Concept explainers
(a)
Interpretation:
The IUPAC name of
Concept Introduction:
In
In organic chemistry, reduction reaction is referred to the number
Alcohols undergo oxidation reaction and reduction reaction. This depends upon the number of hydrogen atoms that is bonded to the alpha carbon atom. Primary and secondary alcohol undergoes oxidation reaction while tertiary alcohol does not undergo oxidation reaction. Primary alcohols undergo oxidation to give aldehyde and carboxylic acid as product. Secondary alcohol undergoes oxidation to give ketone as the product.
Aldehyde undergoes oxidation to give carboxylic acid as the product while ketone does not undergo oxidation reaction.
The reverse of
(b)
Interpretation:
The IUPAC name of aldehyde or ketone that is required to prepare the given compound either by oxidation or reduction has to be given.
Concept Introduction:
In organic chemistry, oxidation reaction is referred to the number
In organic chemistry, reduction reaction is referred to the number
Alcohols undergo oxidation reaction and reduction reaction. This depends upon the number of hydrogen atoms that is bonded to the alpha carbon atom. Primary and secondary alcohol undergoes oxidation reaction while tertiary alcohol does not undergo oxidation reaction. Primary alcohols undergo oxidation to give aldehyde and carboxylic acid as product. Secondary alcohol undergoes oxidation to give ketone as the product.
Aldehyde undergoes oxidation to give carboxylic acid as the product while ketone does not undergo oxidation reaction.
The reverse of oxidation reaction is reduction reaction. Reduction of aldehyde gives primary alcohol as the product and reduction of ketone gives secondary alcohol as the product. Reduction can be accomplished using hydrogen gas and a metal catalyst namely nickel.
(c)
Interpretation:
The IUPAC name of aldehyde or ketone that is required to prepare the given compound either by oxidation or reduction has to be given.
Concept Introduction:
In organic chemistry, oxidation reaction is referred to the number
In organic chemistry, reduction reaction is referred to the number
Alcohols undergo oxidation reaction and reduction reaction. This depends upon the number of hydrogen atoms that is bonded to the alpha carbon atom. Primary and secondary alcohol undergoes oxidation reaction while tertiary alcohol does not undergo oxidation reaction. Primary alcohols undergo oxidation to give aldehyde and carboxylic acid as product. Secondary alcohol undergoes oxidation to give ketone as the product.
Aldehyde undergoes oxidation to give carboxylic acid as the product while ketone does not undergo oxidation reaction.
The reverse of oxidation reaction is reduction reaction. Reduction of aldehyde gives primary alcohol as the product and reduction of ketone gives secondary alcohol as the product. Reduction can be accomplished using hydrogen gas and a metal catalyst namely nickel.
(d)
Interpretation:
The IUPAC name of aldehyde or ketone that is required to prepare the given compound either by oxidation or reduction has to be given.
Concept Introduction:
In organic chemistry, oxidation reaction is referred to the number
In organic chemistry, reduction reaction is referred to the number
Alcohols undergo oxidation reaction and reduction reaction. This depends upon the number of hydrogen atoms that is bonded to the alpha carbon atom. Primary and secondary alcohol undergoes oxidation reaction while tertiary alcohol does not undergo oxidation reaction. Primary alcohols undergo oxidation to give aldehyde and carboxylic acid as product. Secondary alcohol undergoes oxidation to give ketone as the product.
Aldehyde undergoes oxidation to give carboxylic acid as the product while ketone does not undergo oxidation reaction.
The reverse of oxidation reaction is reduction reaction. Reduction of aldehyde gives primary alcohol as the product and reduction of ketone gives secondary alcohol as the product. Reduction can be accomplished using hydrogen gas and a metal catalyst namely nickel.
Want to see the full answer?
Check out a sample textbook solutionChapter 15 Solutions
General, Organic, and Biological Chemistry
- Identify the most important aldehyde and ketone from Section 14.4 on the basis of amount used, and list at least one characteristic for each that contributes to its usefulness.arrow_forwardThe presence of what product of the autooxidation of ethers makes the distillation of ethers dangerous?arrow_forward1) identify the reactant/s in the chemical equation and circle it, also name its major functional group 2) identify the product/s in the chemical equation (circle it) and name its functional group 3) is the a reversible reaction or not? How do we knowarrow_forward
- What would be the organic product for each reaction?arrow_forwardWhat explains why many aldehydes and ketones can undergo self- condensation reactions in basic conditions? A. The alpha carbon can lose a proton and act like a nucleophile and the carbonyl carbon a an electrophile B. The alpha carbon can gain a proton and act like an electrophile and the carbonyl carbon is a nucleophile C. The oxygen of the carbonyl group can attack the carbon of the carbonyl group D. Only esters can undergo self-condensation reactionsarrow_forwardDraw the organic products formed when attached allylic alcohol A is treated with following reagent. HCrO4−–Amberlyst A-26 resinarrow_forward
- List the reagents necessary to produce the given product.arrow_forward8 Name the following ketones and aldehydes. When possible, give both a common name and an IUPAC name. ) CH3(CH2)2CO(CH2)2CH3arrow_forwardDraw the major organic product formed in the following reaction. (The reaction stoichiometry is 1 mol reactant: 1 mol Br2.)arrow_forward
- What is the IUPAC name of the product formed in the following reaction?arrow_forwardMaltose is a carbohydrate present in malt, the liquid obtained from barley and other grains. Although maltose has numerous functional groups, its reactions are explained by the same principles we have already encountered.a. Label the acetal and hemiacetal carbons.b. What products are formed when maltose is treated with each of these reagents: [1] H3O+; [2] CH3OH and HCl; [3] excess NaH, then excess CH3I?c. Draw the products formed when the compound formed in Reaction [3] of part (b) is treated with aqueous acid.The reactions in parts (b) and (c) are used to determine structural features of carbohydrates like maltose.arrow_forward1-Octen-3-ol is a potent mosquito attractant commonly used in mosquito traps. A number of reactions, including hydrogenation, will transform 1-octen-3-ol into a less effective molecule. Draw the structure of a hydrogenation product of 1-octen-3-ol.arrow_forward
- Chemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage LearningOrganic Chemistry: A Guided InquiryChemistryISBN:9780618974122Author:Andrei StraumanisPublisher:Cengage Learning