Skip to main content

Bartleby Sitemap - Textbook Solutions

All Textbook Solutions for Chemical Principles

What two first-row transition metals have unexpectedelectron configurations? A statement in the text says thatfirst-row transition metal ions do not have 4s electrons.Why not? Why do transition metal ions often have severaloxidation states, whereas representative metals generallyhave only one?9E 10E 11E 12E 13E 14E 15E Define each of the following terms. a. coordination compound b. complex ion c. counter ions d. coordination number e. ligand f. chelate g. bidentate 17E When a metal ion has a coordination number of 2, 4, or6, what are the observed geometries and associated bondangles? For each of the following, give the correct formulasfor the complex ions. a. linear Ag+ complex ions having CN- ligands b. tetrahedral Cu+ complex ions having H2O ligands c. tetrahedral Mn2+ complex ions having oxalateligands d. square planar Pt2+ complex ions having NH3 ligands e. octahedral Fe3+ complex ions having EDTA ligands f. octahedral Co2+ complex ions having Cl- ligands g. octahedral Cr3+ complex ions having ethylenediamineligands The compound cisplatin, Pt(NH3)2Cl2 , has been studiedextensively as an antitumor agent. The reaction for thesynthesis of cisplatin is: K2PtCl4(aq)+2NH3(aq)Pt(NH3)2Cl2(s)+2KCl(aq) Write the electron configuration for platinum ion in cisplatin.Most d8 transition metal ions exhibit square planargeometry. With this and the name in mind, draw thestructure of cisplatin.20E 21E 22E 23E 24E 25E 26E 27E 28E 29E 30E 31E 32E 33E 34E 35E 36E 37E For the process Co(NH3)5Cl2++Cl2Co(NH3)4Cl2++NH3 What would be the expected ratio of cis to trans isomersin the product?39E 40E 41E 42E 43E 44E 45E 46E 47E 48E 49E 50E 51E 52E 53E Consider the complex ions Co(NH3)63+,Co(CN)63-,andCoF63- . The wavelengths of absorbed electromagneticradiation for these compounds are (in no specific order)770 nm, 440 nm, and 290 nm. Match the complex ion tothe wavelength of absorbed electromagnetic radiation.55E 56E How many unpaired electrons are in the following complexions? a.Ru(NH3)62+(low-spincase)b.Ni(H2O)62+c.V(en)33+58E 59E 60E 61E 62E 63E 64E 65E 66E 67E 68E 69AE 70AE 71AE 72AE 73AE 74AE 75AE 76AE 77AE 78AE 79AE 80AE 81AE 82AE 83AE 84AE 85AE 86AE 87AE 88AE 89AE 90AE 91AE 92AE 93AE 94AE 95AE 96AE 97CP 98CP 99CP 100CP 101CP 102CP 103CP 104CP 1E 2E 3E 4E 5E 6E 7E 8E 9E 10E 11E 12E 13E 14E 15E 16E 17E 18E 19E 20E 21E 22E 23E 24E 25E 26E 27E 28E 29E 30E 31E 32E 33E 34E 35E The earth receives 1.81014kJ/s of solar energy. Whatmass of solar material is converted to energy over a 24-hperiod to provide the daily amount of solar energy to theearth? What mass of coal would have to be burned toprovide the same amount of energy? Coal releases 32 kJof energy per gram when burned.37E 38E 39E 40E 41E 42E 43E 44E 45E 46E 47E 48E 49E 50E 51E 52E 53E 54E 55E 56E 57E 58E 59E 60E 61AE 62AE 63AE 64AE 65AE 66AE 67AE 68AE 69AE 70AE 71AE 72AE 73AE 74AE 75AE 76AE 77CP 78CP 79CP 80CP 81CP 82CP 84CP 1E 2E Why are cyclopropane and cyclobutane so reactive?4E 5E 6E 7E Name the five structural isomers of C6H14 .Draw the structural formula for each of the following. a. 3-isobutylhexane b. 2,2,4-trimethylpentane, also called isooctane. Thissubstance is the reference (100 level) for octaneratings. c. 2-tert-butylpentane d. The names given in parts a and c are incorrect. Givethe correct names for these hydrocarbons.10E 11E Name each of the following cyclic alkanes, and indicatethe formula of the compound.13E 14E 15E 16E 17E 18E 19E 20E 21E 22E 23E 24E 25E 26E 27E 28E 29E 30E Name the following compounds.32E 33E 34E 35E 36E 37E 38E 39E 40E 41E Draw structural formulas for each of the following alcohols.Indicate whether the alcohol is primary, secondary,or tertiary. a. 1-butanol c. 2-methyl-1-butanol b. 2-butanol d. 2-methyl-2-butanol 43E 44E 45E 46E 47E 48E 49E 50E 51E 52E 53E 54E 55E 56E 57E 58E 59E Give an example reaction that would yield the followingproducts. Name the organic reactant and product ineach reaction. a. alkane b. monohalogenated alkane c. dihalogenated alkane d. tetrahalogenated alkane e. monohalogenated benzene f. alkene 61E 62E 63E 64E 65E 66E 67E 68E 69E 70E 71E 72E 73E 74E 75E 76E 77E 78E 79E 80E 81E 82E 83E 84E 85E 86E 87E 88E 89E 90E 91E 92E 93E 94E 95E Draw the structures of the tripeptides gly-ala-ser andser-ala-gly. How many other tripeptides are possible usingthese three amino acids?97E 98E What types of interactions can occur between the sidechains of the following amino acids that would helpmaintain the tertiary structure of a protein? a. cysteine and cysteine b. glutamine and serine c. glutamic acid and lysine d. proline and leucine 100E 101E 102E 103E 104E 105E 106E 107E 108E 109E 110E 111E 112E 113E 114E 115E 116E 117E 118E 119E 120E

Page: [1][2][3][4][5][6][7][8][9][10]