Concept explainers
Interpretation:
For the given proton transfer reaction, which side of the reaction is favored, and by what numerical factor, is to be predicted.
Concept introduction:
A proton transfer reaction is the one in which a Bronsted Lowry base reacts with a Bronsted Lowry acid to form a conjugate base and a conjugate acid respectively.
A reaction’s tendency to form products is described by its equilibrium constant Keq. A very large Keq favors the products side, while a very small Keq value heavily favors the reactants.
A proton transfer reaction favors the side opposite the stronger acid (i.e., opposite to the lower pKa value). Each difference of one in pKa values between the two acids corresponds to a power of ten by which that side of the reaction is favored.
Want to see the full answer?
Check out a sample textbook solutionChapter 6 Solutions
ORGANIC CHEMISTRY E-BOOK W/SMARTWORK5
- Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)arrow_forward2. Place the following carboxylic acids in their correct order of acidity. 1=Most acidic and 4=least acidic.arrow_forwardWhy are terminal alkynes a lot more acidic than alkanes? - More hydrogen atoms on a sp^3 Carbon - C-C triple bond is stronger than a single bond - Sp1 Carbon in terminal alkynes stabilize conjugate bases. - none of the abovearrow_forward
- Fix each molecule in the drawing area below so that it has the structure it would have if it were dissolved in a 0.1 (aq) solution of NaOH 3-hydroxypropanoic acid and 1,3-dihydroxy-2-propanone .arrow_forwardChemistry complete for a rate. answer both questions for a rate 1. write out the mechanism for the reaction between ethyne and NaNH2. Label the acid snd the base predicting which way the reaction is favored. 2. do the same for C6H5OH and CH3CH2ONaarrow_forwardWhat base is best for the Claisen reaction in the diagram? 1. NaOEt 2. NaOMe 3. NaOCH2Ph 4. NaOPh 5. Any of the above would work equally wellarrow_forward
- Complete each Lewis structure, draw all important resonance structures, predict a value for thebond angles requested, and explain your reasoning. a. Nitrous acid (HNO2)HONOHON=ONO= b. Enolate ion (C2H3O) HC1C2=HC2C1=arrow_forwardNaNH2 is typically used instead of KOH to produce alkynes through elimination because NaNH2 is a stronger base. Explain why KOH can be used to create diphenylacetylene.arrow_forward1. Rank the following species in order of increasing acidity. Explain your reasons for ordering them as you do. HF NH3 H2SO4 CH3OH CH3COOH H3O+ H2O2. Consider the following compounds that vary from nearly nonacidic to strongly acidic. Draw the conjugate bases of these compounds, and explain why the acidity increases so dramatically with substitution by nitro groups. CH4 CH3NO2 CH2(NO2)2 CH(NO2)3arrow_forward
- Rank the following compounds in order of increasing acidity (1 = least acidic, 3 = most acidic) and in the space provided use resonance (of the conjugate base) to explain why the compound you have labelled “3” is the most acidic.arrow_forwardWrite an equation for the acid-base reaction between ethylmagnesium iodide and an alcohol. Use curved arrows to show the flow of electrons in this reaction. In addition, show by using appropriate pKa values that this reaction is an example of a stronger acid and stronger base reacting to give a weaker acid and weaker base.arrow_forwardGive a test to distinguish between propan-2-one and pentan-3-one.arrow_forward
- Organic Chemistry: A Guided InquiryChemistryISBN:9780618974122Author:Andrei StraumanisPublisher:Cengage LearningOrganic ChemistryChemistryISBN:9781305580350Author:William H. Brown, Brent L. Iverson, Eric Anslyn, Christopher S. FootePublisher:Cengage Learning