Concept explainers
Interpretation:
Position of equilibrium for the given acid-base reaction has to be predicted.
Concept introduction:
According to the explanations by Bronsted-Lowry, if a species loses a proton then it is an acid whereas if a species receives one proton, then it is base.
If a base receives one proton, then the formed species is a conjugate acid whereas an acid lose one proton, then the formed species is a conjugated base.
Mixture of acid and base undergoes equilibrium reaction and it’s
Weak acids are more stable and less reactive, so equilibrium follows the direction of formation weak acids in a reaction.
Lesser the
Want to see the full answer?
Check out a sample textbook solutionChapter 23 Solutions
Organic Chemistry
- Rank the following substances in order of increasing acidity: (a) (CH3)2CHOH, HC≡CH, (CF3)2CHOH, CH3OH (b) Phenol, p-methylphenol, p-[trifluoromethyl) phenol (c) Benzyl alcohol, phenol, p-hydroxybenzonic acidarrow_forwardComplete the following acid-base reactions. (a) CH3CH2CH2CH2Li + CH3COOH (b) CH3CH2CH2CH2MgBr + CH3CH2OHarrow_forwardIn each equilibrium, label the stronger acid, the stronger base, the weaker acid, and the weaker base. Also estimate the position of each equilibrium. (a) CH3CH2O + CH3CCH CH3CH2OH + CH3CC (b) CH3CH2O + HCl CH3CH2OH + Cl (c) CH3COOH + CH3CH2O CH3COO + CH3CH2OHarrow_forward
- Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)arrow_forward18-28 Arrange these compounds in order of increasing acidity: benzoic acid, benzyl alcohol, phenol.arrow_forwardWill acetylene react with sodium hydride according to the following equation to form a salt and hydrogen, H2? Using pKa values given in Table 4.1, calculate Keq for this equilibrium.arrow_forward
- Determine which of the following bases is strong enough to deprotonate acetonitrile (CH3CN), so that equilibrium favors the products:(a) NaH; (b) Na2CO3; (c) NaOH; (d) NaNH2; (e) NaHCO3.arrow_forwardWhich of the following has the strongest conjugate base? Group of answer choices benzoic acid (Ka = 6.5 x 10-5) hydrazoic acid (Ka = 1.9 x 10-5) chlorous acid (Ka = 1.1 x 10-2) carbonic acid (Ka = 4.3 x 10-7) chloroacetic acid (Ka = 1.4 x 10-3)arrow_forwardLabel each reactant and product in this reaction as a Brønsted acid or base. HCN+NH−2↽−−⇀CN−+NH3arrow_forward
- Which of these is the strongest base? A) I- B) CO2- 3 C) HPO2- 4 D) H2PO- 4arrow_forwardPredict the products of the following acid–base reactions, or indicate if no significantreaction would take place. H¬C‚C≠- Na+ + CH3OHarrow_forwardWhat is the conjugate acid of each of the following? 1. NH3 2. Cl- 3. HO- 4. H2Oarrow_forward
- Organic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage LearningIntroduction to General, Organic and BiochemistryChemistryISBN:9781285869759Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar TorresPublisher:Cengage Learning