Silver undergoes similar reactions as those shown for gold. Both metals react with cyanide ion in the presence of oxygen to form soluble complexes, and both are reduced by zinc. The reaction of Ag+ with cyanide ion may be viewed as two sequential steps:
(1)
(2)
- a. Use the solubility product equilibrium constant (Appendix J) of AgCN(s) to determine the equilibrium constant for Step 1.
- b. Use the equilibrium constants from Step 1 and the overall reaction to determine the equilibrium constant for Step 2.
- c. Excess AgCN(s) is combined with 1.0 L of 0.0071 M CN− (aq) and allowed to equilibrate. Calculate the equilibrium concentrations of CN− and [Ag(CN)2]− using the equilibrium constant for Step 2. Assume no change in volume occurs.
Want to see the full answer?
Check out a sample textbook solutionChapter 17 Solutions
Chemistry & Chemical Reactivity
- What is the approximate value of the equilibrium constant KP for the change C2H5OC2H5(l)C2H5OC2H5(g) at 25 C. {Vapor pressure was described in the previous Chapter on liquids and solids; refer back to this chapter to find the relevant information needed to solve this problem.)arrow_forwardThe standard equilibrium constant is 2.1109for this reaction at 25 C Zn2+(aq)+4NH3(aq)Zn(NH3)42+(aq) (a) Calculate rG at this temperature. (b) If standard-state concentrations of the reactants andproducts are combined, in which direction will the reaction proceed? (c) Calculate rG when [Zn(NH3)42+] = 0.010 M, [Zn2+] =0.0010 M, and [NH3] = 3.5104M.arrow_forwardTitanium(IV) oxide is converted to titanium carbide with carbon at a high temperature. TiO2(s) + 3 C(s) 2 CO(g) + TiC(s) (a) Calculate rG and K at 727 C. (b) Is the reaction product-favored at equilibrium at this temperature? (c) How can the reactant or product concentrations be adjusted for the reaction to proceed at 727 C?arrow_forward
- The following data were collected for a system at equilibrium at 140°C. Calculate the equilibrium constant for the reaction, 3 H2(g) + N2(g) 5=^ 2 NHt(g) at this temperature. [H2] = 0.10 mol L_1, [NJ = 1.1 mol L"1, [NHJ = 3.6 X 10"-mol L'1arrow_forwardExplain the difference between K, Kp, and Q.arrow_forwardConsider the following equilibria involving SO2(g) and their corresponding equilibrium constants. SO2(g) + 12 O2(g) SO3(g) K1 2SO3(g) 2SO2(g) + O2(g) K2 Which of the following expressions relates K1 to K2? (a) K2=K12 (b) K22=K1 (c) K2 = K1 (d) K2 = 1/K1 (e) K2=1/K12arrow_forward
- The reaction, 3 H2(g) + N2(g) (g), has the fol lowing equilibrium constants at the temperatures given: atT=25°C,K= 2.8 X 104 at T = 500°C, A = 2.4 X IO"7 At which temperature are reactants favored? At which temperature are products favored? YVhat can you say about the reaction if the equilibrium constant is 1.2 at 127°C?arrow_forwardKp for the formation of phosgene, COCl2, is 6.5 1011 at 25 C. CO(g) + Cl2(g) COCl2(g) What is the value of Kp for the dissociation of phosgene? COCl2(g) CO(g) + Cl2(g)arrow_forwardIf wet silver carbonate is dried in a stream of hot air. the air must have a certain concentration level of carbon dioxide to prevent silver carbonate from decomposing by the reaction Ag2CO3(s)Ag2O(s)+CO2(g) H for this reaction is 79.14 kJ/mol in the temperature range of 25 to 125C. Given that the partial pressure of carbon dioxide in equilibrium with pure solid silver carbonate is 6.23 103 torr at 25C, calculate the partial pressure of CO2 necessary to prevent decomposition ofAg2CO3 at 110C. (Hint: Manipulate the equation in Exercise 79.)arrow_forward
- Given the following descriptions of reversible reactions, write a balanced net ionic equation (simplest whole-number coefficients) and the equilibrium constant expression (K) for each. (a) Liquid acetone (C3H6O) is in equilibrium with its vapor. (b) Hydrogen gas reduces nitrogen dioxide gas to form ammonia and steam. (c) Hydrogen sulfide gas (H2S) bubbled into an aqueous solution of lead(ll) ions produces lead sulfide precipitate and hydrogen ions.arrow_forwardWrite the mathematical expression for the reaction quotient, QC, for each of the following reactions: (a) CH4(g)+CI2CH3CI(g)+HCI(g) (b) N2(g)+O2(g)2NO(g) (c) 2SO2(g)+O2(g)2SO3(g) (d) BaSO3(s)BaO(s)+SO2(g) (e) P4(g)+5O2(g)P4O10(s) (f) Br2(g)2Br(g) (g) CH4(g)+2O2(g)CO2(g)+2H2O(l) (h) CuSO45H2O(s)CuSO4(s)+5H2O(g)arrow_forwardMany sugars undergo a process called mutarotation, in which the sugar molecules interconvert between two isomeric forms, finally reaching an equilibrium between them. This is true for the simple sugar glucose, C6H12O6, which exists in solution in isomeric forms called alpha-glucose and beta-glucose. If a solution of glucose at a certain temperature is analyzed, and it is found that the concentration of alpha-glucose is twice the concentration of beta-glucose, what is the value of K for the interconversion reaction?arrow_forward
- Chemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage LearningChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage Learning