(a) Interpretation: The product of a reaction between a given organic compound and Tollens reagent should be determined: Concept Introduction: Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry , there are different functional groups such as carboxylic acid , alcohol, ester, or amide. Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Question

Want to see the full answer?

Answer 1

Question

Chapter 16, Problem 16.54P

Interpretation Introduction

(a)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(b)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(c)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(d)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Expert Solution & Answer

Want to see the full answer?

Check out a sample textbook solution

See solution

Students have asked these similar questions

What product is formed when benzene is treated with each organic halide in the presence of AlCl3?

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?

Answer 2

Question

Chapter 16, Problem 16.54P

Interpretation Introduction

(a)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(b)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(c)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(d)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Expert Solution & Answer

Want to see the full answer?

Check out a sample textbook solution

See solution

Answer 3

Question

Chapter 16, Problem 16.54P

Interpretation Introduction

(a)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(b)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(c)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(d)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Expert Solution & Answer

Want to see the full answer?

Check out a sample textbook solution

See solution

Answer 4

Question

Chapter 16, Problem 16.54P

Interpretation Introduction

(a)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(b)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(c)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(d)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Expert Solution & Answer

Want to see the full answer?

Check out a sample textbook solution

See solution

Answer 5

Chapter 16, Problem 16.54P

Interpretation Introduction

(a)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(b)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(c)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Interpretation Introduction

(d)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Answer 6

Chapter 16, Problem 16.54P

Interpretation Introduction

(a)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Answer 7

Chapter 16, Problem 16.54P

Interpretation Introduction

(a)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Answer 8

Interpretation Introduction

(b)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Answer 9

Interpretation Introduction

(b)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Answer 10

Interpretation Introduction

(c)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Answer 11

Interpretation Introduction

(c)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Answer 12

Interpretation Introduction

(d)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Answer 13

Interpretation Introduction

(d)

Interpretation:

The product of a reaction between a given organic compound and Tollens reagent should be determined:

Concept Introduction:

Functional groups are the groups of atoms or atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound. In organic chemistry, there are different functional groups such as carboxylic acid, alcohol, ester, or amide.

Carbonyl compounds are organic compounds with >C=O as a functional group in the molecule. It can be aldehyde and ketones that depend on the presence of the alkyl group bonded on the carbonyl carbon atom.

Answer 14

Expert Solution & Answer

Answer 15

Expert Solution & Answer

Answer 16

Want to see the full answer?

Check out a sample textbook solution

See solution

Answer 17

Ch. 16.1 - Prob. 16.1P Ch. 16.1 - Draw the structure of the three constitutional...Ch. 16.2 - Prob. 16.3P Ch. 16.2 - Give the structure corresponding to each TUPAC...Ch. 16.2 - Prob. 16.5P Ch. 16.2 - Prob. 16.6P Ch. 16.2 - Give the structure corresponding to each name. a....Ch. 16.3 - Which compound in each pair has the higher boiling...Ch. 16.3 - Acetone and progesterone are two ketones that...Ch. 16.4 - Prob. 16.10P

Solution Summary: The author explains that functional groups are the groups of atoms which are bonded with the parent carbon chain in the organic molecule and are responsible for the physical and chemical properties of the compound.

Concept explainers

Want to see the full answer?

Chapter 16 Solutions