Silicon (28 g, 1.0 mole) and oxygen (128 g, 4.0 moles) are reacted in a sealed container. At the end of the reaction, how much silicon, oxygen, and silicon dioxide are present in the container? Complete the following table. Si O2 SiO, + Starting Moles 1.0 mol 4.0 mol O mol Change -1.0 mol Ending Moles Ending Grams O, change: mol SiO, change: mol Si ending moles: mol Si ending grams:

Silicon (28 g, 1.0 mole) and oxygen (128 g, 4.0 moles) are reacted in a sealed container. At the end of the reaction, how much silicon, oxygen, and silicon dioxide are present in the container? Complete the following table. Si O2 SiO, + Starting Moles 1.0 mol 4.0 mol O mol Change -1.0 mol Ending Moles Ending Grams O, change: mol SiO, change: mol Si ending moles: mol Si ending grams:

World of Chemistry

7th Edition

ISBN:9780618562763

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 52A

See similar textbooks

Similar questions

or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
A possible practical way to eliminate oxides of nitrogen(such as NO2 ) from automobile exhaust gases uses cyanuricacid, C3N3(OH)3 . When heated to the relatively lowtemperature of 625°F, cyanuric acid converts to gaseousisocyanic acid (HNCO). Isocyanic acid reacts with NO2 inthe exhaust to form nitrogen, carbon dioxide, and water,all of which are normal constituents of the air. (a) Write balanced equations for these two reactions. (b) If the process described earlier became practical, howmuch cyanuric acid (in kilograms) would be requiredto absorb the 1.71010kgNO2 generated annuallyin auto exhaust in the United States?
4.17 Phosgene is a highly toxic gas that has been used as a chemical weapon at times in the past. It is now used in the manufacture of polycarbonates, which are used to make phone cases and plastic eyeglass lenses. Phosgene is produced by the reaction, CO+Cl2COCl2 . Given an excess of carbon monoxide, what mass of chlorine gas must be reacted to form 4.5 g of phosgene?
Explain how one determines which reactant in a process is the limiting reactant. Does this depend only on the masses of the reactant present? Give an example of how to determine the limiting reactant by using a Before-Change-After (RCA) table with a balanced chemical equation and reactant starling amounts.
onsider the balanced chemical equation :math>4Al(s)+3O2(g)2Al2O3(s). at mole ratio would you use to calculate how many moles of oxygen gas would be needed to react completely with a given number of moles of aluminum metal? What mole ratio would you use to calculate the number of moles of product that would be expected if a given number of moles of aluminum metal reacts completely?
Cryolite (Na3AlF6) is used in the production of aluminumfrom its ores. It is made by the reaction 6NaOH+Al2O3+12HF2Na3AlF6+9H2O Calculate the mass of cryolite that can be prepared by thecomplete reaction of 287gAl2O3 .
At high temperatures, silicon dioxide reacts with carbon to produce silicon carbide, SiC, also known as carborundum, an important industrial abrasive. If the reaction is run with 100. g of each reactant: (a) Determine the limiting reactant; and (b) Calculate the mass of excess reactant remaining after the reaction is over.
Small quantities of ammonia gas can be generated in the laboratory by heating an ammonium salt with a strong base. For example, ammonium chloride reacts with sodium hydroxide according to the following balanced equation: :math>NH4Cl(s)+NaOH(s)NH3(g)+NaCl(s)+N2O(g) at mass of ammonia gas is produced if 1.39 g of ammonium chloride reacts completely?
Alkali metal hydroxides are sometimes used to “scrub” excess carbon dioxide from the air in closed spaces (such as submarines and spacecraft). For example, lithium hydroxide reacts with carbon dioxide according to the unbalanced chemical equation :math>LiOH(s)+CO2(g)Li2CO3(s)+H2O(g) ppose a lithium hydroxide canister contains 155 g of LiOH(s). What mass of CO2(g)will the canister be able to absorb? If it is found that after 24 hours of use the canister has absorbed 102 g of carbon dioxide, what percentage of its capacity has been reached?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Consider a reaction represented by the following balanced equation :math>2A+3BC+4D u find that it requires equal masses of A and B so that there are no reactants left over. Which of the following is true? Justify your choice. l type='a'> The molar mass of A must be greater than the molar mass of B. i>The molar mass of A must be less than the molar mass of B. i>The molar mass of A must be the same as the molar mass of B.