What reactant that remains after the chemical reaction stops?Select one:O A stoichiometryO B. excess reactantO C limiting reactantD. mole ratioWhen does a chemical reaction stops?Select one:A. When the excess reactant is used upB. Chemical reaction never stopsO C. When the lab is finishedO D. When the limiting reactant is used upWhich mole ratio is corect from the given chemical equation?2N, + 50,2N,0,Select oneO A 2 mol N, to 3 mol N,0,O B.2 mol N, to 2 mol N,0,O C.2 mol N, to 5 mol N,0,O D. 5 mol 0, to 2 mol NO,

The chemical reaction involves the combination of the reactant molecule in an appropriate mole ratio…

Answered: What reactant that remains after the…

Living by Chemistry

2nd Edition

ISBN:9781464142314

Author:Angelica M. Stacy

Publisher:Angelica M. Stacy

ChapterU4: Toxins: Stoichiometry, Solution Chemistry, And Acids And Bases

Section: Chapter Questions

Problem 20STP

See similar textbooks

Similar questions

onsider the balanced chemical equation :math>4Al(s)+3O2(g)2Al2O3(s). at mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of aluminum metal? What mole ratio would you use to calculate the number of moles of product that would be expected if a given number of moles of aluminum metal reacts completely?
For each of the following balanced equations, indicate how many moles of the product could be produced by complete reaction of 1.00 g of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;NH3(g)+HCl(g)NH4Cl(s) msp;CaO(s)+CO2(g)CaCO3(s) msp;4Na(s)+O2(g)2Na2O(s) msp;2P(s)+3Cl2(g)2PCl3(l)
Air Pollution Nitrogen monoxide, which is present in urban air pollution, immediately Converts to nitrogen dioxide as it reacts with oxygen. a. Write the balanced chemical equation for the formation of nitrogen dioxide from nitrogen monoxide. b. What mole ratio would you use to convert from moles of nitrogen monoxide to moles of nitrogen dioxide?
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
A weighed sample of iron (Fe) is added to liquid bromine (Br2) and allowed to react completely. The reaction produces a single product, which can be isolated and weighed. The experiment was repeated a number of times with different masses of iron but with the same mass of bromine (see graph below). (a) What mass of Br2 is used when the reaction consumes 2.0 g of Fe? (b) What is the mole ratio of Br2 to Fe in the reaction? (c) What is the empirical formula of the product? (d) Write the balanced chemical equation tor the reaction of iron and bromine. (e) What is the name of the reaction product? (f) Which statement or statements best describe the experiments summarized by the graph? (i) When 1.00 g of Fe is added to the Br2, Fe is the limiting reagent. (ii) When 3.50 g of Fe is added to the Br2, there is an excess of Br2. (iii) When 2.50 g of Fe is added to the Br2, both reactanu are used up compietely. (iv) When 2.00 g of Fe is added to the Br2, 10.8 g of product is formed. The percent yield must therefore be 20.0%.
For each of the following balanced chemical equations, calculate how many moles of product(s) would be produced if 0.500 mole of the first reactant were lo react completely. msp;CO2(g)+4H2(g)CH4(g)+2H2O(l) msp;BaCl2(aq)+2AgNO3(aq)2AgCl(s)+Ba(NO3)2(aq) msp;C3H8(g)+5O2(g)4H2O(l)+3CO2(g) msp;3H2SO4(aq)+2Fe(s)Fe2(SO4)3(aq)+3H2(g)
Consider the following generic reaction: Y2+2XY2XY2 In a limiting reactant problem, a certain quantity of each reactant is given and you are usually asked to calculate the mass of product formed. If 10.0 g of Y2 is reacted with 10.0 g of XY, outline two methods you could use to determine which reactant is limiting (runs out first) and thus determines the mass of product formed.
One mol of ammonia reacts with 1.00 mol of oxygen to form nitrogen oxide and water according to the reaction 4NH3(g)+5O2(g)4NO(g)+6H2O(l)State which statements are true about the reaction and make the false statements true. (a) All the oxygen is consumed. (b) 4.00 mol NO are produced. (c) 1.50 mol H2O are produced. (d) The description of the experiment does not provide enough information to determine percent yield. (e) Three moles of water are produced for every two moles of NO obtained.
3.59 The composition of materials such as alloys can be described in terms of mole percentage (mol%), atom percentage (at%), or weight percentage (wt%). Carry out the following conversions among these units. (a) 60 Cu and 40 Al to at%, (b) 25 mol% NiO and 75 mol % MgO to wt%, (C) 40 wt% MgO and 60 wt% Feo to mol %
Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.
he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
Nitrogen (N2) and hydrogen (H2)react to form ammonia (NH3). Consider the mixture of N2 and H2 in a closed container as illustrated below: Assuming the reaction goes to completion, draw a representation of the product mixture. Explain how you arrived at this representation.

Recommended textbooks for you

Living by Chemistry

Chemistry

ISBN:

9781464142314

Author:

Angelica M. Stacy

Publisher:

W. H. Freeman

World of Chemistry

Chemistry

ISBN:

9780618562763

Author:

Steven S. Zumdahl

Publisher:

Houghton Mifflin College Div

Introductory Chemistry: A Foundation

Chemistry

ISBN:

9781337399425

Author:

Steven S. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Living by Chemistry

Chemistry

ISBN:

9781464142314

Author:

Angelica M. Stacy

Publisher:

W. H. Freeman

World of Chemistry

Chemistry

ISBN:

9780618562763

Author:

Steven S. Zumdahl

Publisher:

Houghton Mifflin College Div

Introductory Chemistry: A Foundation

Chemistry

ISBN:

9781337399425

Author:

Steven S. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry

ISBN:

9781133611097

Author:

Steven S. Zumdahl

Publisher:

Cengage Learning

Chemistry

ISBN:

9781305957404

Author:

Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:

Cengage Learning

Chemistry: An Atoms First Approach

Chemistry

ISBN:

9781305079243

Author:

Steven S. Zumdahl, Susan A. Zumdahl

Publisher:

Cengage Learning

SEE MORE TEXTBOOKS