Concept explainers
Determine whether
a. The complete combustion of one mole of butan-1-ol.
b. The complete combustion of one mole of glucose,
c. The decomposition of solid ammonium nitrate to produce liquid water and gaseous dinitrogen monoxide.
Trending nowThis is a popular solution!
Learn your wayIncludes step-by-step video
Chapter 7 Solutions
GENERAL CHEMISTRY(LL)-W/MASTERINGCHEM.
Additional Science Textbook Solutions
CHEMISTRY-TEXT
Essential Organic Chemistry (3rd Edition)
Chemistry & Chemical Reactivity
Chemistry: The Central Science (13th Edition)
Organic Chemistry
General, Organic, and Biological Chemistry (3rd Edition)
- Use Appendix L to find the standard enthalpies of formation of oxygen atoms, oxygen molecules (O2), and ozone (O3). What is the standard state of oxygen? Is the formation of oxygen atoms from O2 exothermic? What is the enthalpy change for the formation of 1 mol of O3 from O2?arrow_forwardConsider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.arrow_forwardThe decomposition of ozone, O3, to oxygen, O2, is an exothermic reaction. What is the sign of q? If you were to touch a flask in which ozone is decomposing to oxygen, would you expect the flask to feel warm or cool?arrow_forward
- When 1.000 g of gaseous butane, C4H10, is burned at 25C and 1.00 atm pressure, H2O(l) and CO2(g) are formed with the evolution of 49.50 kJ of heat. a Calculate the molar enthalpy of formation of butane. (Use enthalpy of formation data for H2O and CO2.) b Gf of butane is 17.2 kJ/mol. What is G for the combustion of 1 mol butane? c From a and b, calculate S for the combustion of 1 mol butane.arrow_forwardA sample of nickel is heated to 99.8C and placed in a coffee-cup calorimeter containing 150.0 g water at 23.5C. After the metal cools, the final temperature of metal and water mixture is 25.0C. If the specific heat capacity of nickel is 0.444 J/C g, what mass of nickel was originally heated? Assume no heat loss to the surroundings.arrow_forwardIn earlier times, ethyl ether was commonly used as an anesthetic. It is, however, highly flammable. When five milliliters of ethyl ether, C4H10O(l)(d=0.714g/mL), are burned in a bomb calorimeter, the temperature rises from 23.5C to 39.7C. The calorimeter contains 1.200 kg of water and has a heat capacity of 5.32 kJ/C. (a) What is qH2o? (b) What is qcal? (c) What is q for the combustion of 5.00 mL of ethyl ether? (d) What is q for the combustion of one mole of ethyl ether?arrow_forward
- 9.42 Why is enthalpy generally more useful than internal energy in the thermodynamics of real world systems?arrow_forwardAt 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?arrow_forwardIndicate which state function is equal to heat, q, for each process described. a. The ignition of a sample in a bomb calorimeter, an unyielding, heavy metal chamberin which samples are burned for heat content analysis b.The melting of an icecube in a cup c.The cooling down ofthe inside of arefrigerator d.A fire in a fireplacearrow_forward
- Nitric acid, HNO3, can be prepared by the following sequence of reactions: 4NH3(g)+5O2(g)4NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(l)+NO(g) How much heat is evolved when 1 mol of NH3(g) is converted to HNO3(l)? Assume standard states at 25 C.arrow_forwardCoal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.arrow_forwardGasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forward
- Physical ChemistryChemistryISBN:9781133958437Author:Ball, David W. (david Warren), BAER, TomasPublisher:Wadsworth Cengage Learning,General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningLiving By Chemistry: First Edition TextbookChemistryISBN:9781559539418Author:Angelica StacyPublisher:MAC HIGHER
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning