Concept explainers
a.
Interpretation:
The complete structure with all atoms and lone pairs of given compound
Concept Introduction:
BOND LINE STRUCTURE:
The bond line structure is a simple way of representing a structure of carbon compound. Bonding of atom is represented by lines.
LEWIS STRUCTURE:
The bonds have to be drawn between atoms and the lone pair of electron present in a compound. It is otherwise known as Lewis dot diagram.
OCTET RULE:
The atoms share or lose or gain electrons to satisfy nearest electronic configuration of noble gases. The compound should be surrounded by eight valence electrons to form octet.
b.
Interpretation:
The complete structure with all atoms and lone pairs of given compound
Concept Introduction:
Refer part a.
![Check Mark](/static/check-mark.png)
Want to see the full answer?
Check out a sample textbook solution![Blurred answer](/static/blurred-answer.jpg)
Chapter 10 Solutions
Connect 1-Semester Online Access for Principles of General, Organic & Biochemistry
- Draw an acceptable Lewis structure from each condensed structure, such that all atoms have zero formal charge. a. diethyl ether, (CH3CH2)2O, the first general anesthetic used in medical procedures b.acrylonitrile, CH2CHCN, starting material used to manufacture synthetic Orlon fibers c.dihydroxyacetone, (HOCH2)2CO, an ingredient in sunless tanning products d.acetic anhydride, (CH3CO)2O, a reagent used to synthesize aspirinarrow_forwardHow would I convert each condensed formula to a lewis structure 1a. (CH3)2CHOCH2CH2CH2OH 1b. CH3(CH2)2CO2C(CH3)3arrow_forwardDraw an acceptable Lewis structure from each condensed structure, such that all atoms have zero formal charge. a. diethyl ether, (CH;CH2),0, the first general anesthetic used in medical procedures b. acrylonitrile, CH;CHCN, starting material used to manufacture synthetic Orlon fibers C. dihydroxyacetone, (HOCH2)¿CO, an ingredient in sunless tanning products d. acetic anhydride, (CH3CO),0, a reagent used to synthesize aspirinarrow_forward
- Based on the molecular formula, determine whether each compound is an alkane, alkene, or alkyne. (Assume that the hydro- carbons are noncyclical and there is no more than one multiple bond.) a. C5H12 b. C3H6 с. С-Н12 d. C11H22arrow_forwardConvert each condensed formula to a Lewis structure. CH3(CH2)4CH(CH3)2 (CH3)3CCH(OH)CH2CH3 (CH3)2CHCHO (HOCH2)2CH(CH2)3C(CH3)2CH2CH3arrow_forwardConvert each condensed formula to a Lewis structure.1.) (CH3)2CHOCH2CH2CH2OH2.) CH3(CH2)2CO2C(CH3)3arrow_forward
- Draw an acceptable Lewis structure from each condensed structure, such that all atoms have zero formal charge. a. diethyl ether, (CH3CH2)2O, the rst general anesthetic used in medical proceduresb. acrylonitrile, CH2CHCN, starting material used to manufacture synthetic Orlon bersc. dihydroxyacetone, (HOCH2)2CO, an ingredient in sunless tanning productsd. acetic anhydride, (CH3CO)2O, a reagent used to synthesize aspirinarrow_forwardBe sure to answer all parts. Convert each shorthand structure to a complete structure with all atoms and lone pairs drawn in. (CH3)3COH = draw structure ... CH3CO₂(CH₂)3CH3 = draw structure...arrow_forwardConvert each compound to a skeletal structure. a. CH 3(CH 2) 7CH 3 b. 1,1-diethylcyclohexane c. (CH 3CH 2) 2CHCH 2CH 2CH 3arrow_forward
- . Determine whether the two structures are isomers or the same molecule drawn in two different ways. a. CH3-CH,-c-o-CH3 CH, —С—о—сн, —сн, I b. c. CH3-HC-CH-CH3 ČH;CH3 CH; CH3-HC-CH-CH3 CH3arrow_forwardConvert each molecule to a skeletal structure. a. (CH3)2CHCH2CH2CH(CH3)2 b. CH3CH(Cl)CH(OH)CH3 c.CH3(CH2)2C(CH3)2CH(CH3)CH(CH3)CH(Br)CH3arrow_forwardChemistry 2.) Draw the condensed structures (NOT line structures) for the following reactions of alcohols. CH3 a.) H3C- [H'] CH2-CH- CH3 CH3 H3C-CH-CH3 b.) H;C-CH2-CH-CH2 CH2-OH [0]arrow_forward
![Text book image](https://www.bartleby.com/isbn_cover_images/9781337399692/9781337399692_smallCoverImage.gif)