Chemistry for Engineering Students
3rd Edition
ISBN: 9781285199023
Author: Lawrence S. Brown, Tom Holme
Publisher: Cengage Learning
expand_more
expand_more
format_list_bulleted
Concept explainers
Textbook Question
Chapter 3, Problem 3.90PAE
3.98 The characteristic odor of decaying flesh is due to the presence of various nitrogen-containing compounds. One such compound, called putrescine, was analyzed and found to contain 54.49% carbon, 13.72% hydrogen, and 31.78% nitrogen by mass. If the molar mass of putrescine is known to be between 85 and 105, what is its molecular formula?
Expert Solution & Answer
Trending nowThis is a popular solution!
Chapter 3 Solutions
Chemistry for Engineering Students
Ch. 3 - • describe the chemical processes used in biomass...Ch. 3 - Prob. 2COCh. 3 - list at least three quantities that must be...Ch. 3 - Write balanced chemical equations for simple...Ch. 3 - Prob. 5COCh. 3 - Prob. 6COCh. 3 - Interconvert between mass, number of molecules,...Ch. 3 - Determine a chemical formula from elemental...Ch. 3 - define the concentration of a solution and...Ch. 3 - Calculate the molarity of solutions prepared by...
Ch. 3 - Prob. 11COCh. 3 - Prob. 12COCh. 3 - Prob. 13COCh. 3 - write molecular and ionic equations for acidbase...Ch. 3 - Prob. 3.1PAECh. 3 - Prob. 3.2PAECh. 3 - Prob. 3.3PAECh. 3 - A newspaper article states that biomass has...Ch. 3 - Prob. 3.5PAECh. 3 - Prob. 3.6PAECh. 3 - Which symbols are used to indicate solids,...Ch. 3 - How is the addition of heat symbolized in a...Ch. 3 - Prob. 3.9PAECh. 3 - 3.10 Define the term stoichiometric coefficient.Ch. 3 - 3.11 Balance these equations. (a) Al(s) + O2(g)(...Ch. 3 - 3.11 Balance the following equations. (a) CaC2(s)...Ch. 3 - 3.13 An explosive whose chemical formula is...Ch. 3 - 3.14 A number of compounds are used in cement, and...Ch. 3 - 3.15 Ethanol, C2H5OH is found in gasoline blends...Ch. 3 - 3.16 Balance the following equations. (a) reaction...Ch. 3 - 3.17 Write balanced chemical equations for the...Ch. 3 - 3.18 Diborane and related compounds were proposed...Ch. 3 - 3.19 Silicon nitride, Si3N4, is used as a...Ch. 3 - The following pictures show a molecular-scale view...Ch. 3 - Prob. 3.21PAECh. 3 - Prob. 3.22PAECh. 3 - Prob. 3.23PAECh. 3 - Prob. 3.24PAECh. 3 - Prob. 3.25PAECh. 3 - 3.24 Classify the following compounds as...Ch. 3 - 3.25 The following compounds are water-soluble....Ch. 3 - 3.26 Decide whether each of the following is...Ch. 3 - Prob. 3.29PAECh. 3 - 3.28 A packaging engineer is working on a new...Ch. 3 - 3.29 Classify each of these as an acid or a base....Ch. 3 - 3.30 Define the term spectator ion.Ch. 3 - 3.31 What is the difference between a total ionic...Ch. 3 - 3.32 Balance the following equations and then...Ch. 3 - 3.33 Balance the following equations, and then...Ch. 3 - 3.34 In principle, it may be possible to engineer...Ch. 3 - 3.35 Explain the concept of the mole in your own...Ch. 3 - 3.36 How many entities are present in each of the...Ch. 3 - 3.37 If atypical grain of sand occupies a volume...Ch. 3 - 3.38 Estimate the size of a particle 1 mole of...Ch. 3 - 3.39 Calculate the molar mass of each of the...Ch. 3 - 3.40 Calculate the molar masses (in grams per...Ch. 3 - 3.41 Calculate the molar mass of each of these...Ch. 3 - Prob. 3.44PAECh. 3 - 3.43 Calculate the molar mass of the following...Ch. 3 - 3.44 Determine the molar mass of these ceramic...Ch. 3 - A chemist needs exactly 2 moles of KNO3 to make a...Ch. 3 - 3.46 What mass of ozone (O3) contains 4.5 moles of...Ch. 3 - 3.47 Calculate the mass in grams of each the...Ch. 3 - 3.48 Calculate the mass in grams of 13.5 mol of...Ch. 3 - 3.49 How many moles are present in the given...Ch. 3 - 3.50 A test of an automobile engine's exhaust...Ch. 3 - 3.51 Modern instruments can measure a mass as...Ch. 3 - 3.52 How many H atoms are present in 7.52 g of...Ch. 3 - 3.53 How many O atoms are present in 214 g of...Ch. 3 - A sample of H2C2O4.2H2O of mass 3.35 g is heated...Ch. 3 - 3.55 An average person inhales roughly 2.5 g of O2...Ch. 3 - 3.56 A large family of boron-hydrogen compounds...Ch. 3 - Prob. 3.59PAECh. 3 - 3.58 Determine the simplest formulas of the...Ch. 3 - 3.59 The composition of materials such as alloys...Ch. 3 - 3.60 Copper can have improved wear resistance if...Ch. 3 - 3.61 Calculate the molarity of each of the...Ch. 3 - 3.62 What is the molarity of each ion present in...Ch. 3 - 3.63 How many moles of solute are present in each...Ch. 3 - 3.64 How many grams of solute are present in each...Ch. 3 - 3.65 Determine the final molarity for the...Ch. 3 - Prob. 3.68PAECh. 3 - Prob. 3.69PAECh. 3 - 3.68 Magnesium is lighter than other structural...Ch. 3 - Prob. 3.71PAECh. 3 - Prob. 3.72PAECh. 3 - 3.71 What is meant by the term carbon reservoir?...Ch. 3 - Prob. 3.74PAECh. 3 - Prob. 3.75PAECh. 3 - Prob. 3.76PAECh. 3 - 3.87 Nitric acid (HNO3) can be produced by the...Ch. 3 - 3.88 One Step in the enrichment of uranium for use...Ch. 3 - 3.89 Pyridine has the molecular formula C5H5N....Ch. 3 - 3.90 Pyrrole has the molecular formula C4H5N. When...Ch. 3 - 3.91 Hydrogen cyanide (HCN) is extremely toxic,...Ch. 3 - 3.92 Many chemical reactions take place in the...Ch. 3 - 3.93 Adipic acid is used in the production of...Ch. 3 - 3.94 Calcium carbonate (limestone, CaCO3)...Ch. 3 - Prob. 3.85PAECh. 3 - Consider two samples of liquid: 1 mole of water...Ch. 3 - 3.95 Cumene is a hydrocarbon, meaning that it...Ch. 3 - 3.96 Methyl cyanoacrylate is the chemical name for...Ch. 3 - 3.97 A low-grade form of iron ore is called...Ch. 3 - 3.98 The characteristic odor of decaying flesh is...Ch. 3 - 3.99 Iron—platinum alloys may be useful as...Ch. 3 - 3.100 Some aluminum—lithium alloys display the...Ch. 3 - 3.101 Which (if any) of the following compounds...Ch. 3 - 3.102 Classify the following compounds as acids or...Ch. 3 - 3.103 What is the mass in grams of solute in 250.0...Ch. 3 - 3.104 What volume of 0.123 M NaOH in milliliters...Ch. 3 - 3.105 Nitric acid is often sold and transported as...Ch. 3 - 3.106 Twenty-five mL of a 0.388 M solution of...Ch. 3 - 3.107 As computer processor speeds increase, it is...Ch. 3 - 3.108 As chip speeds increase, the width of the...Ch. 3 - 3.109 Materials engineers often create new alloys...Ch. 3 - 3.110 The protein that carries oxygen in the blood...Ch. 3 - 3.111 The chlorophyll molecule responsible for...Ch. 3 - 3.112 In one experiment, the burning of 0.614 g of...Ch. 3 - 3.113 MgCl2 is often found as an impurity in table...Ch. 3 - Prob. 3.106PAECh. 3 - 3.115 The average person exhales 1.0 kg of carbon...Ch. 3 - 3.116 The simplest approximate chemical formula...Ch. 3 - 3.117 For the oxides of iron, FeO, Fe2O3, and...Ch. 3 - 3.118 Consider common sugars such as glucose...Ch. 3 - Prob. 3.111PAECh. 3 - 3.120 1f you have 32.6 g of sodium carbonate that...Ch. 3 - 3.121 If you have 21.1 g of iron(II) nitrate that...Ch. 3 - 3.122 What type of reasoning were we using when we...Ch. 3 - 3.123 Most periodic tables provide molar masses...
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.Similar questions
- 3.95 Cumene is a hydrocarbon, meaning that it contains only carbon and hydrogen. If this compound is 89.94% C by mass and its molar mass is 120.2 g/mol, what is its molecular formula?arrow_forward3.96 Methyl cyanoacrylate is the chemical name for the substance sold as Super Glue, and it has the chemical formula C5H5NO2. Calculate the number of molecules of this substance in a 1.0-ounce tube of Super Glue, assuming that the glue is 80% methyl cyanoacrylate by mass.arrow_forwardAcetylene is a colorless gas used as a fuel in welding torches, among other things. It is 92.26% C and 7.74% H. Its molar mass is 26.02 g/mol. What are the empirical and molecular formulas of acetylene?arrow_forward
- The structure of one of the bases in DNA, adenine, is shown here. Which represents the greater mass: 40.0 g of adenine or 3.0 1023 molecules of the compound?arrow_forwardCacodyl, a compound containing arsenic, was reported in 1842 by the German chemist Robert Wilhelm Bunsen. It has an almost intolerable garlic-like odor. Its molar mass is 210 g/mol, and it is 22.88% C, 5.76% H, and 71.36% As. Determine its empirical and molecular formulas.arrow_forwardWhich molecule has a molecular mass of 28.05 amu?arrow_forward
- Vitamin A has a molar mass of 286.4 g/mol and a general molecular formula of CxHyE, where E is an unknown element. If vitamin A is 83.86% C and 10.56% H by mass, what is the molecular formula of vitamin A?arrow_forward3.111 The chlorophyll molecule responsible for photosynthesis in plants contains 2.72% Mg by mass. There is only one Mg atom per chlorophyll molecule. How can you determine the molar mass of chlorophyll based on this information?arrow_forward3.123 Most periodic tables provide molar masses with four or five significant figures for the elements. How accurately would you have to measure the mass of a sample of roughly 100 g to make a calculation of the number of moles of the chemical to have its significant figures limited by the molar mass calculation rather than the mass measurement?arrow_forward
- Methanol, CH3OH, is prepared industrially from the gas-phase catalytic balanced reaction that has been depicted here using molecular models. In a laboratory test, a reaction vessel was filled with 41.1 g CO und 10.2 g H2. How many grams of methanol would be produced in a complete reaction? Which reactant remains unconsumed at the end of the reaction? How many grams of it remain?arrow_forwardAcrylic acid, used in the manufacture of acrylic plastics, has the composition 50.0% C, 5.6% H, and 44.4% O. What is its empirical formula?arrow_forwardCalcium carbide, CaC2, used to produce acetylene, C2H2, is prepared by heating calcium oxide, CaO, and carbon, C, to high temperature. CaO(s)+3C(s)CaC2(s)+CO(g) If a mixture contains 8.49 kg of each reactant, how many grams of calcium carbide can be prepared?arrow_forward
arrow_back_ios
arrow_forward_ios
Recommended textbooks for you
- Chemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
Chemistry for Engineering Students
Chemistry
ISBN:9781337398909
Author:Lawrence S. Brown, Tom Holme
Publisher:Cengage Learning
Chemistry: Principles and Practice
Chemistry
ISBN:9780534420123
Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer
Publisher:Cengage Learning
Chemistry: An Atoms First Approach
Chemistry
ISBN:9781305079243
Author:Steven S. Zumdahl, Susan A. Zumdahl
Publisher:Cengage Learning
Chemistry & Chemical Reactivity
Chemistry
ISBN:9781337399074
Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel
Publisher:Cengage Learning
Chemistry & Chemical Reactivity
Chemistry
ISBN:9781133949640
Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel
Publisher:Cengage Learning
General Chemistry - Standalone book (MindTap Cour...
Chemistry
ISBN:9781305580343
Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; Darrell
Publisher:Cengage Learning
Step by Step Stoichiometry Practice Problems | How to Pass ChemistryMole Conversions Made Easy: How to Convert Between Grams and Moles; Author: Ketzbook;https://www.youtube.com/watch?v=b2raanVWU6c;License: Standard YouTube License, CC-BY