Interpretation:
Chemist is testing by running the reaction when different R groups on the two alcohol carbons are used; the correct statement has to be identified.
Concept Introduction:
Pinacol rearrangement: For all glycols Pinacol rearrangement occurs. Unsymmetrical vicinal
Step 1: Add proton (protonation of Pinacol using acid catalyst).
Step 2: Break a bond to give a stable molecules or ions (formation of carbocation).
Step 3: 1, 2-shift (migration of substituent from
Step 4: deprotonation occurs (take a proton away).
Want to see the full answer?
Check out a sample textbook solutionChapter 10 Solutions
Organic Chemistry
- Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)arrow_forwardSelect the stronger acid from pair and explain your reasoning. For stronger acid, write a structural formula for its conjugate base. Q.CH3CH2OH or CH3CH2SHarrow_forwardHighlight in red each acidic location on the organic molecule at left. Highlight in blue each basic location on the organic molecule at right. Note for advanced students: we mean acidic or basic in the Brønsted-Lowry sense only. NH₂ NH₂ × Garrow_forward
- Which one is the difinition of Lewis base? a compound that reacts with water and increases the amount of hydronium ion present a compound that donates a proton (a hydrogen ion, H') to another compound any species that can donate a pair of electrons O any species that can accept a pair of electrons O a compound that accepts a proton (a hydrogen ion, H') from another compoundarrow_forwardPlease answer 6,7,8arrow_forwardDraw the products of the following acid-base reaction.arrow_forward
- Question 46 Which is the better acid? or ethanol acetic acid ethanol acetic acidarrow_forwardFor each structure you drew in the answer to the previous question, classify it as a strong acid,strong base, weak acid, or weak base.arrow_forwardHighlight in red each acidic location on the organic molecule at left. Highlight in blue each basic location on the organic molecule at right. Note for advanced students: we mean acidic or basic in the Brønsted-Lowry sense only. Cl Cl Xarrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage LearningChemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage LearningOrganic Chemistry: A Guided InquiryChemistryISBN:9780618974122Author:Andrei StraumanisPublisher:Cengage Learning