While ethanol (CH,CH,OH) is produced naturally by fermentation, e.g. in beer- and wine-making, industrially it is synthesized by reacting ethylene CH,CH,) with water vapor at elevated temperatures. A chemical engineer studying this reaction fills a 200. mL flask with 3.0 atm of ethylene gas and 1.9 atm of water vapor. When the mixture has come to equilibrium she determines that it contains 2.39 atm of ethylene gas and 1.29 atm of water vapor. The engineer then adds another 0.63 atm of water, and allows the mixture to come to equilibrium again. Calculate the pressure of ethanol after equilibrium is reached the second time. Round your answer to 2 significant digits. atm

While ethanol (CH,CH,OH) is produced naturally by fermentation, e.g. in beer- and wine-making, industrially it is synthesized by reacting ethylene CH,CH,) with water vapor at elevated temperatures. A chemical engineer studying this reaction fills a 200. mL flask with 3.0 atm of ethylene gas and 1.9 atm of water vapor. When the mixture has come to equilibrium she determines that it contains 2.39 atm of ethylene gas and 1.29 atm of water vapor. The engineer then adds another 0.63 atm of water, and allows the mixture to come to equilibrium again. Calculate the pressure of ethanol after equilibrium is reached the second time. Round your answer to 2 significant digits. atm

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 33P

See similar textbooks

Similar questions

. At high temperatures, elemental nitrogen and oxygen react with each other to form nitrogen monoxide. N2(g)+O2(g)2NO(g)Suppose the system is analyzed at a particular temperature, and the equilibrium concentrations arc found to be [N2]=0.041M. [O2]=0.0078M, and [NO]=4.710M. Calculate the value of K for the reaction.
Methanol can be synthesized by means of the equilibriumreaction CO(g)+2H2(g)CH3OH(g) for which the equilibrium constant at 225°C is 6.08103. Assume that the ratio of the pressures of CO(g) and H2(g) is 1:2. What values should they have if the partial pressureof methanol is to be 0.500 atm?
At a certain temperature, K=0.29 for the decomposition of two moles of iodine trichloride, ICl3(s), to chlorine and iodine gases. The partial pressure of chlorine gas at equilibrium is three times that of iodine gas. What are the partial pressures of iodine and chlorine at equilibrium?
At 500C, k for the for the formation of ammonia from nitrogen and hydrogen gases is 1.5105. N2(g)+3H2(g)2NH3(g)Calculate the equilibrium partial pressure of hydrogen if the equilibrium partial pressures of ammonia and nitrogen are 0.015 atm and 1.2 atm, respectively.
5.16. In atmospheric chemistry, the following chemical reaction converts , the predominant oxide of sulfur that comes from combustion of S-containing materials, to , which can combine with to make sulfuric acid (and thus contribute to acid rain): (a) Write the expression for K for this equilibrium. (b) Calculate the value of for this equilibrium using the values in Appendix 2. (c) Calculate the value of K for this equilibrium. (d) If of and of are enclosed in a system in the presence of some liquid, in which direction would the reaction move?
Colorless N2O4 gas decomposes to form red-brown colored NO2 gas. Describe how the concentrations of N2O4 and NO2 would change increase or decrease as equilibrium was established in a sealed container that initially contained only N2O4. What observation would indicate that equilibrium had been established?
. Suppose that for the reaction PCl5(g)PCl3(g)+Cl2(g)it is determined, at a particular temperature. that the equilibrium concentrations are [PCl5(g)]=0.0711M,[PCl3(g)]=0.0302M, and [Cl2(g)]=0.0491M. Calculate the value of K for he reaction at this temperature.
. Ammonia. a very important industrial chemical. is produced by the direct combination of the following elements under carefully controlled conditions: N2(g)+3H2(g)2NH3(g)Suppose. in an experiment, that the reaction mixture is analyzed after equilibrium is reached, and it is found, at a particular temperature. that [NH3]=0.25M,[H2]=3.4103M, and [N2]=5.3105M. Calculate the value of K at this temperature.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
. Many sugars undergo a process called mutarotation, in which the sugar molecules interconvert between two isomeric forms, finally reaching an equilibrium between them. This is true for the simple sugar glucose, C6H12O6, which exists in solution in isomeric forms called alpha-glucose and beta-glucose. If a solution of glucose at a certain temperature is analyzed, and it is found that the concentration of alpha-glucose is twice the concentration of beta-glucose, what is the value of K for the inter-conversion reaction?