Industrially, sodium metal is obtained by electrolyzing molten sodium chloride. The reaction at the cathode is
In view of the fact that potassium is a stronger reducing agent than sodium, explain why this approach works. (The boiling points of sodium and potassium are 892°C and 770°C, respectively.)
Want to see the full answer?
Check out a sample textbook solutionChapter 14 Solutions
Chemistry
- The direct reaction of iron(III) oxide. Fe2O3, to give iron and oxygen gas is a nonspontaneous reaction; normally, iron combines with oxygen to give rust (the oxide). Yet we do change iron(III) oxide, as iron ore, into iron metal. How is this possible? Explain.arrow_forwardAt 1 atm and 25 C, NO2 with an initial concentration of 1.00 M is 3.3103 decomposed into NO and O2. Calculate the value of the equilibrium constant for the reaction. 2NO2(g)2NO(g)+O2(g)arrow_forwardWrite the mathematical expression for the reaction quotient, QC, for each of the following reactions: (a) CH4(g)+CI2CH3CI(g)+HCI(g) (b) N2(g)+O2(g)2NO(g) (c) 2SO2(g)+O2(g)2SO3(g) (d) BaSO3(s)BaO(s)+SO2(g) (e) P4(g)+5O2(g)P4O10(s) (f) Br2(g)2Br(g) (g) CH4(g)+2O2(g)CO2(g)+2H2O(l) (h) CuSO45H2O(s)CuSO4(s)+5H2O(g)arrow_forward
- Given the following descriptions of reversible reactions, write a balanced net ionic equation (simplest whole-number coefficients) and the equilibrium constant expression (K) for each. (a) Liquid acetone (C3H6O) is in equilibrium with its vapor. (b) Hydrogen gas reduces nitrogen dioxide gas to form ammonia and steam. (c) Hydrogen sulfide gas (H2S) bubbled into an aqueous solution of lead(ll) ions produces lead sulfide precipitate and hydrogen ions.arrow_forward12.108 A nuclear engineer is considering the effect of discharging waste heat from a power plant into a lake and estimates that this may warm the water locally to 25 °C. One question to be considered is the effect of this temperature change on the uptake of CO2 by the water. The equilibrium constant for the reaction CO2+H2OH2CO3 ; is K=1.7103 at 25 °C. Because bonds form, the reaction is exothermic. (a) Will this reaction progress further toward products at higher temperatures near the water discharge with its warmer water than it would in the cooler lake water? Explain your reasoning. (b) Carbonic acid has a Kaof 2.5104 at 25 °C. What is the equilibrium constant for the CO2+2H2OHCO3+H3O+? (c) What additional factor should the engineer be considering about CO2 gas, probably before considering this reaction chemistry?arrow_forwardAt 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?arrow_forward
- Write the mathematical expression for the reaction quotient, QC, for each of the following reactions (a) N2(g)+3H2(g)2NH3(g) (b) 4NH3(g)+5O2(g)4NO(g)+6H2O(g) (C) N2O2(g)2NO2(g) (d) CO2(g)+H2CO(g)+H2O(g) (e) NH4CI(s)NH3(g)+HCI(g) (f) 2Pb( NO3)2(s)2PbO(s)+4NO2(g)+O2(g) (g) 2H2(g)+O2(g)2H2O(g) (h) S8(g)8S(g)arrow_forwardBecause carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?arrow_forwardAdenosine triphosphate, ATP, is used as a free-energy source by biological cells. (See the essay on page 624.) ATP hydrolyzes in the presence of enzymes to give ADP: ATP(aq)+H2O(l)ADP(aq)+H2PO4(aq);G=30.5kJ/molat25C Consider a hypothetical biochemical reaction of molecule A to give molecule B: A(aq)B(aq);G=+15.0kJ/molat25C Calculate the ratio [B]/[A] at 25C at equilibrium. Now consider this reaction coupled to the reaction for the hydrolysis of ATP: A(aq)+ATP(aq)+H2O(l)B(aq)+ADP(aq)+H2PO4(aq) If a cell maintains a high ratio of ATP to ADP and H2PO4 by continuously making ATP, the conversion of A to B can be made highly spontaneous. A characteristic value of this ratio is [ATP][ADP][H2PO4]=500 Calculate the ratio [B][A] in this case and compare it with the uncoupled reaction. Compared with the uncoupled reaction, how much larger is this ratio when coupled to the hydrolysis of ATP?arrow_forward
- . Gaseous phosphorus pentachloride decomposes according to the reaction PCl5(g)PCl3(g)+Cl2(g)The equilibrium system was analyzed at a particular temperature, and the concentrations of the substances present were determined to be [PCl5]=1.1102M,[PCl3]=0.325M. and [Cl2]=3.9103M. Calculate the value of K for the reaction.arrow_forwardThe following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1arrow_forwardWhat is the approximate value of the equilibrium constant KP for the change C2H5OC2H5(l)C2H5OC2H5(g) at 25 C. {Vapor pressure was described in the previous Chapter on liquids and solids; refer back to this chapter to find the relevant information needed to solve this problem.)arrow_forward
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781285199030Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStax