Bartleby Sitemap - Textbook Solutions
All Textbook Solutions for Chemical Principles
What two first-row transition metals have unexpectedelectron configurations? A statement in the text says thatfirst-row transition metal ions do not have 4s electrons.Why not? Why do transition metal ions often have severaloxidation states, whereas representative metals generallyhave only one?9E10E11E12E13E14E15EDefine each of the following terms. a. coordination compound b. complex ion c. counter ions d. coordination number e. ligand f. chelate g. bidentate17EWhen a metal ion has a coordination number of 2, 4, or6, what are the observed geometries and associated bondangles? For each of the following, give the correct formulasfor the complex ions. a. linear Ag+ complex ions having CN- ligands b. tetrahedral Cu+ complex ions having H2O ligands c. tetrahedral Mn2+ complex ions having oxalateligands d. square planar Pt2+ complex ions having NH3 ligands e. octahedral Fe3+ complex ions having EDTA ligands f. octahedral Co2+ complex ions having Cl- ligands g. octahedral Cr3+ complex ions having ethylenediamineligandsThe compound cisplatin, Pt(NH3)2Cl2 , has been studiedextensively as an antitumor agent. The reaction for thesynthesis of cisplatin is: K2PtCl4(aq)+2NH3(aq)Pt(NH3)2Cl2(s)+2KCl(aq) Write the electron configuration for platinum ion in cisplatin.Most d8 transition metal ions exhibit square planargeometry. With this and the name in mind, draw thestructure of cisplatin.20E21E22E23E24E25E26E27E28E29E30E31E32E33E34E35E36E37EFor the process Co(NH3)5Cl2++Cl2Co(NH3)4Cl2++NH3 What would be the expected ratio of cis to trans isomersin the product?39E40E41E42E43E44E45E46E47E48E49E50E51E52E53EConsider the complex ions Co(NH3)63+,Co(CN)63-,andCoF63- . The wavelengths of absorbed electromagneticradiation for these compounds are (in no specific order)770 nm, 440 nm, and 290 nm. Match the complex ion tothe wavelength of absorbed electromagnetic radiation.55E56EHow many unpaired electrons are in the following complexions? a.Ru(NH3)62+(low-spincase)b.Ni(H2O)62+c.V(en)33+58E59E60E61E62E63E64E65E66E67E68E69AE70AE71AE72AE73AE74AE75AE76AE77AE78AE79AE80AE81AE82AE83AE84AE85AE86AE87AE88AE89AE90AE91AE92AE93AE94AE95AE96AE97CP98CP99CP100CP101CP102CP103CP104CP1E2E3E4E5E6E7E8E9E10E11E12E13E14E15E16E17E18E19E20E21E22E23E24E25E26E27E28E29E30E31E32E33E34E35EThe earth receives 1.81014kJ/s of solar energy. Whatmass of solar material is converted to energy over a 24-hperiod to provide the daily amount of solar energy to theearth? What mass of coal would have to be burned toprovide the same amount of energy? Coal releases 32 kJof energy per gram when burned.37E38E39E40E41E42E43E44E45E46E47E48E49E50E51E52E53E54E55E56E57E58E59E60E61AE62AE63AE64AE65AE66AE67AE68AE69AE70AE71AE72AE73AE74AE75AE76AE77CP78CP79CP80CP81CP82CP84CP1E2EWhy are cyclopropane and cyclobutane so reactive?4E5E6E7EName the five structural isomers of C6H14 .Draw the structural formula for each of the following. a. 3-isobutylhexane b. 2,2,4-trimethylpentane, also called isooctane. Thissubstance is the reference (100 level) for octaneratings. c. 2-tert-butylpentane d. The names given in parts a and c are incorrect. Givethe correct names for these hydrocarbons.10E11EName each of the following cyclic alkanes, and indicatethe formula of the compound.13E14E15E16E17E18E19E20E21E22E23E24E25E26E27E28E29E30EName the following compounds.32E33E34E35E36E37E38E39E40E41EDraw structural formulas for each of the following alcohols.Indicate whether the alcohol is primary, secondary,or tertiary. a. 1-butanol c. 2-methyl-1-butanol b. 2-butanol d. 2-methyl-2-butanol43E44E45E46E47E48E49E50E51E52E53E54E55E56E57E58E59EGive an example reaction that would yield the followingproducts. Name the organic reactant and product ineach reaction. a. alkane b. monohalogenated alkane c. dihalogenated alkane d. tetrahalogenated alkane e. monohalogenated benzene f. alkene61E62E63E64E65E66E67E68E69E70E71E72E73E74E75E76E77E78E79E80E81E82E83E84E85E86E87E88E89E90E91E92E93E94E95EDraw the structures of the tripeptides gly-ala-ser andser-ala-gly. How many other tripeptides are possible usingthese three amino acids?97E98EWhat types of interactions can occur between the sidechains of the following amino acids that would helpmaintain the tertiary structure of a protein? a. cysteine and cysteine b. glutamine and serine c. glutamic acid and lysine d. proline and leucine100E101E102E103E104E105E106E107E108E109E110E111E112E113E114E115E116E117E118E119E120E