Are the reactants or products favored at equilibrium in each reaction?
a.
b.
c.
Want to see the full answer?
Check out a sample textbook solutionChapter 9 Solutions
General, Organic, and Biological Chemistry - 4th edition
- Convert the values of KC to values of KP to the values of KP to values of Kc. (a) N2(g)+3H2(g)2NH3(g) Kc=0.50 at 400 C (b) H2(g)+I2(g)2HI(g) Kc=50.2 at 448 C (c) Na2SO410H2O(s)Na2SO4(s)+10H2O(g) Kp=4.081025 at 25C (d) H2O(l)H2O(g) Kp=0.122 at 50 Carrow_forwardEquilibrium: Co(H2O)62+ (aq) + 4 Cl-(aq) ⇌ CoCl42- (aq) + 6 H2O (l) pink blue a. You put 5 mL of stock solution into each of five test tubes. (25 mLs divided evenly into 5 test tubes). Test tube 1 was your control. To test tube 2, you added some water. Which direction did the equilibrium shift? How do you know? b. To test tube 3 you added some silver nitrate. Did this shift the equilibrium? If so, how is that possible as silver ion and nitrate ion are not in the equation? c. To test tube 5, you put the stock solution into hot water and it turned blue; then you put it into ice water and it turned pink. Explain what happened.arrow_forwardLitmus is a compound that changes color depending on the concentration of H+ and OH- present in a solution. In .1 M HCl, litmus turns red. In 0.1 M NaOH, litmus turns blue. From this information, which of the following reactions describes the Litmus equilibrium? a. More info is needed to answer this question. b. blue litmus + OH^-1 (aq) ---> red litmus. c. blue litmus + H+ (aq) ---> red litmus.arrow_forward
- 1- Consider the following chemical reaction at equilibrium: HF(aq) + H₂O(l) ⇌ H₃O⁺(aq) + F⁻(aq) If HF(aq) is added, how will the equilibrium shift?arrow_forwardNiCO3 (s) ---> Ni^2+(aq) + CO3^2-(aq) K1 = 6.6 x 10^-9 HCO3^-(aq) + H2O(ℓ) CO3^2-(aq) + H3O^+(aq) K2 = 4.8 x 10^-11 equilibrium constant for the following reaction NiCO3(s) + H3O^+(aq) ---> Ni^2+(aq) + HCO3^-(aq) + H2O(ℓ) K3 = ?arrow_forwardYou have found the following: CaSO4(s) <=> Ca+2(aq) + SO4-2(aq) K = (6.053x10^-5) What is the value of K for the following reaction? 2 CaSO4(s) <=> 2 Ca+2(aq) + 2 SO4-2(aq) Note: Your answer is assumed to be reduced to the highest power possible. Please provide neat and clean handwriting and clear image Give answer correctlyarrow_forward
- Given the two reactions PbCl2(aq) <-> Pb2+(aq) +2Cl− (aq), K = 1.83×10−10 AgCl(aq) <->Ag+(aq) + Cl− (aq) K = 1.29×10−4 what is the equilibrium constant Kfinal for the following reaction? PbCl2(aq) + 2Ag+(aq) <-> 2AgCl(aq) +Pb2+ (aq)arrow_forwardConsider the following chemical reaction at equilibrium: HF(aq) + H₂O(l) ⇌ H₃O⁺(aq) + F⁻(aq) If one drop of aqueous hydrochloric acid (HCl) is added, in which direction will the equilibrium (Q) shift? A) reactants B) products C) neither the reactants nor the productsarrow_forwardHemoglobin is the protein in red blood cells that transports oxygen to cells throughout your body. Each hemoglobin (Hb) molecule attaches to four oxygen molecules: Hb(aq) + 4 O2(aq) ⇌ Hb(O2)4(aq) In which direction does the above equilibrium shift in each of the following situations: (a)At high elevations the air pressure is lowered reducing the [O2] in the blood. (b)At high altitude, climbers sometimes breathe pressurized oxygen from a tank to increase the [O2] in the blood. (c)People who live at higher altitudes produce more hemoglobin.arrow_forward
- For the following equilibrium reaction: NaOH(Aq) + HCl(aq) HOH(aq) + NaCl(aq) + Δ What happens if you add: A) KCl B)KBrarrow_forward1- What happens to the H atom In 2CH4 + 3O2 2CO + 4H2O? 2- 2NH3 (g) + 92kJ <--> N2 (g) + 3H2 (g) which of the following will cause the equilibrium to shift toward the reactants? a.Reducing the pressure b.Removal of N2 c.Increasing the temperature d.Removal of H2 e.Removal of NH3 3- 2RbOH + H2SO4 Rb2SO4 + 2H2O, what happens to the oxidation number of the Rb atom? 4- 6H+ + 2MnO4- + 5H2O2 2Mn+2 + 5O2 + 8H2O, what is being oxidized and reduced in this redox reaction? 5- Fe + I2 FeI2 what is being oxidized and reduced in this redox reaction?arrow_forwardAccording to the equation below, at equilibrium would the amount of nitrogen monoxide (NO) increase or decrease if more nitrogen dioxide (NO2) is added? 2 NO2 (g) ⇌ NO3 (g) + NO (g)arrow_forward
- Chemistry by OpenStax (2015-05-04)ChemistryISBN:9781938168390Author:Klaus Theopold, Richard H Langley, Paul Flowers, William R. Robinson, Mark BlaserPublisher:OpenStaxChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage Learning