What are the coefficients for the chemical equation below, once balanced? ___ CH3CH2CH2OH(l) + ___O2(g) ___CO2(g) + ___H2O(l)

What are the coefficients for the chemical equation below, once balanced? _ CH3CH2CH2OH(l) + _O2(g) _CO2(g) + _H2O(l)

Introductory Chemistry For Today

8th Edition

ISBN:9781285644561

Author:Seager

Publisher:Seager

Chapter5: Chemical Reactions

Section: Chapter Questions

Problem 5.70E

See similar textbooks

Related questions

Q: The illustration to the left represents a mixture of oxygen ( red ) and fluorine ( green )…

A: A balanced chemical equation is the one that contains the same count of different types of atoms on…

Q: Balance the following equations using lowest whole number coefficients. A number 1 must be placed…

A: Given Balance the following reaction 1) Na 3PO 4 (aq)+HCl (aq) → NaCl (aq) + H 3PO 4 (aq) 2)…

Q: N но What is the chemical formula for the limiting reactant in the reaction shown? chemical formula:…

Q: Consider the following unbalanced chemical equation: S2Cl2 (l) + NH3 (g) à S4N4 (s) + S8 (s) +…

A: S2Cl2 (l) + NH3 (g) ---> S4N4 (s) + S8 (s) + NH4Cl (s) Balancing of sulfur: In order to balance…

Q: Balance this chemical equation (shown below) with the algebraic method. FeS + O2 ----> Fe2O3 +…

A: Given FeS + O2 ----> Fe2O3 + SO2

Q: The circle below represents a mixture of A2 and B2 before they react to form AB3.…

A: The limiting reagent in a chemical reaction is a reactant that is totally consumed when the chemical…

Q: Calcium phosphate reacts with sulfuric acid to form calcium sulfate and phosphoric acid. What is the…

A: Given, Calcium phosphate reacts with sulfuric acid to form calcium sulfate and phosphoric acid.

Q: Iron(III) chloride and sodium sulfide react to form iron(III) sulfide and sodium chloride, according…

A: The reaction given is => FeCl3 + Na2S ---------> Fe2S3 + NaCl

Q: When the following equation is properly balanced, what are the coefficients for C,H6(), O2(g),…

A: Balanced chemical equation :- A chemical equation is said to be balanced if atoms of different…

Q: Determine whether each of the following equations is balanced or not balanced:

A: We get to know that whether the given equation is balanced or not by counting various atoms of…

Q: Question - Balance the following chemical equations: C8H18 + O2 ---> CO2 + H2O When you complete and…

Q: Given the unbalanced chemical equation, CH3OH(l) + O2(g) → CO2(g) + H2O(g), what is the mole ratio…

A: The reaction given is, => CH3OH (l) + O2 (g) -------> CO2 (g) + H2O (g)

Q: When the following equation is properly balanced, what are the coefficients for C6H6(l), O2(g),…

A: To balance a chemical equation, we balance each and every atom in the equation. i.e. Atoms of each…

Q: Consider the following unbalanced chemical equation: S2CI2 (1) + NH3 (g) à S4N4 (s) + S8 (s) + NH4CI…

A: Given the unbalanced equation: S2Cl2 (l) + NH3 (g) → S4N4 (s) +S8 (s) + NH4Cl (s) We have to find…

Q: How many moles of methane are produced when 85.1 molesmoles of carbon dioxide gas react with excess…

A: Number of moles of any substance is the ratio of mass of the substance to the molar mass of that…

Q: Balance the following skeletal chemical equations. (Use the lowest possible coefficients.)(a) Al(s)…

A: Balanced the following reactions-

Q: Balance the chemical equation. CS2 + NH3-H2S+ NH4SCN Assume the coefficient of NH,SCN is 1. What is…

Q: For the following unbalanced chemical equation, suppose exactly 6.70 g of each reactant is taken.…

A: Number of Mole- Ratio of given mass of substance to the molar mass of substance is called number of…

Q: HO What is the chemical formula for the limiting reactant in the reaction shown? chemical formula…

A: A limiting reactant is a reactant that is completely converted to products. Once all the limiting…

Q: Nitric oxide (NO) reacts with oxygen gas to form nitrogen dioxide (NO,), a dark brown gas: 2NO(g) +…

Q: 1.). Balance the equation above. Where the lines are, write the coefficient you would use to balance…

A: Note: As per guidelines, single question is allowed to each session, please post it seperatly, thank…

Q: What is the coefficient the should be placed in front of phosphorus trifluoride (PF3)? * F2+ P4 PF3…

A: The coefficient can be obtained by balancing the equation:

Q: If you have 3 moles of propane (C3H8) and 10 moles of oxygen, which is the limiting reactant?…

A: Which is the limiting reactant?

Q: When the following equation is balanced, the coefficients are C3H18 + 02 – CO2 + H20 О 2, 3, 4, 4 1,…

Q: 088 HO What is the chemical formula for the limiting reactant in the reaction shown? chemical…

A: Limiting reactant : Limiting reactants are those chemical species that are consumed completely in…

Q: CH4(g) gas reacts with F2(g) to produce CH3F(g) and HF(g). (a) A particulate representation of F2(g)…

A: The reaction taking place is given as,

Q: S + 6 HNO3 --> H2SO4 + 6 NO2 + 2 H2O In the above equation how many moles of water…

A: Given, S + 6 HNO3 → H2SO4 + 6 NO2 + 2 H2O moles of HNO3 consumed = 78 moles moles of water (H2O)…

Q: "Smelling salts," which are used to revive someone who has fainted, typically contain ammonium…

A: Generally, the ammonium carbonate is decomposed radially to form ammonia, carbon dioxide and water…

Q: Considering the reaction below, _______ is the limiting reactant when 26.0 g of acetylene (C2H2) and…

A: The limiting reagent in a chemical reaction is a reactant that is totally consumed when the chemical…

Q: Use the following UNBALANCED equation:____ N2 + ____ F2 -->____ NF3. How many moles of nitrogen…

A: The balanced equation is N2 + 3F2 -----> 2NF3

Q: Consider the following unbalanced equation ____Na2SiF6 + ____ Na ---------> ____Si +…

Q: __C6H14(l) + __O2(g) → __CO2(g) + __H2O(g) When this equation is properly balanced, the numbers…

A: According to the Law of conservation of mass " all atoms of different elements must be equal on both…

Q: ass of salicylic acid used 2.998 g Moles of salicylic acid (C7H6O3) used 0.0217 moles What is the…

A: Given that: Moles of salicylic acid used = 0.0217 moles To calculate: Theoretical yield of the…

Q: [References] nelling salts," which are used to revive someone who has fainted, typically contain…

A: The question is based on the concept of Reaction Stoichiometry. We have to calculate the mass of…

Q: For the reaction, Na2CO3+Ca(NO3)2-->CaCO3+2NaNO3 how many grams of calcium carbonate, CaCO3, are…

A: The balanced chemical equation is, Na2CO3 + Ca(NO3)2 → CaCO3 + 2NaNO3 The number of moles of Na2CO3…

Q: 6. A student collects the following data when decomposing a sample of baking soda, NaHCO3. Find the…

A: 1) To calculate the theoretical yield , we would use stoichiometric relation between reactant ,…

Q: Given the UNBALANCED chemical equation, Al + Cl2 ---> Alcl3, answer the following questions below:…

A: Consider the given unbalanced equation is as follows; Al + Cl2 → AlCl3

Q: For the following equation determine which reactant is the limiting reactant and which reactant is…

A: Limiting reactant: The limiting reagent (or limiting reactant or limiting agent) in a chemical…

Q: Consider the equation 2 C4H6 + 11 O2 → 8 CO2 + 6H2O. How many moles of CO2 are produced if 5 moles…

A: We need to know the limiting reactant and that will decide the amount of product formed. We will…

Q: For the following reaction, 0.497 moles of sulfur are mixed with 0.217 moles of carbon monoxide.…

A: Given, 0.497 moles of sulfur are mixed with 0.217 moles of carbon monoxide.

Q: When the following equation is properly balanced, what are the coefficients for C6H6(l), O2(g),…

A: The question is about writing the coefficients of the given Chemical equation -

Q: N2H4(g) + – N2O4(g) – N2(g) + – H2O(g) 1 3 4 MacBook Air

Q: Consider the following reaction H2 (g) + F2 (g) → 2 HF (g) Given 3.2 moles of H2, the number of…

Q: Smelling salts," which are used to revive someone who has fainted, typically contain ammonium…

A: To calculate mass of ammonia gas: First we have to calculate number of moles of ammonium carbonate,…

Q: C3Hg(g) + 502(g) 4H20(g) + 3CO2(g) If 211 g of propane (C3H8) is burned, find the mass of carbon…

Q: In the balanced chemical equation below, how many moles of sodium fluoride are needed to produce…

Q: When this equation is balanced with the smallest set of whole numbers, what is the coefficient for…

A: We have to determine the coefficient for N2 in the given chemical reaction after balancing the…

Q: The balanced reaction of calcium carbonate and hydrochloric acid is as follows: CACO3 (s) + 2…

A: A numerical problem based on quantitative analysis, which is to be accomplished.

Q: Methanol can be formed by the following UNBALANCED equation below. How many grams of methanol can be…

Q: Match the mole ratios from the following balanced equation: 6NO + 4NH3 --> 5N2 + 6H2O

A: Mole ratios is equal to stoichiometry cofficient ratio

Concept explainers

Stoichiometry

Stoichiometry is a chemical division that evaluates the quantitative content of the chemical process with the help of the reacting molecules or products taking part in the reaction. The term “stoicheion” in “Stoichiometry”, is an old Greek term for "element" whereas “metron” means "measure".

Question

100%

What are the coefficients for the chemical equation below, once balanced?

___ CH₃CH₂CH₂OH(l) + ___O₂(g) ___CO₂(g) + ___H₂O(l)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Explain how one determines which reactant in a process is the limiting reactant. Does this depend only on the masses of the reactant present? Give an example of how to determine the limiting reactant by using a Before-Change-After (RCA) table with a balanced chemical equation and reactant starling amounts.
For each of the following balanced reactions, calculate how many moles of each product would be produced by complete conversion of 0.50 mole of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;2H2O(l)2H2O(l)+O2(g) msp;2KClO3(s)2KCl(s)+3O2(g) msp;2Al(s)+6HCl(aq)2AlCl3(aq)+3H2(g) msp;C3H8(g)+5O2(g)3CO2(g)+4H2O(g)
The gaseous hydrocarbon acetylene, C2H2, is used in welders’ torches because of the large amount of heat released when acetylene burns with oxygen. :math>2C2H2(g)+5O2(g)4CO2(g)+2H2O(g) w many grams of oxygen gas are needed for the complete combustion of 150 g of acetylene?
The following diagram represents the high-temperature reaction between CH4 and O2. Use this diagram to answer the following questions. a. What are the chemical formulas of the products? b. How many moles of each product can be obtained if 6.0 moles of CH4 react?
Write the balanced chemical equation for the complete combustion of heptene, C7H14. In combustion, hcpLcnc reacts with oxygen to produce carbon dioxide and water. What is the mole ratio that would enable you to calculate the number of moles of oxygen needed to react exactly with a given number of moles of heptene? What mole ratios would you use to calculate how many moles of each product form from a given number of moles of heptene?
The following pictures show a molecular-scale view of a chemical reaction between the compounds AB2 and B2. (A at-oms are shown in blue and B atoms in white). The box on the left represents the box on the right shows what is left once the reaction has gone to completion. Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
The following diagram represents the high-temperature reaction between CH4 and H2O. Use this diagram to answer the following questions. a. What are the chemical formulas of the products? b. How many moles of each product can be obtained if 6.0 moles of CH4 react?
For each of the following unbalanced chemical equations, suppose 25.0 g of each reactant is taken. Show by calculation which reactant is limiting. Calculate the theoretical yield in grams of the product in boldface. msp;C2H5OH(l)+O2(g)CO2(g)+H2O(l) msp;N2(g)+O2(g)NO(g) msp;NaClO2(aq)+Cl2(g)NaCl(aq) msp;H2(g)+N2(g)NH3(g)
itamin B12 , cyancobalamin, is essential for human nutrition. Its molecular formula is C63H88CoN14O14P . A lack of this vita min in the diet can lead to anemia. Cyanocohalamin is the form of the vitamin found in vitamin supplements. l type='a'> What is the molar mass of cyanocobalamin to two decimal places? How many moles of cyanocohalamin molecules are present in 250 mg of cyanocobalamin? What is the mass of 0.60 mole of cyanocobalamin? How many atoms of hydrogen are in 1 .0 mole of cyanocobalamin? What is the mass of 1.0107 molecules of cyanocobalamin? What is the mass (in grams) of one molecule of cyanocobalamin?
When copper(ll) oxide is heated in the presence Of hydrogen gas, elemental copper and water are produced. What mass of copper can be obtained if 32.0 g of copper(ll) oxide is used?
Solid copper can be produced by passing gaseous ammonia over solid copper (II) oxide al high temperatures. mg src=Images/HTML_99425-9-66QAP_image001.jpg alt="" align="top"/> e other products of the reaction are nitrogen gas and water Vapor. The balanced equation for this reaction is: :math>2NH3(g)+3CuO(s)N2(g)+3Cu(s)+3H2O(g) at is the theoretical yield of solid copper that should form when 18.1 g of NH3, is reacted with 90.4 g of CuO? If only 45.3 g of copper is actually collected, what is the percent yield? mg src=Images/HTML_99425-9-66QAP_image002.jpg alt="" align="top"/>
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?