwardA 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.arrow_forward
- In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.arrow_forwardThe decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forwardThe process of dissolving ammonium nitrate, NH4NO3, in water is an endothermic process. What is the sign of q? If you were to add some ammonium nitrate to water in a flask, would you expect the flask to feel warm or cool?arrow_forward
- The specific heat capacity of copper is 0.385 J g1 C1, whereas it is 0.128 J g1 C1 for gold. Assume you place 100. g of each metal, originally at 25 C, in a boiling water bath at 100 C. If energy is transferred to each metal at the same rate, determine which piece of metal will reach 100 C first.arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardAssume 200. mL of 0.400 M HCl is mixed with 200. mL of 0.400 M NaOH in a coffee-cup calorimeter The temperature of the solutions before mixing was 25.10 C; after mixing and allowing the reaction to occur, the temperature is 27.78 C. What is the enthalpy change when one mole of acid is neutralized? (Assume that the densities of all solutions are 1.00 g/mL and their specific heat capacities are 4.20 J/g K.)arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning