Concept explainers
Interpretation:
The standard enthalpy of formation
Concept Introduction:
The standard enthalpy of formation
Hess's law of constant heat summation states that the total enthalpy change for a given reaction can be expressed as a sum of the enthalpies of the intermediate reactions i.e.
Here, ΔH = total enthalpy change
ΔH1, ΔH2… ΔHn are the enthalpy changes of the intermediate steps.
Want to see the full answer?
Check out a sample textbook solutionChapter 4 Solutions
Thermodynamics, Statistical Thermodynamics, & Kinetics
- White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.arrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forward
- Under what circumstances is the heat of a process equal to the enthalpy change for the process?arrow_forwardThe enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardCalculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.arrow_forward
- Use Appendix L to find the standard enthalpies of formation of oxygen atoms, oxygen molecules (O2), and ozone (O3). What is the standard state of oxygen? Is the formation of oxygen atoms from O2 exothermic? What is the enthalpy change for the formation of 1 mol of O3 from O2?arrow_forwardGive the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.arrow_forwardThe enthalpy of combustion of diamond is -395.4 kJ/mol. C s, dia O2 g CO2 g Determine the fH of C s, dia.arrow_forward
- Physical ChemistryChemistryISBN:9781133958437Author:Ball, David W. (david Warren), BAER, TomasPublisher:Wadsworth Cengage Learning,ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning