Concept explainers
(a)
Interpretation:
The bond enthalpy and energy should be calculated for the
Concept Introduction:
The mathematical expression for the standard enthalpy change value at room temperature is:
Where, n and p represents the coefficients of reactants and products in the balanced chemical equation.
The mathematical expression for the standard enthalpy is:
According Hess’s law,
The mathematical expression for standard internal energy change is:
(b)
Interpretation:
The bond enthalpy and energy should be calculated for the
Concept Introduction:
The mathematical expression for the standard enthalpy change value at room temperature is:
Where, n and p represents the coefficients of reactants and products in the balanced chemical equation.
The mathematical expression for the standard enthalpy is:
According Hess’s law,
The mathematical expression for standard internal energy change is:
(c)
Interpretation:
The bond enthalpy and energy should be calculated for the
Concept Introduction:
The mathematical expression for the standard enthalpy change value at room temperature is:
Where, n and p represents the coefficients of reactants and products in the balanced chemical equation.
The mathematical expression for the standard enthalpy is:
According Hess’s law,
The mathematical expression for standard internal energy change is:
Want to see the full answer?
Check out a sample textbook solutionChapter 4 Solutions
Thermodynamics, Statistical Thermodynamics, & Kinetics
- Hydrogen peroxide, H2O2, is a colorless liquid whose solutions are used as a bleach and an antiseptic. H2O2 can be prepared in a process whose overall change is H2(g)+O2(g)H2O2(l) Calculate the enthalpy change using the following data: H2O2(l)H2O(l)+12O2(g);H=98.0kJ2H2(g)+O2(g)2H2O(l);H=571.6kJarrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardCalcium oxide, CaO, is prepared by heating calcium carbonate (from limestone and seashells). CaCO3(s)CaO(s)+CO2(g) Calculate the standard enthalpy of reaction, using enthalpies of formation. The Hf of CaO(s) is 635 kJ/mol. Other values are given in Table 6.2.arrow_forward
- The head of a strike anywhere match contains tetraphosphorus trisulfide, P4S3. In an experiment, a student burned this compound in an excess of oxygen and found that it evolved 3651 kJ of heat per mole of P4S3 at a constant pressure of 1 atm. She wrote the following thermochemical equation: P4S3(s)+8O2(g)P4O10(s)+3SO2(g);H=3651kJ Calculate the standard enthalpy of formation of P4S3, using this students result and the following standard enthalpies of formation: P4O10(s), 3009.9 kJ/mol; SO2(g), 296.8 kJ/mol. How does this value compare with the value given in Appendix C?arrow_forwardAnother reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?arrow_forwardHydrogen sulfide, H2S, is a poisonous gas with the odor of rotten eggs. The reaction for the formation of H2S from the elements is H2(g)+18S3(rhombic)H2S(g) Use Hesss law to obtain the enthalpy change for this reaction from the following enthalpy changes: H2S(g)+32O2(g)H2O(g)+SO2(g);H=518kJH2(g)+12O2(g)H2O(g);H=242kJ18S8(rhombic)+O2(g)SO2(g);H=297kJarrow_forward
- A 10.00-g sample of acetic acid, HC2H3O2, was burned in a bomb calorimeter in an excess of oxygen. HC2H3O2(l)+2O2(g)2CO2(g)+2H2O(l) The temperature of the calorimeter rose from 25.00C to 35.84C. If the heat capacity of the calorimeter and its contents is 13.43 kJ/C, what is the enthalpy change for the reaction?arrow_forwardA sample of ethanol, C2H5OH, weighing 2.84 g was burned in an excess of oxygen in a bomb calorimeter. The temperature of the calorimeter rose from 25.00C to 33.73C. If the heat capacity of the calorimeter and contents was 9.63 kJ/C, what is the value of q for burning 1.00 mol of ethanol at constant volume and 25.00C? The reaction is C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) Is q equal to U or H?arrow_forwardCompounds with carboncarbon double bonds, such as ethylene, C2H4, add hydrogen in a reaction called hydrogenation. C2H4(g)+H2(g)C2H6(g) Calculate the enthalpy change for this reaction, using the following combustion data: C2H4(g)+3O2(g)2CO2(g)+2H2O(l);H=1411kJC2H6(g)+72O2(g)2CO2(g)+3H2O(l);H=1560kJH2(g)+12O2(g)H2O(l);H=286kJarrow_forward
- Ethanol, C2H5OH, is used as a fuel for motor vehicles, particularly in Brazil. (a) Write the balanced equation for the combustion of ethanol to CO2(g) and H2O(g), and, using the data in Appendix G, calculate the enthalpy of combustion of 1 mole of ethanol. (b) The density of ethanol is 0.7893 g/mL. Calculate the enthalpy of combustion of exactly 1 L of ethanol. (c) Assuming that an automobile’s mileage is directly proportional to the heat of combustion of the fuel, calculate how much farther an automobile could be expected to travel on 1 L of gasoline than on 1 L of ethanol. Assume that gasoline has the heat of combustion and the density of n—octane, C8H18(Hf=208.4kJ/mol;density=0.7025g/mL).arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forwardHydrogen sulfide gas is a poisonous gas with the odor of rotten eggs. It occurs in natural gas and is produced during the decay of organic matter, which contains sulfur. The gas burns in oxygen as follows: 2H2S(g)+3O2(g)2H2O(l)+2SO2(g) Calculate the standard enthalpy change for this reaction using standard enthalpies of formation.arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning