(a)
Interpretation:
The given alcohol compound has to be classified as primary, secondary and tertiary alcohol.
Concept Introduction:
Alcohols are compounds which contain hydroxyl functional group. Alcohol in which the carbon bearing hydroxyl group is connected to three carbon atoms is tertiary alcohol. Alcohol in which the carbon bearing hydroxyl group is connected to two carbon atoms is secondary alcohol. Alcohol in which the carbon bearing hydroxyl group is connected to only one carbon atom is primary alcohol.
(b)
Interpretation:
The given alcohol compound has to be classified as primary, secondary and tertiary alcohol.
Concept Introduction:
Refer to part (a).
(c)
Interpretation:
The given alcohol compound has to be classified as primary, secondary and tertiary alcohol.
Concept Introduction:
Refer to part (a).
(d)
Interpretation:
The given alcohol compound has to be classified as primary, secondary and tertiary alcohol.
Concept Introduction:
Refer to part (a).
(e)
Interpretation:
The given alcohol compound has to be classified as primary, secondary and tertiary alcohol.
Concept Introduction:
Refer to part (a).
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
OWLv2 for Moore/Stanitski's Chemistry: The Molecular Science, 5th Edition, [Instant Access], 1 term (6 months)
- Classify the following alcohols as primary, secondary, or tertiary: a. b.CH3CH2CH2CH2OH c.arrow_forwardWhat functional group distinguishes each of the following hydrocarbon derivatives? a. halohydrocarbons b. alcohols c. ethers d. aldehydes e. ketones f. carboxylic acids g. esters h. amines Give examples of each functional group. What prefix or suffix is used to name each functional group? What are the bond angles in each? Describe the bonding in each functional group. What is the difference between a primary, secondary, and tertiary alcohol? For the functional groups in ah, when is a number required to indicate the position of the functional group? Carboxylic acids are often written as RCOOH. What does COOH indicate and what does R indicate? Aldehydes are sometimes written as RCHO. What does CHO indicate?arrow_forwardDifferentiate primary, secondary, and tertiary alcohols.arrow_forward
- 5. Draw the structure of each of the following alcohols. Then draw and name the product you would expect to produce by the oxidation of each. a. 4-Methyl-2-heptanol b. 3,4-Dimethyl-1-pentanol c. 4-Ethyl-2-heptanol d. 5,7-Dichloro-3-heptanolarrow_forwardConsider the following starting material and choose all of the functional groups that are likely to oxidize in it. a. aldehyde b. secondary alcohol c. alkane d. hemiacetal e. carboxylic acid f. alkenearrow_forward1. What functional group is produced when an aldehyde reacts with H2/Pt? A.secondary alcohol B. carboxylic acid C.hemiacetal D. primary alcohol E.alkane F.tertiary alcohol G. alkene 2. What reaction occurs when an aldehyde reacts with H2/Pt to form a primary alcohol? A. Hydration B. Hydration C. Dehydration D. Oxidation E. Reduction( hydrogentation) 3. What reaction occurs when an Ester react with H+/H2O to from a carboxylic acid and alcohol? A. Dehydration B. Reduction ( Hydrogenation) C.Hydrolysis D. Hydration E.oxidationarrow_forward
- Name 5 types of reactions for alcohols (organic chemistry)arrow_forwardWhat is the condensed structural formula for 3,3-diethyl-2-methylhexane? A. CH3CH2CH(CH2CH3)CH2(CH3)CH2CH3 B. CH3CH2C(CH2CH3)2CH2(CH3)CH2CH3 C. CH3CH(CH3)C(CH2CH3)2CH2CH2CH3 D. CH3C(CH3)2C(CH2CH3)2CH2CH2CH3arrow_forwardHO H₂C. CH O CH, H CH₂ ... Choose a match Alcohol Aldehyde Ketone Carboxylic acid Etherarrow_forward
- What are some examples of primary, secondary, and tertiary alcohols?arrow_forwardWhich is an example of an ether?A. CH3OH B. CH3CH2CH2Cl C. CH3CH2COOCH3 D. CH3CH2OCH2CH3arrow_forwardWhich alcohol should be most soluble in a nonpolar solvent such as hexane, C6H14 ? a. CH3CH2CH2OH b. CH3CH2OH c. CH3CH2CH2CH2OH d. CH3OH e. CH3CH2CH2CH2CH2OHarrow_forward
- Chemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: Matter and ChangeChemistryISBN:9780078746376Author:Dinah Zike, Laurel Dingrando, Nicholas Hainen, Cheryl WistromPublisher:Glencoe/McGraw-Hill School Pub Co
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning