Chromium(VI) forms two different oxyanions, the orange dichromate ion, Cr2O72− , and the yellow chromate ion, CrO42− .
(See the following photos.) The equilibrium reaction between the two ions is
Explain why orange dichromate solutions turn yellow when sodium hydroxide is added.
Want to see the full answer?
Check out a sample textbook solutionChapter 12 Solutions
Chemistry: An Atoms First Approach
- In a particular experiment, the equilibrium constant measured for the reaction, Cl2(g)+NO2(g)Cl2NO2(g), is 2.8. Based on this measurement, calculate AG° for this reaction. Calculate AG° using data from Appendix E at the back of the book and discuss the agreement between your two calculations.arrow_forwardThe following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?arrow_forwardThe creation of shells by mollusk species is a fascinating process. By utilizing the Ca2+ in their food and aqueous environment, as well as some complex equilibrium processes, a hard calcium carbonate shell can be produced. One important equilibrium reaction in this complex process is HCO3(aq)H+(aq)+CO32(aq)K=5.61011 If 0.16 mole of HCO3 is placed into 1.00 L of solution, what will be the equilibrium concentration of CO32?arrow_forward
- The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1arrow_forwardThe experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?arrow_forwardAt a certain temperature, the reaction Xe(g)+2F2(g)XeF4(g)gives a 50.0% yield of XeF4, starting with Xe(Pxe=0.20atm) and F2(PF2=0.40atm). Calculate K at this temperature. What must the initial pressure of F2 be to convert 75.0% of the xenon to XeF4?arrow_forward
- The decomposition of PCl5(g) to form PCl3(g) and Cl2(g) has Kc = 33.3 at a high temperature. If the initial concentration of PCl5 is 0.1000 M, what are the equilibrium concentrations of the reactants and products?arrow_forwardConsider the following equilibria involving SO2(g) and their corresponding equilibrium constants. SO2(g) + 12 O2(g) SO3(g) K1 2SO3(g) 2SO2(g) + O2(g) K2 Which of the following expressions relates K1 to K2? (a) K2=K12 (b) K22=K1 (c) K2 = K1 (d) K2 = 1/K1 (e) K2=1/K12arrow_forward. Mercury(I) chloride, Hg2Cl2, was formerly administered orally as a purgative. Although we usually think of mercury compounds as highly toxic, the K of mercury(I) chloride is small enough (1.31018)that the amount of mercury that dissolves and enters the bloodstream is tiny. Calculate the concentration of mercury(I) ion present in a saturated solution of Hg2Cl2.arrow_forward
- Consider the reaction 2N2O(g) + O2(g) 4NO(g) Suppose the system is at equilibrium, and then an additional mole of N2O(g) is injected into the system at constant temperature. Once the reaction reestablishes equilibrium, has the amount of N2O increased or decreased from its original equilibrium amount? Explain. What happens to the value of the equilibrium constant with this change?arrow_forwardAt room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?arrow_forwardThe value of the equilibrium constant, K, is dependent on which of the following? (There may be more than one answer.) a. the initial concentrations of the reactants b. the initial concentrations of the products c. the temperature of the system d. the nature of the reactants and products Explain.arrow_forward
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry for Engineering StudentsChemistryISBN:9781337398909Author:Lawrence S. Brown, Tom HolmePublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningIntroductory Chemistry: A FoundationChemistryISBN:9781285199030Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage Learning