Questions about organometallic complexes. a) Transition metal species are classified as Werner or organometallic complexes: Complex Werner Metal Ox. State Example Ligand NH3, Electrons high low 12-22 Organometallic CO 18 In organometallic complexes briefly explain how the oxidation state of the metal determines the type of ligand. b) Provide the required information regarding the following organometallic compounds. (n²-C2H4)M(CO)3 Missing 2nd-row transition metal M: XH(CO)s Missing 1"-row transition metal X:

Questions about organometallic complexes. a) Transition metal species are classified as Werner or organometallic complexes: Complex Werner Metal Ox. State Example Ligand NH3, Electrons high low 12-22 Organometallic CO 18 In organometallic complexes briefly explain how the oxidation state of the metal determines the type of ligand. b) Provide the required information regarding the following organometallic compounds. (n²-C2H4)M(CO)3 Missing 2nd-row transition metal M: XH(CO)s Missing 1"-row transition metal X:

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 31P

See similar textbooks

Similar questions

A 3.03-g petroleum specimen was decomposed by wet ashing and subsequently diluted to 500 mL in a volumetric flask. Cobalt was determined by treating 25.00-mL aliquots of this diluted solution as follows: Assume that the Co(II)-ligand chelate obeys Beer’s law, and calculate the percentage of cobalt in the original sample.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Give the coordination numbers and write the formulas for each of the following, including all isomers where appropriate: (a) tetrahydroxozincate(ll) ion (tetrahedral). (b) hexacyanopalladate(IV) ion. (c) dichlomaurate(I) ion (note that aurum is Latin for "gold"). (d) diamminedichloroplatinum(Il). (e) potassium diamminetetrachlorochromate(III). (f) hexaamminecobalt(III) hexacyanochromate(III). (g) dibromobis(ethylenediamine) cobalt(III) nitrate
Sketch structure of Mo(DMe) Cl2 (NMe,)2 , thhen apply ean to this complex showing ligand analysis and oxidation state analysis
Consider the [Ir2(dimen)4] 2+ complex. Notice that the dimen ligand is asymmetric. There is also a different, symmetric diisocyano ligand referred to as “TM4” (structure shown to the right) that forms the same sort of binuclear complex that dimen does. Answer the following questions with supporting justification: a. How many geometric isomers (ignore any optical ones) of [Ir2(TM4)4] 2+ are there? b. How many geometric isomers (ignore any optical ones) of [Ir2(dimen)4] 2+ are there? c. In the “twisted” deformational isomer, would you expect [Ir2(TM4)4] 2+ or[Ir2(dimen)4] 2+ to be able to rotate polarized light? Justify your answer.
Provide a name for the following complex ion:[AuF4]^-
Many transition metal complexes are said to follow the “18-electron rule,” meaning they form particularly stable complexes when the metal + ligand electrons contributing to the MOs add up to a total of 18 electrons. a. Use the full MO diagram for an octahedral metal complex with pi-acidic ligands we derived in class to justify why 18-electrons might be particularly stable. b. Use the 18-electron rule to predict which 1st row transition metal would be most likely to form an octahedral M(CO)6 (Note: there is no charge; the metal retains all its electrons.) c. Qualitatively, how would you expect the CO bond to change when it forms this complex? Would it be stronger, weaker, or the same compared to free CO? (Hint: think about what a ? −???? means and what the orbital does from the perspective of the M–CO interaction as well as the C– O interaction).
The (2-aminoethyl)phosphine ligand, acts as a bidentate ligand with metalsof Transition.i) How many possible isomers of [dichlorobis{(2-aminoethyl)phosphine}nickel(II)] inoctahedral coordination exist? Draw them and identify the pairs of enantiomers.ii) Classify the configuration of the chiral isomers as D or L
Sketch the orientation of the orbitals relative to the ligandsin an octahedral complex to explain the splitting and the relativeenergies of the dxyand dx2-y2 the orbitals.
Inorganic Chemistry (i) Define spectrochemical series (ii) Explain the difference between weak-field and strong-field ligands
Explain why the tetrahedral complexes A and B have magnetic moments of 1.89 and 0.0 BM respectively. Comment on the observations.