Concept explainers
(a)
Interpretation:
The curved-arrow mechanism for nucleophilic substitution reaction of mechlorethamine with water is to be stated.
Concept introduction:
Nucleophilic substitution reactions are the reactions in which an nucleophile attacks the compounds and substitute a group which also acts as a nucleophile. The NGP is a phenomenon which helps in the enhancement of the rate of nucleophilic substitution reaction.
(b)
Interpretation:
The curved-arrow mechanism for cross-linking of the DNA molecule by mechlorethamine is to be stated.
Concept introduction:
Nucleophilic substitution reactions are the reactions in which an nucleophile attacks the compounds and substitute a group which also acts as a nucleophile. The NGP is a phenomenon which helps in the enhancement of the rate of nucleophilic substitution reaction.
Want to see the full answer?
Check out a sample textbook solutionChapter 11 Solutions
EBK ORGANIC CHEMISTRY
- Acyclovir is an effective antiviral agent used to treat the herpes simplexvirus. (a) Draw the enol form of acyclovir, and explain why it is aromatic.(b) Why is acyclovir typically drawn in its keto form, despite the fact thatits enol is aromatic?arrow_forwardwhat will be the type of interaction of ethane with bromine: a) radicals b) ionic c) nucleophilic d) electrophilicarrow_forwardPredict the major product of the following reaction and draw it in the space provided. 1) NH,NH, 2) KOH, heatarrow_forward
- Why aldehydes and ketones do not undergo nucleophilic substitution reaction?arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.arrow_forwardEthyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?arrow_forward
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.arrow_forwardWhich functional group has the maximum reactivity toward nucleophilic attack? a) acid chloride b) ketone c) ester d) amidearrow_forwardThe compound eutypine is an antibacterial agent isolated from the fungus Eutypa lata. This fungus results in a disease common to vineyards called eutyposis. Give a sequence of reactions that will take the following reactant and give eutypine when the other reactants used in the sequence are acetylene and acetone.arrow_forward
- Electrophilic aromatic substitution usually occurs at the 1-position of naphthalene, also called the a position. Predict themajor products of the reactions of naphthalene with the following reagents. f) fuming sulfuric acidarrow_forwardExplain why pentane-2,4-dione forms two alkylation products (A and B) when the number ofequivalents of base is increased from one to two.arrow_forward12) Which compound is stronger base? a) b) D A d) all the samearrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage Learning