Concept explainers
(a)
Interpretation:
The standard heat of the formaldehyde formation from methanol and oxygen reaction given by the equation should be calculated.
And standard heat of combustion of hydrogen is given by the equation:
Concept introduction:
The standard heat of combustion is the number of calories or the total energy generated as heat when a certain compound goes through combustion in presence of oxygen under the standard conditions. Generally, a hydrocarbon reacts with oxygen in this type of reaction. This is also an exothermic reaction as it generates heat energy.
In Hess’s law, enthalpy change which involved in the chemical reactions are same, it doesn’t matter the steps involved in the reactions.
(b)
Interpretation:
The need of following the Hess’s Law to find the standards of reaction the given equation in sub part (a) should be explained.
Concept introduction:
The standard heat of combustion is the number of calories or the total energy generated as heat when a certain compound goes through combustion in presence of oxygen under the standard conditions. Generally, a hydrocarbon reacts with oxygen in this type of reaction. This is also an exothermic reaction as it generates heat energy.
In Hess’s law, enthalpy change which involved in the chemical reactions are same, it doesn’t matter the steps involved in the reactions. This reaction seems to be an endothermic reaction.
Want to see the full answer?
Check out a sample textbook solutionChapter 9 Solutions
EBK ELEMENTARY PRINCIPLES OF CHEMICAL P
- The formation of aluminum oxide from its elements is highly exothermic. If 2.70 g Al metal is burned in pure O2 to give A12O3, calculate how much thermal energy is evolved in the process (at constant pressure).arrow_forwardYou did an experiment in which you found that 59.8 J was required to raise the temperature of 25.0 g of ethylene glycol (a compound used as antifreeze in automobile engines) by 1.00 K. Calculate the specific heat capacity of ethylene glycol from these data.arrow_forward2. In which of the following reactions is there a significant transfer of energy as work from the system to the surroundings? This occurs if there is a change in the number of moles of gases. C(s) + O2(g) → CO2(g) CH4(g) + 2 O2(g) → CO2g) + 2 H2O(g) 2 C(s) + O2(g) → 2 CO(g) 2 Mg(s) + O2(g) → 2 MgO(s)arrow_forward
- Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.arrow_forwardWhite phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.arrow_forwardCalculate the standard enthalpy of combustion for benzene, C6H6. C6H6() + 15/2 O2(g) 6 CO2(g) + 3 H2O() rH = ? The enthalpy of formation of benzene is known [rH[C6H6()] = +49.0 kJ/mol], and other values needed can be found in Appendix L.arrow_forward
- When 1.000 g of gaseous butane, C4H10, is burned at 25C and 1.00 atm pressure, H2O(l) and CO2(g) are formed with the evolution of 49.50 kJ of heat. a Calculate the molar enthalpy of formation of butane. (Use enthalpy of formation data for H2O and CO2.) b Gf of butane is 17.2 kJ/mol. What is G for the combustion of 1 mol butane? c From a and b, calculate S for the combustion of 1 mol butane.arrow_forwardWhen 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?arrow_forwardNitrogen gas (2.75 L) is confined in a cylinder under constant atmospheric pressure (1.01 105 pascals). The volume of gas decreases to 2.10 L when 485 J of energy is transferred as heat to the surroundings. What is the change in internal energy of the gas?arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage Learning
- Chemistry: Principles and PracticeChemistryISBN:9780534420123Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward MercerPublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage LearningPhysical ChemistryChemistryISBN:9781133958437Author:Ball, David W. (david Warren), BAER, TomasPublisher:Wadsworth Cengage Learning,