Concept explainers
Interpretation: The
Concept Introduction: For the overall processes, the enthalpy change can be determined by adding the enthalpy change of all the steps involved in the process is known as Hess’s Law. The equation to show Hess’s law is:
Answer to Problem 65E
Explanation of Solution
Given:
Rules related to enthalpies of the reaction are:
- When a reaction is inverted, then the sign of enthalpy is also inverted.
- When a reaction is multiplied by ‘n’ coefficient, then the value of enthalpy is multiplied by ‘n’ value.
The required equation is:
In order to obtain the required equation, reversing reaction (1) and adding to reaction (3).
Adding reaction (2) to reaction (6)
Now multiply reaction (5) by 2 and add reaction (7) to it:
Now reverse the reaction (4) and add to the reaction (8).
Cancelling the common terms in above equation:
Want to see more full solutions like this?
Chapter 9 Solutions
Chemical Principles
- The enthalpy change for the following reaction is 393.5 kJ. C(s,graphite)+O2(g)CO2(g) (a) Is energy released from or absorbed by the system in this reaction? (b) What quantities of reactants and products are assumed? (c) Predict the enthalpy change observed when 3.00 g carbon burns in an excess of oxygen.arrow_forwardGiven: 2Cu2O(s) + O2(g) 4CuO(s)H = 288 kJ Cu2O(s) CuO(s) + CuO(s)H = 11kJ Calculate the standard enthalpy of formation (Ht) for CuO(s).arrow_forwardIs the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)arrow_forward
- The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?arrow_forward9.41 Under what conditions does the enthalpy change equal the heat of a process?arrow_forwardThe first step in the preparation of lead from its ore (galena, PbS) consists of roasting the ore. PbS(s)+32O2(g)SO2(g)+PbO(s) Calculate the standard enthalpy change for this reaction, using enthalpies of formation (see Appendix C).arrow_forward
- The Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?arrow_forwardEnthalpy changes for the following reactions can be determined experimentally: N2(g) + 3 H2(g) 2 NH3(g) rH = 91.8 kJ/mol-rxn 4 NH3(g) + 5 O2(g) 4 NO(g) + 6 H2O(g) rH = 906.2 kJ/mol-rxn H2(g) + O2(g) H2O(g) rH = 241.8 kl/mol-rxn Use these values to determine the enthalpy change for the formation of NO(g) from the elements (an enthalpy change that cannot be measured directly because the reaction is reactant-favored). N2(g) + O2(g) NO(g) rH = ?arrow_forwardThe first step in the production of nitric acid from ammonia involves the oxidation of NH3. 4 NH3(g) + 5 O2(g) 4 NO(g) + 6 H2O(g) (a) Use standard enthalpies of formation to calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat in the oxidation of 10.0 g of NH3?arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning