Interpretation:
Reason for why angle found in p-nitroaniline means that the
Concept Introduction:
Hybridization is the mixing of valence atomic orbitals to get equivalent hybridized orbitals that having similar characteristics and energy.
Geometry of different types of molecule with respect to the hybridizations are mentioned are mentioned below,
Resonance is an electron displacement effect for stabilizing a molecule through delocalization of bonding electrons in the pi orbital.
Delocalized electrons stabilize a compound. The extra stability gains from having delocalized electrons are called resonance stabilization or resonance energy.
Want to see the full answer?
Check out a sample textbook solutionChapter 23 Solutions
ORGANIC CHEMISTRY-OWL V2 ACCESS
- Which of the following concepts can be used to explain the difference in acidity between acetic acid (CH3COOH) an 19 ethanol (CH3CH2OH)? Multiple Choice Hybridization Electronegativity Resonance Sizearrow_forwardWhat is the meaning of the term tertiary (3°) when it is used to classify amines? Draw a structural formula for the one tertiary (3°) amine known as Hünig’s base (N,N-diisopropylethylamine).arrow_forwardAcrylic fibers are polymers made from a starting material called acrylonitrile, H2C(CH)CN. In acrylonitrile, a - CN group replaces a hydrogen atom on ethene. Draw the Lewis diagram for this molecule, give the hybridization of each carbon atom, and describe the \pi orbitals and the number of electrons that occupy each one. Draw the three-dimensional structure of the molecule, showing all angles.arrow_forward
- 2) Based on valence bond theory, which statement best describes the electron geometry and hybridization of the central atom(s) in acetylene HCCH? A) The electron geometry of the 2 carbons in acetylene is linear with a sp hybridization. B) The electron geometry of the 2 carbons in acetylene is trigonal planar with a sp2 hybridization. C) The electron geometry of the 2 carbons in acetylene is tetrahedral with a sp3 hybridization.arrow_forwardThe pyridine molecule C5H5N has a planar geometry. What is the hybridization of each atom in the ring? Draw a diagram to show all the hybrid orbitals (in one color) and the pz orbitals (in a different color) contributing to the pi MO. Is the molecule aromatic? The thiophene molecule is also planar. What is the hybridization of each atom in the ring? Draw a diagram to show all the hybrid orbitals (in one color) and the pz orbitals (in a different color) contributing to the pi MO. Is the molecule aromatic?arrow_forward2. Complete the table for the indicated compounds Molecule C2H2 SF5- NO3- Lewis structure include lone pairs & formal charges on each atom Resonance structures don't have to include lone pairs; write N/A if there are none Electron Geometry Hybridization on central atom Overlapping orbitals include value of n in the orbital name (e.g. 1s, not s). Write N/A if that kind of bond is not present in the molecule T: Molecular Geometry Bond angle(s) include < as necessary 3D structure and polarity don't have to include lone pairs; draw the |dipole arrow on the molecule or write "non- polar"arrow_forward
- This is the shape of the sp hybrid carbons in this compound. tetrahedral trigonal planar linear square This is the General Formula of alkanes, where n is the number of C. CnH2n CnH2n-2 CnH2n+2 CnH2n-4 This class of organic compounds is saturated with only carbon-carbon single bonds. O Alkynes Alkenes Alkanes Arenes O Oarrow_forwardWhat is the molecular structure about the nitrogen atom in trimethyl amine and in the trimethyl ammonium ion, (CH3)3NH+? What is the hybridization of the nitrogen atom in trimethyl amine and in the trimethyl ammonium ion?arrow_forward1. Draw the bond-line structures of Ibuprofen, Naproxen, and Acetaminophen. Determine the number of sp³- and sp2 hybridized carbon atoms by completing the table below: Compound of sp3-hybridized # of sp²-hybridized # carbon atoms carbon atoms Ibuprofen - C13H1802 Naproxen - C14H13 Na03 Acetaminophen C3H,NO,arrow_forward
- 2. Name the following hydrocarbon. Predict the hybridization (sp³, sp2, o sp) in the asteroid carbon. Mention the shape and bond anglearrow_forward3. Give the definition of a covalent bond. Draw a schematic representation of the overlap of orbitals to form a o bond between two carbon atoms in the sp-hybrid state.arrow_forwardDraw the Lewis Structures for the following molecules and give the hybridization for each carbon atom. a) 2-methyl-1-butanol, CH3CH2CH2(CH3)CH2OH b) Ethyl propanoate, CH3CH2CO2CH2CH3 c) Methyl cyanide (aka acetonitrile), CH3CN d) Isopropyl phenyl ether, (CH3)2CHOC6H5 e) N,N-dimethylpentamide, CH3CH2CH2CH2CON(CH3)2arrow_forward
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistryChemistryISBN:9781259911156Author:Raymond Chang Dr., Jason Overby ProfessorPublisher:McGraw-Hill EducationPrinciples of Instrumental AnalysisChemistryISBN:9781305577213Author:Douglas A. Skoog, F. James Holler, Stanley R. CrouchPublisher:Cengage Learning
- Organic ChemistryChemistryISBN:9780078021558Author:Janice Gorzynski Smith Dr.Publisher:McGraw-Hill EducationChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningElementary Principles of Chemical Processes, Bind...ChemistryISBN:9781118431221Author:Richard M. Felder, Ronald W. Rousseau, Lisa G. BullardPublisher:WILEY