3. Provide crystal field splitting diagrams that clearly show orbital names, orbitalelectron population, and 10D (i.e. A.) for the following complexes. Use yourknowledge of the spectrochemical series and crystal field theory to determine LSvs. HS.a. [Fe(CN)6]+b. [Pt(NH3)4]+c. [Pt(CI)6]?-d. [Ni(Cl)«]²-

The degeneracy of d or f- orbitals breaks when the ligands come close to the metal ion. This happens…

3. Provide crystal field splitting diagrams that clearly show orbital names, orbital electron population, and 10Dq (i.e. Ao) for the following complexes. Use your knowledge of the spectrochemical series and crystal field theory to determine LS vs. HS. a. [Fe(CN)«]+ b. [Pt(NH3)4]2* c. [Pt(Cl)&]²- d. [Ni(Cl)4]?

3. Provide crystal field splitting diagrams that clearly show orbital names, orbital electron population, and 10Dq (i.e. Ao) for the following complexes. Use your knowledge of the spectrochemical series and crystal field theory to determine LS vs. HS. a. [Fe(CN)«]+ b. [Pt(NH3)4]2* c. [Pt(Cl)&]²- d. [Ni(Cl)4]?

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter20: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 97CP

See similar textbooks

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Experiments show that K4[Cr(CN)6] is paramagnetic and has two unpaired electrons. The related complex K4[Cr(SCN)6] is paramagnetic and has four unpaired electrons. Account for the magnetism of each compound using the ligand field model. Predict where the SCN ion occurs in the spectro-chemical series relative to CN.