![Pearson eText Biology: Life on Earth with Physiology -- Instant Access (Pearson+)](https://www.bartleby.com/isbn_cover_images/9780135755785/9780135755785_largeCoverImage.gif)
Pearson eText Biology: Life on Earth with Physiology -- Instant Access (Pearson+)
12th Edition
ISBN: 9780135755785
Author: Gerald Audesirk, Teresa Audesirk
Publisher: PEARSON+
expand_more
expand_more
format_list_bulleted
Concept explainers
Textbook Question
Chapter 3, Problem 1FIB
In organic molecules made of chains of subunits, each subunit is called a(n) _____, and the chains are called _____. Carbohydrates consisting of long chains of sugars are called_____. These sugar chains can be broken down by _____ reactions. Three types of carbohydrates consisting of long glucose chains are _____, _____, and
Expert Solution & Answer
![Check Mark](/static/check-mark.png)
Want to see the full answer?
Check out a sample textbook solution![Blurred answer](/static/blurred-answer.jpg)
Students have asked these similar questions
When two carbohydrates bond, they do so through a reaction called
This produce a molecule called a_____. A molecule comprising numerous carbohydrates is called a______.
linoleic acid
polyunsaturated
weaker
higher
more
stearic acid
similar
stronger
saturated
lower
less
Consider a hypothetical amino acid whose side chain forms a hydrogen bond with
the oxygen atom of a water molecule. Based on this information, which of the
following statements is correct?
The side chain of the amino acid is hydrophobic.
The side chain of the amino acid is negatively charged.
It is not possible to determine if the amino acid is positively charged, negatively
charged, or hydrophobic.
The side chain of the amino acid is positively charged.
Chapter 3 Solutions
Pearson eText Biology: Life on Earth with Physiology -- Instant Access (Pearson+)
Ch. 3.1 - which of these is/are polar molecules? (you may...Ch. 3.1 - define organic molecules and explain why carbon is...Ch. 3.1 - explain why functional groups are important in...Ch. 3.1 - name and describe the properties of seven...Ch. 3.2 - define organic molecules and explain why carbon is...Ch. 3.3 - Describe hydrolysis of this molecule.Ch. 3.3 - describe the major types of carbohydrates?Ch. 3.3 - provide examples of each type of carbohydrate and...Ch. 3.4 - Look up the rest of the amino acids and. based on...Ch. 3.4 - Infectious prions such as those that cause mad cow...
Ch. 3.4 - Why do many proteins, when heated excessively....Ch. 3.4 - Why a Perm Is (Temporarily) Permanent?Ch. 3.4 - describe protein subunits and how proteins are...Ch. 3.4 - explain the four levels of protein structure and...Ch. 3.4 - list several functions of proteins and provide...Ch. 3.4 - Prob. 4CYLCh. 3.5 - describe the general structure of nucleotides?Ch. 3.5 - list three different functions of nucleotides?Ch. 3.5 - explain how nucleic acids are synthesized?Ch. 3.5 - give two examples of nucleic acids and their...Ch. 3.5 - Puzzling Proteins All cells use DNA as a blueprint...Ch. 3.6 - What kind of reaction breaks this molecule apart?Ch. 3.6 - An obese 55-year-old woman consults her physician...Ch. 3.6 - Why are steroid hormones able to diffuse through...Ch. 3.6 - compare and contrast the structure and synthesis...Ch. 3.6 - describe the functions of fats, oils, and waxes?Ch. 3.6 - Prob. 3CYLCh. 3.6 - Prob. 1CTCh. 3 - Polar molecules a. dissolve in lipids. b. are...Ch. 3 - Prob. 2MCCh. 3 - Prob. 3MCCh. 3 - Which of the following is not composed of...Ch. 3 - Prob. 5MCCh. 3 - In organic molecules made of chains of subunits,...Ch. 3 - Prob. 2FIBCh. 3 - Prob. 3FIBCh. 3 - Prob. 4FIBCh. 3 - Fill in the following with the appropriate type of...Ch. 3 - Prob. 1RQCh. 3 - List the four principal classes of biological...Ch. 3 - Prob. 3RQCh. 3 - Prob. 4RQCh. 3 - Prob. 5RQCh. 3 - Describe the synthesis of a protein from amino...Ch. 3 - Where in nature do we find cellulose? Where do we...Ch. 3 - Based on their structure, sketch and explain how...Ch. 3 - Prob. 2ACCh. 3 - Prob. 3AC
Knowledge Booster
Learn more about
Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, biology and related others by exploring similar questions and additional content below.Similar questions
- When the carbohydrate maltose is digested into two glucose monosaccharide sugars (by maltase in the human small intestine), the resulting glucose monomers are properly defined as: the catalysts the substrates the enzymes the reactants the productsarrow_forwardFats have the most potential energy of all the biomolecules because they have the most ___________________ atoms associated with ___________________ atoms. Your answer should consist of the first blank word with a comma and a space between them. For example: black, whitearrow_forwardThe symbol for the fatty acid below is ________________: ________________, n-____________________. CH3(CH2)2(CH=CHCH2)2(CH2)4COOH (This is a multiple blank question, e.g. for 12:1, n-3 you would enter 12, 1, and 3.)arrow_forward
- Cells can store energy as starches (long polymer forms of carbohydrates, or sugars) and fats. If you isolate the starch stored by a cell, you would find that a lot of the mass of the isolated starch is actually water. However, if you isolate the fat stored by a cell you would find that very little of the mass of the fat is water. Explain this difference based on the structures or properties of the starch and fat moleculesarrow_forwardWhich of the following names best describes the molecule? A. Pentose B. α-glucose C. β-fructose D. L-sugar E. ketosearrow_forwardLactose is a disaccharide made of a glucose and a galactose bonded together. Lactose is found in milk yet does not taste sweet because our taste receptors do not sense lactose. Our taste receptors do sense galactose and glucose. How can a mug of warm milk taste sweet, without adding sugar? [Select the best answer.] The activation energy required for the hydrolysis of lactose into glucose and galactose is supplied by heating the milk. The milk proteins are denatured by the heat. The reaction is endergonic so the heat is the energy required for the reaction to occur. The lactose has less free energy than the glucose and galactose.arrow_forward
- Let us say that the four major classes of biomolecules (Carbohydrates, Proteins, Nucleic Acids, and Lipids) are in the form of food, which one of the four do you think will give you the most energy? Why?arrow_forwardWhich of the following molecules is likely to have the most potential energy? A molecule of glucose A molecule of ATP A molecule of ADP A polysaccharidearrow_forwardAmong the simplest_ , those called_, are glucose (an_) and _(a _).arrow_forward
- Describe two conditions when it is more advantageous to use carbohydrates as a metabolic fuel rather than lipids, and explain why . Why might lipids be more advantageous under the opposite condition?arrow_forwardDixie Bee wanted to make JELL-O shots for her next party, but felt guilty about encouraging her guests to consume alcohol. She tried to compensate for the toxicity of the alcohol by adding pieces of healthy fresh pineapple to the shots, but when she did, the JELL-O never solidified. What happened? Hint: JELL-O is mainly sugar and a gelatinous mixture of proteins.arrow_forwardMatch each type of molecule with its description. _________ chain of amino acids _________ energy carrier _________ glycerol, fatty acids, _________ phosphate _________ chain of nucleotides _________ one or more sugar units a. carbohydrate b. phospholipid c. protein d. DNA e. ATParrow_forward
arrow_back_ios
SEE MORE QUESTIONS
arrow_forward_ios
Recommended textbooks for you
- Human Biology (MindTap Course List)BiologyISBN:9781305112100Author:Cecie Starr, Beverly McMillanPublisher:Cengage LearningBiology Today and Tomorrow without Physiology (Mi...BiologyISBN:9781305117396Author:Cecie Starr, Christine Evers, Lisa StarrPublisher:Cengage LearningConcepts of BiologyBiologyISBN:9781938168116Author:Samantha Fowler, Rebecca Roush, James WisePublisher:OpenStax College
![Text book image](https://www.bartleby.com/isbn_cover_images/9781305112100/9781305112100_smallCoverImage.gif)
Human Biology (MindTap Course List)
Biology
ISBN:9781305112100
Author:Cecie Starr, Beverly McMillan
Publisher:Cengage Learning
![Text book image](https://www.bartleby.com/isbn_cover_images/9781305117396/9781305117396_smallCoverImage.gif)
Biology Today and Tomorrow without Physiology (Mi...
Biology
ISBN:9781305117396
Author:Cecie Starr, Christine Evers, Lisa Starr
Publisher:Cengage Learning
![Text book image](https://www.bartleby.com/isbn_cover_images/9781938168116/9781938168116_smallCoverImage.gif)
Concepts of Biology
Biology
ISBN:9781938168116
Author:Samantha Fowler, Rebecca Roush, James Wise
Publisher:OpenStax College
Macromolecules | Classes and Functions; Author: 2 Minute Classroom;https://www.youtube.com/watch?v=V5hhrDFo8Vk;License: Standard youtube license