Does the enthalpy of formation of
Want to see the full answer?
Check out a sample textbook solutionChapter 4 Solutions
Thermodynamics, Statistical Thermodynamics, & Kinetics
- The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardThe Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forward
- White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.arrow_forwardUse Hesss law to calculate the enthalpy change for the formation of CS2() from C(s) and S(s) [C(s) + 2 S(s) CS2()] from the following enthalpy values. C(s)+O2(g)CO2(g)rH1=393.5kJ/mol-rxnS(s)+O2(g)SO2(g)rH2=296.8kJ/mol-rxnCS2(l)+3O2(g)CO2(g)+2SO2(g)rH3=1103.9kJ/mol-rxnarrow_forwardOne step in the manufacturing of sulfuric acid is the conversion of SO2(g) to SO3(g). The thermochemical equation for this process is SO2(g)+12O2(g)SO3(g)H=98.9kJ The second step combines the SO3 with H2O to make H2SO4. (a) Calculate the enthalpy change that accompanies the reaction to make 1.00 kg SO3(g). (b) Is heat absorbed or released in this process?arrow_forward
- In a coffee-cup calorimeter, 1.60 g NH4NO3 is mixed with 75.0 g water at an initial temperature of 25.00C. After dissolution of the salt, the final temperature of the calorimeter contents is 23.34C. Assuming the solution has a heat capacity of 4.18 J/C g and assuming no heat loss to the calorimeter, calculate the enthalpy change for the dissolution of NH4NO3 in units of kJ/mol.arrow_forwardUse Appendix L to find the standard enthalpies of formation of oxygen atoms, oxygen molecules (O2), and ozone (O3). What is the standard state of oxygen? Is the formation of oxygen atoms from O2 exothermic? What is the enthalpy change for the formation of 1 mol of O3 from O2?arrow_forwardThe first step in the production of nitric acid from ammonia involves the oxidation of NH3. 4 NH3(g) + 5 O2(g) 4 NO(g) + 6 H2O(g) (a) Use standard enthalpies of formation to calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat in the oxidation of 10.0 g of NH3?arrow_forward
- Chemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage Learning
- Chemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning